Index of /public/Press Releases
![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[ ]](/icons/layout.gif) | Pagesfrom12.03.15.pdf | 2024-10-04 11:53 | 11K | |
![[ ]](/icons/layout.gif) | Wellington.pdf | 2024-10-04 11:53 | 13K | |
![[ ]](/icons/layout.gif) | Ambulance Company Ow..> | 2024-10-04 11:53 | 16K | |
![[ ]](/icons/layout.gif) | KC Woman Sentenced f..> | 2024-10-04 11:53 | 17K | |
![[ ]](/icons/layout.gif) | Former Gary Firefigh..> | 2024-10-04 11:53 | 17K | |
![[ ]](/icons/layout.gif) | Ponte Vedra Man Indi..> | 2024-10-04 11:53 | 17K | |
![[ ]](/icons/layout.gif) | New York Woman Sente..> | 2024-10-04 11:53 | 17K | |
![[ ]](/icons/layout.gif) | roofing.pdf | 2024-10-04 11:53 | 17K | |
![[ ]](/icons/layout.gif) | Union Treasurer Sent..> | 2024-10-04 11:53 | 17K | |
![[ ]](/icons/layout.gif) | Chiropractor Pleads ..> | 2024-10-04 11:53 | 18K | |
![[ ]](/icons/layout.gif) | Former Charleston Jo..> | 2024-10-04 11:53 | 18K | |
![[ ]](/icons/layout.gif) | Former Business Mana..> | 2024-10-04 11:53 | 18K | |
![[ ]](/icons/layout.gif) | Former Charleston Jo..> | 2024-10-04 11:53 | 18K | |
![[ ]](/icons/layout.gif) | Former Felon Sentenc..> | 2024-10-04 11:53 | 18K | |
![[ ]](/icons/layout.gif) | North Miami Beach Re..> | 2024-10-04 11:53 | 18K | |
![[ ]](/icons/layout.gif) | Maimi Resident Unemp..> | 2024-10-04 11:53 | 18K | |
![[ ]](/icons/layout.gif) | Israeli Owner of Mal..> | 2024-10-04 11:53 | 18K | |
![[ ]](/icons/layout.gif) | Rochester Couple Cha..> | 2024-10-04 11:53 | 18K | |
![[ ]](/icons/layout.gif) | Collin County Man Co..> | 2024-10-04 11:53 | 18K | |
![[ ]](/icons/layout.gif) | Buffalo Man Indicted..> | 2024-10-04 11:53 | 19K | |
![[ ]](/icons/layout.gif) | Ex Siu-E Employee Pl..> | 2024-10-04 11:53 | 19K | |
![[ ]](/icons/layout.gif) | CFO of Local Drywall..> | 2024-10-04 11:53 | 19K | |
![[ ]](/icons/layout.gif) | United States Postal..> | 2024-10-04 11:53 | 19K | |
![[ ]](/icons/layout.gif) | Identity Theft Ring ..> | 2024-10-04 11:53 | 19K | |
![[ ]](/icons/layout.gif) | Guilty Plea in Schem..> | 2024-10-04 11:53 | 19K | |
![[ ]](/icons/layout.gif) | Couple Pleads Guilty..> | 2024-10-04 11:53 | 19K | |
![[ ]](/icons/layout.gif) | Lee Summit Business ..> | 2024-10-04 11:53 | 19K | |
![[ ]](/icons/layout.gif) | Union Officer to Ple..> | 2024-10-04 11:53 | 20K | |
![[ ]](/icons/layout.gif) | Scranton Business Ow..> | 2024-10-04 11:53 | 20K | |
![[ ]](/icons/layout.gif) | Virginia Man Admits ..> | 2024-10-04 11:53 | 20K | |
![[ ]](/icons/layout.gif) | Diagnostic Company O..> | 2024-10-04 11:53 | 20K | |
![[ ]](/icons/layout.gif) | Federal Grand Jury I..> | 2024-10-04 11:53 | 20K | |
![[ ]](/icons/layout.gif) | Battle Creek Hotel O..> | 2024-10-04 11:53 | 20K | |
![[ ]](/icons/layout.gif) | West Palm Beach Man ..> | 2024-10-04 11:53 | 20K | |
![[ ]](/icons/layout.gif) | Union Official Plead..> | 2024-10-04 11:53 | 20K | |
![[ ]](/icons/layout.gif) | Suburban Physician I..> | 2024-10-04 11:53 | 20K | |
![[ ]](/icons/layout.gif) | Union Bookkeeper Who..> | 2024-10-04 11:53 | 20K | |
![[ ]](/icons/layout.gif) | North Miami Resident..> | 2024-10-04 11:53 | 20K | |
![[ ]](/icons/layout.gif) | Former AFLAC Employe..> | 2024-10-04 11:53 | 20K | |
![[ ]](/icons/layout.gif) | New Madrid County Ma..> | 2024-10-04 11:53 | 20K | |
![[ ]](/icons/layout.gif) | H-1B Tech Staffing C..> | 2024-10-04 11:53 | 20K | |
![[ ]](/icons/layout.gif) | Postal Union Steward..> | 2024-10-04 11:53 | 21K | |
![[ ]](/icons/layout.gif) | FloridaWomanSentence..> | 2024-10-04 11:53 | 21K | |
![[ ]](/icons/layout.gif) | Union Officer Pleads..> | 2024-10-04 11:53 | 21K | |
![[ ]](/icons/layout.gif) | Owner of Mall Kiosk ..> | 2024-10-04 11:53 | 21K | |
![[ ]](/icons/layout.gif) | Clinic owner and UPS..> | 2024-10-04 11:53 | 21K | |
![[ ]](/icons/layout.gif) | Miami Resident Sente..> | 2024-10-04 11:53 | 21K | |
![[ ]](/icons/layout.gif) | Sacramento Woman Sen..> | 2024-10-04 11:53 | 22K | |
![[ ]](/icons/layout.gif) | Kentucky Otolaryngol..> | 2024-10-04 11:53 | 22K | |
![[ ]](/icons/layout.gif) | Former Stockton Woma..> | 2024-10-04 11:53 | 22K | |
![[ ]](/icons/layout.gif) | Federal Grand Jury I..> | 2024-10-04 11:53 | 22K | |
![[ ]](/icons/layout.gif) | Former director of C..> | 2024-10-04 11:53 | 22K | |
![[ ]](/icons/layout.gif) | Broward County Resid..> | 2024-10-04 11:53 | 22K | |
![[ ]](/icons/layout.gif) | Two Union Officials ..> | 2024-10-04 11:53 | 23K | |
![[ ]](/icons/layout.gif) | Manager of Clothing ..> | 2024-10-04 11:53 | 23K | |
![[ ]](/icons/layout.gif) | Former Facilities Ma..> | 2024-10-04 11:53 | 23K | |
![[ ]](/icons/layout.gif) | North Miami Beach Re..> | 2024-10-04 11:53 | 23K | |
![[ ]](/icons/layout.gif) | Former Thornton Woma..> | 2024-10-04 11:53 | 23K | |
![[ ]](/icons/layout.gif) | Six Additional India..> | 2024-10-04 11:53 | 23K | |
![[ ]](/icons/layout.gif) | Former Worksource De..> | 2024-10-04 11:53 | 23K | |
![[ ]](/icons/layout.gif) | Five Indiana Kentuck..> | 2024-10-04 11:53 | 23K | |
![[ ]](/icons/layout.gif) | Brunswick couple cha..> | 2024-10-04 11:53 | 23K | |
![[ ]](/icons/layout.gif) | Andover Man Pleads G..> | 2024-10-04 11:53 | 24K | |
![[ ]](/icons/layout.gif) | Former political can..> | 2024-10-04 11:53 | 24K | |
![[ ]](/icons/layout.gif) | Rocky River executiv..> | 2024-10-04 11:53 | 24K | |
![[ ]](/icons/layout.gif) | Virginia Immigration..> | 2024-10-04 11:53 | 24K | |
![[ ]](/icons/layout.gif) | Owner Of Information..> | 2024-10-04 11:53 | 24K | |
![[ ]](/icons/layout.gif) | Beam Bros. Trucking ..> | 2024-10-04 11:53 | 25K | |
![[ ]](/icons/layout.gif) | PaigeSettlementValle..> | 2024-10-04 11:53 | 25K | |
![[ ]](/icons/layout.gif) | Last Defendant In $4..> | 2024-10-04 11:53 | 25K | |
![[ ]](/icons/layout.gif) | Former UAW Official ..> | 2024-10-04 11:53 | 25K | |
![[ ]](/icons/layout.gif) | Ohio Woman Sentenced..> | 2024-10-04 11:53 | 25K | |
![[ ]](/icons/layout.gif) | Husband and Wife Fro..> | 2024-10-04 11:53 | 25K | |
![[ ]](/icons/layout.gif) | Painting Contractor ..> | 2024-10-04 11:53 | 25K | |
![[ ]](/icons/layout.gif) | Olathe Woman Sentenc..> | 2024-10-04 11:53 | 25K | |
![[ ]](/icons/layout.gif) | Sutter County Women ..> | 2024-10-04 11:53 | 25K | |
![[ ]](/icons/layout.gif) | Pharmaceutical Emplo..> | 2024-10-04 11:53 | 25K | |
![[ ]](/icons/layout.gif) | Two Stockton Men Cha..> | 2024-10-04 11:53 | 25K | |
![[ ]](/icons/layout.gif) | Washington Business ..> | 2024-10-04 11:53 | 26K | |
![[ ]](/icons/layout.gif) | Pharmaceutical Emplo..> | 2024-10-04 11:53 | 26K | |
![[ ]](/icons/layout.gif) | Two Pharmaceutical E..> | 2024-10-04 11:53 | 26K | |
![[ ]](/icons/layout.gif) | Commercial Construct..> | 2024-10-04 11:53 | 26K | |
![[ ]](/icons/layout.gif) | Former Postal Employ..> | 2024-10-04 11:53 | 26K | |
![[ ]](/icons/layout.gif) | Capitol Heights Post..> | 2024-10-04 11:53 | 27K | |
![[ ]](/icons/layout.gif) | HUSBAND AND WIFE IND..> | 2024-10-04 11:53 | 27K | |
![[ ]](/icons/layout.gif) | Member of Dockworker..> | 2024-10-04 11:53 | 27K | |
![[ ]](/icons/layout.gif) | High Desert Woman Ch..> | 2024-10-04 11:53 | 27K | |
![[ ]](/icons/layout.gif) | Osteopathic Doctor P..> | 2024-10-04 11:53 | 28K | |
![[ ]](/icons/layout.gif) | Federal Jury Convict..> | 2024-10-04 11:53 | 28K | |
![[ ]](/icons/layout.gif) | Woodbury Woman Plead..> | 2024-10-04 11:53 | 28K | |
![[ ]](/icons/layout.gif) | Pleasantville Guidan..> | 2024-10-04 11:53 | 29K | |
![[ ]](/icons/layout.gif) | General Foreman At P..> | 2024-10-04 11:53 | 29K | |
![[ ]](/icons/layout.gif) | Two former labor uni..> | 2024-10-04 11:53 | 29K | |
![[ ]](/icons/layout.gif) | Fiat Chryslers Forme..> | 2024-10-04 11:53 | 29K | |
![[ ]](/icons/layout.gif) | Former FCA Executive..> | 2024-10-04 11:53 | 30K | |
![[ ]](/icons/layout.gif) | Three Indicted in Im..> | 2024-10-04 11:53 | 30K | |
![[ ]](/icons/layout.gif) | 2nd Former Newport P..> | 2024-10-04 11:53 | 30K | |
![[ ]](/icons/layout.gif) | Former Union Officia..> | 2024-10-04 11:53 | 30K | |
![[ ]](/icons/layout.gif) | Local Attorney Plead..> | 2024-10-04 11:53 | 31K | |
![[ ]](/icons/layout.gif) | Atlantic County New ..> | 2024-10-04 11:53 | 31K | |
![[ ]](/icons/layout.gif) | State Labor Commissi..> | 2024-10-04 11:53 | 31K | |
![[ ]](/icons/layout.gif) | Atlantic County Man ..> | 2024-10-04 11:53 | 32K | |
![[ ]](/icons/layout.gif) | huniskcer joel sent_..> | 2024-10-04 11:53 | 32K | |
![[ ]](/icons/layout.gif) | Federal Grant Fraud ..> | 2024-10-04 11:53 | 32K | |
![[ ]](/icons/layout.gif) | Pleasantville, new j..> | 2024-10-04 11:53 | 32K | |
![[ ]](/icons/layout.gif) | Pharmaceutical Emplo..> | 2024-10-04 11:53 | 32K | |
![[ ]](/icons/layout.gif) | Leshner, Cory Senten..> | 2024-10-04 11:53 | 33K | |
![[ ]](/icons/layout.gif) | FORMER BUSINESS MANA..> | 2024-10-04 11:53 | 33K | |
![[ ]](/icons/unknown.gif) | BoltonLarosaPleaPR.PDF | 2024-10-04 11:53 | 33K | |
![[ ]](/icons/layout.gif) | DeAlmeida Lino Plea ..> | 2024-10-04 11:53 | 33K | |
![[ ]](/icons/layout.gif) | carrasco sent_7_26_1..> | 2024-10-04 11:53 | 33K | |
![[ ]](/icons/layout.gif) | DePiro Stephen Sente..> | 2024-10-04 11:53 | 33K | |
![[ ]](/icons/layout.gif) | New Jersey Woman Adm..> | 2024-10-04 11:53 | 33K | |
![[ ]](/icons/layout.gif) | Cleaning Company Own..> | 2024-10-04 11:53 | 33K | |
![[ ]](/icons/layout.gif) | Hartley Thomas Ind_1..> | 2024-10-04 11:53 | 34K | |
![[ ]](/icons/layout.gif) | Mohammad Wahid and M..> | 2024-10-04 11:53 | 34K | |
![[ ]](/icons/layout.gif) | Moe Paul Indictment ..> | 2024-10-04 11:53 | 34K | |
![[ ]](/icons/layout.gif) | Cape Girardeau Count..> | 2024-10-04 11:53 | 34K | |
![[ ]](/icons/layout.gif) | East Windsor Woman C..> | 2024-10-04 11:53 | 34K | |
![[ ]](/icons/layout.gif) | Johnson Charles Ind_..> | 2024-10-04 11:53 | 35K | |
![[ ]](/icons/layout.gif) | Sinking Spring_PA Ma..> | 2024-10-04 11:53 | 35K | |
![[ ]](/icons/layout.gif) | carrasco perjury GP_..> | 2024-10-04 11:53 | 35K | |
![[ ]](/icons/layout.gif) | Former_US_Postal_Ser..> | 2024-10-04 11:53 | 35K | |
![[ ]](/icons/layout.gif) | Elizabeth Honig Plea..> | 2024-10-04 11:53 | 35K | |
![[ ]](/icons/layout.gif) | Doctor Sentenced to ..> | 2024-10-04 11:53 | 35K | |
![[ ]](/icons/layout.gif) | MARGATE, NEW JERSEY,..> | 2024-10-04 11:53 | 35K | |
![[ ]](/icons/layout.gif) | Vice President of Lo..> | 2024-10-04 11:53 | 35K | |
![[ ]](/icons/layout.gif) | Fink_Nagle 12.1.16.pdf | 2024-10-04 11:53 | 35K | |
![[ ]](/icons/layout.gif) | TENNESSEE COUPLE SEN..> | 2024-10-04 11:53 | 35K | |
![[ ]](/icons/layout.gif) | Wiseman Garrett Sent..> | 2024-10-04 11:53 | 35K | |
![[ ]](/icons/layout.gif) | HCF_Buchanan Sent_2_..> | 2024-10-04 11:53 | 35K | |
![[ ]](/icons/layout.gif) | Gayl Joshua Plea PR ..> | 2024-10-04 11:53 | 36K | |
![[ ]](/icons/layout.gif) | Hall Earl Trial_3_10..> | 2024-10-04 11:53 | 36K | |
![[ ]](/icons/layout.gif) | Miami-Dade County Br..> | 2024-10-04 11:53 | 36K | |
![[ ]](/icons/layout.gif) | Former Executive wit..> | 2024-10-04 11:53 | 36K | |
![[ ]](/icons/layout.gif) | HathawayWilliamKrist..> | 2024-10-04 11:53 | 36K | |
![[ ]](/icons/layout.gif) | SandersCoryIndictPR.pdf | 2024-10-04 11:53 | 36K | |
![[ ]](/icons/layout.gif) | HathawayWilliamKrist..> | 2024-10-04 11:53 | 36K | |
![[ ]](/icons/layout.gif) | 91-3962-0013PCJ.1510..> | 2024-10-04 11:53 | 36K | |
![[ ]](/icons/layout.gif) | Plaza Construction C..> | 2024-10-04 11:53 | 36K | |
![[ ]](/icons/layout.gif) | 91-3939-0039PC 15092..> | 2024-10-04 11:53 | 37K | |
![[ ]](/icons/layout.gif) | Former Business Mana..> | 2024-10-04 11:53 | 37K | |
![[ ]](/icons/layout.gif) | Acting Boss Of Bonan..> | 2024-10-04 11:53 | 37K | |
![[ ]](/icons/layout.gif) | Four Defendants Sent..> | 2024-10-04 11:53 | 37K | |
![[ ]](/icons/layout.gif) | A.G. Schneiderman An..> | 2024-10-04 11:53 | 37K | |
![[ ]](/icons/layout.gif) | Businness Owners Cha..> | 2024-10-04 11:53 | 37K | |
![[ ]](/icons/layout.gif) | AllenDoreenPleaPR 6...> | 2024-10-04 11:53 | 37K | |
![[ ]](/icons/layout.gif) | North Miami Resident..> | 2024-10-04 11:53 | 37K | |
![[ ]](/icons/layout.gif) | U.S. Attorney Wifred..> | 2024-10-04 11:53 | 37K | |
![[ ]](/icons/layout.gif) | Hall_retrial_sent_6_..> | 2024-10-04 11:53 | 37K | |
![[ ]](/icons/layout.gif) | Urbanski Steven Hodn..> | 2024-10-04 11:53 | 38K | |
![[ ]](/icons/layout.gif) | Former Local 17.pdf | 2024-10-04 11:53 | 38K | |
![[ ]](/icons/layout.gif) | ILWU Chiro Scam - Am..> | 2024-10-04 11:53 | 38K | |
![[ ]](/icons/layout.gif) | Former Copley man se..> | 2024-10-04 11:53 | 38K | |
![[ ]](/icons/layout.gif) | Kutztown Steel Compa..> | 2024-10-04 11:53 | 38K | |
![[ ]](/icons/layout.gif) | Hall Earl Trial_11_2..> | 2024-10-04 11:53 | 39K | |
![[ ]](/icons/layout.gif) | Rochester Man Pleads..> | 2024-10-04 11:53 | 39K | |
![[ ]](/icons/layout.gif) | Santillo GP.pdf | 2024-10-04 11:53 | 39K | |
![[ ]](/icons/layout.gif) | DOCTORS CONVICTED IN..> | 2024-10-04 11:53 | 39K | |
![[ ]](/icons/layout.gif) | Union Employee Sente..> | 2024-10-04 11:53 | 39K | |
![[ ]](/icons/layout.gif) | Gayl Joshua Sentenci..> | 2024-10-04 11:53 | 39K | |
![[ ]](/icons/layout.gif) | Indictment Charges P..> | 2024-10-04 11:53 | 40K | |
![[ ]](/icons/layout.gif) | Manager of Clothing ..> | 2024-10-04 11:53 | 40K | |
![[ ]](/icons/layout.gif) | Moran_indictment_09_..> | 2024-10-04 11:53 | 40K | |
![[ ]](/icons/layout.gif) | Owner of Axis Benefi..> | 2024-10-04 11:53 | 40K | |
![[ ]](/icons/layout.gif) | Three Family Members..> | 2024-10-04 11:53 | 40K | |
![[ ]](/icons/layout.gif) | Six Defendants Charg..> | 2024-10-04 11:53 | 41K | |
![[ ]](/icons/layout.gif) | Former Lexington Res..> | 2024-10-04 11:53 | 41K | |
![[ ]](/icons/layout.gif) | Financial Management..> | 2024-10-04 11:53 | 41K | |
![[ ]](/icons/layout.gif) | Two More Sentenced F..> | 2024-10-04 11:53 | 41K | |
![[ ]](/icons/layout.gif) | FDLE arrests man in ..> | 2024-10-04 11:53 | 41K | |
![[ ]](/icons/layout.gif) | Port St. Lucie Resid..> | 2024-10-04 11:53 | 41K | |
![[ ]](/icons/layout.gif) | Milwaukee-Area Gas S..> | 2024-10-04 11:53 | 41K | |
![[ ]](/icons/layout.gif) | Timeshare Consulting..> | 2024-10-04 11:53 | 41K | |
![[ ]](/icons/layout.gif) | Tedesco Matthew and ..> | 2024-10-04 11:53 | 41K | |
![[ ]](/icons/layout.gif) | Two Delano Residents..> | 2024-10-04 11:53 | 41K | |
![[ ]](/icons/layout.gif) | BrownGarySentencePR.pdf | 2024-10-04 11:53 | 42K | |
![[ ]](/icons/layout.gif) | Former Union Officia..> | 2024-10-04 11:53 | 42K | |
![[ ]](/icons/layout.gif) | Meridian Residents C..> | 2024-10-04 11:53 | 42K | |
![[ ]](/icons/layout.gif) | Identity Thieves Sen..> | 2024-10-04 11:53 | 42K | |
![[ ]](/icons/layout.gif) | Thomas Sudhan and Ap..> | 2024-10-04 11:53 | 42K | |
![[ ]](/icons/layout.gif) | Valenti Michael Plea..> | 2024-10-04 11:53 | 42K | |
![[ ]](/icons/layout.gif) | 2 Sentenced to Priso..> | 2024-10-04 11:53 | 42K | |
![[ ]](/icons/layout.gif) | Former Meriden Resid..> | 2024-10-04 11:53 | 42K | |
![[ ]](/icons/layout.gif) | Former President of ..> | 2024-10-04 11:53 | 42K | |
![[ ]](/icons/layout.gif) | Erron Strachan Arres..> | 2024-10-04 11:53 | 42K | |
![[ ]](/icons/layout.gif) | Cleveland Heights ma..> | 2024-10-04 11:53 | 42K | |
![[ ]](/icons/layout.gif) | Two Texas Men Senten..> | 2024-10-04 11:53 | 42K | |
![[ ]](/icons/layout.gif) | Former Union Officer..> | 2024-10-04 11:53 | 43K | |
![[ ]](/icons/layout.gif) | Man Admits Role In I..> | 2024-10-04 11:53 | 43K | |
![[ ]](/icons/layout.gif) | Former Owner of Long..> | 2024-10-04 11:53 | 43K | |
![[ ]](/icons/layout.gif) | Former Owner Of Spri..> | 2024-10-04 11:53 | 43K | |
![[ ]](/icons/layout.gif) | Hedge Fund Executive..> | 2024-10-04 11:53 | 43K | |
![[ ]](/icons/layout.gif) | INDICTMENT CHARGES 3..> | 2024-10-04 11:53 | 43K | |
![[ ]](/icons/layout.gif) | Corporation and Thre..> | 2024-10-04 11:53 | 43K | |
![[ ]](/icons/layout.gif) | Man Admits Role In I..> | 2024-10-04 11:53 | 43K | |
![[ ]](/icons/layout.gif) | Cinelli Craig and Ci..> | 2024-10-04 11:53 | 43K | |
![[ ]](/icons/layout.gif) | Plantation Resident ..> | 2024-10-04 11:53 | 43K | |
![[ ]](/icons/layout.gif) | Salvatore Armao Plea..> | 2024-10-04 11:53 | 43K | |
![[ ]](/icons/layout.gif) | Former Senior VP Of ..> | 2024-10-04 11:53 | 43K | |
![[ ]](/icons/layout.gif) | Illinois Man Admits ..> | 2024-10-04 11:53 | 44K | |
![[ ]](/icons/layout.gif) | Woman Sentenced for ..> | 2024-10-04 11:53 | 44K | |
![[ ]](/icons/layout.gif) | LOCAL BUSINESSMAN PL..> | 2024-10-04 11:53 | 44K | |
![[ ]](/icons/layout.gif) | Member Of Lucchese O..> | 2024-10-04 11:53 | 44K | |
![[ ]](/icons/layout.gif) | Lampignano Traversa ..> | 2024-10-04 11:53 | 45K | |
![[ ]](/icons/layout.gif) | Georgia Man Admits U..> | 2024-10-04 11:53 | 45K | |
![[ ]](/icons/layout.gif) | Chicago Dermatologis..> | 2024-10-04 11:53 | 45K | |
![[ ]](/icons/layout.gif) | Former Facilities Ma..> | 2024-10-04 11:53 | 45K | |
![[ ]](/icons/layout.gif) | Former President of ..> | 2024-10-04 11:53 | 45K | |
![[ ]](/icons/layout.gif) | Former Senior UAW Of..> | 2024-10-04 11:53 | 46K | |
![[ ]](/icons/layout.gif) | Six Defendants Indic..> | 2024-10-04 11:53 | 46K | |
![[ ]](/icons/layout.gif) | Dallas Attorney and ..> | 2024-10-04 11:53 | 46K | |
![[ ]](/icons/layout.gif) | Pennsylvania Contrac..> | 2024-10-04 11:53 | 46K | |
![[ ]](/icons/layout.gif) | Former UAW Official ..> | 2024-10-04 11:53 | 46K | |
![[ ]](/icons/layout.gif) | Stockton Man Sentenc..> | 2024-10-04 11:53 | 47K | |
![[ ]](/icons/layout.gif) | Compound King and Tw..> | 2024-10-04 11:53 | 47K | |
![[ ]](/icons/layout.gif) | Former UAW Official ..> | 2024-10-04 11:53 | 47K | |
![[ ]](/icons/layout.gif) | Man Sentenced To 27 ..> | 2024-10-04 11:53 | 47K | |
![[ ]](/icons/layout.gif) | Resident of Nashua S..> | 2024-10-04 11:53 | 47K | |
![[ ]](/icons/layout.gif) | Ten Individuals Conv..> | 2024-10-04 11:53 | 47K | |
![[ ]](/icons/layout.gif) | Former Charity Execu..> | 2024-10-04 11:53 | 47K | |
![[ ]](/icons/layout.gif) | Dallas Attorney Sent..> | 2024-10-04 11:53 | 47K | |
![[ ]](/icons/layout.gif) | Former Detroit City ..> | 2024-10-04 11:53 | 47K | |
![[ ]](/icons/layout.gif) | Champaign Roofer Cha..> | 2024-10-04 11:53 | 47K | |
![[ ]](/icons/layout.gif) | Hedge Fund CFO Sente..> | 2024-10-04 11:53 | 47K | |
![[ ]](/icons/layout.gif) | General Foreman At P..> | 2024-10-04 11:53 | 47K | |
![[ ]](/icons/layout.gif) | Former Senior UAW Of..> | 2024-10-04 11:53 | 48K | |
![[ ]](/icons/layout.gif) | Former CEO of Tennes..> | 2024-10-04 11:53 | 48K | |
![[ ]](/icons/layout.gif) | Mullens Doctor Charg..> | 2024-10-04 11:53 | 48K | |
![[ ]](/icons/layout.gif) | Twenty White County ..> | 2024-10-04 11:53 | 48K | |
![[ ]](/icons/layout.gif) | Owners and Chiroprac..> | 2024-10-04 11:53 | 48K | |
![[ ]](/icons/layout.gif) | Former Charity Execu..> | 2024-10-04 11:53 | 48K | |
![[ ]](/icons/layout.gif) | Roofing Company Owne..> | 2024-10-04 11:53 | 48K | |
![[ ]](/icons/layout.gif) | Jury convicts operat..> | 2024-10-04 11:53 | 48K | |
![[ ]](/icons/layout.gif) | Federal Jury Convict..> | 2024-10-04 11:53 | 48K | |
![[ ]](/icons/layout.gif) | Andover Construction..> | 2024-10-04 11:53 | 48K | |
![[ ]](/icons/layout.gif) | Teamsters Indicated ..> | 2024-10-04 11:53 | 48K | |
![[ ]](/icons/layout.gif) | Georgia Woman Admits..> | 2024-10-04 11:53 | 49K | |
![[ ]](/icons/layout.gif) | Defendants Sentenced..> | 2024-10-04 11:53 | 49K | |
![[ ]](/icons/layout.gif) | GEORGIA MAN SENTENCE..> | 2024-10-04 11:53 | 49K | |
![[ ]](/icons/layout.gif) | Middle Township Teac..> | 2024-10-04 11:53 | 49K | |
![[ ]](/icons/layout.gif) | Wife of Former UAW V..> | 2024-10-04 11:53 | 49K | |
![[ ]](/icons/layout.gif) | Hearing Aid Dealer a..> | 2024-10-04 11:53 | 49K | |
![[ ]](/icons/layout.gif) | Charges Allege Two I..> | 2024-10-04 11:53 | 49K | |
![[ ]](/icons/layout.gif) | Senator Abel Nazario..> | 2024-10-04 11:53 | 50K | |
![[ ]](/icons/layout.gif) | Gregorson sentencing..> | 2024-10-04 11:53 | 50K | |
![[ ]](/icons/layout.gif) | Members And Associat..> | 2024-10-04 11:53 | 50K | |
![[ ]](/icons/layout.gif) | Former Boss of Opera..> | 2024-10-04 11:53 | 50K | |
![[ ]](/icons/layout.gif) | Gregerson Indictment..> | 2024-10-04 11:53 | 50K | |
![[ ]](/icons/layout.gif) | Owner of Information..> | 2024-10-04 11:53 | 50K | |
![[ ]](/icons/layout.gif) | IT Software Services..> | 2024-10-04 11:53 | 50K | |
![[ ]](/icons/layout.gif) | Accountant Charged w..> | 2024-10-04 11:53 | 50K | |
![[ ]](/icons/layout.gif) | DA Charges Manslaugh..> | 2024-10-04 11:53 | 51K | |
![[ ]](/icons/layout.gif) | Chiropractor Pleads ..> | 2024-10-04 11:53 | 51K | |
![[ ]](/icons/layout.gif) | Omaha Railcar Cleani..> | 2024-10-04 11:53 | 51K | |
![[ ]](/icons/layout.gif) | Business Manager Sen..> | 2024-10-04 11:53 | 51K | |
![[ ]](/icons/layout.gif) | Two Labor Union Offi..> | 2024-10-04 11:53 | 51K | |
![[ ]](/icons/layout.gif) | Bart Verdict.pdf | 2024-10-04 11:53 | 52K | |
![[ ]](/icons/layout.gif) | Former Treasurer of ..> | 2024-10-04 11:53 | 52K | |
![[ ]](/icons/layout.gif) | Chambersburg Man Ind..> | 2024-10-04 11:53 | 52K | |
![[ ]](/icons/layout.gif) | Margate New Jersey F..> | 2024-10-04 11:53 | 52K | |
![[ ]](/icons/layout.gif) | Attorney Convicted o..> | 2024-10-04 11:53 | 53K | |
![[ ]](/icons/layout.gif) | Husband and Wife Adm..> | 2024-10-04 11:53 | 53K | |
![[ ]](/icons/layout.gif) | Building Contractor ..> | 2024-10-04 11:53 | 53K | |
![[ ]](/icons/layout.gif) | VILLANUEVA Guilty Pl..> | 2024-10-04 11:53 | 53K | |
![[ ]](/icons/layout.gif) | Acosta Sergio and Ac..> | 2024-10-04 11:53 | 53K | |
![[ ]](/icons/layout.gif) | Wife of Former UAW V..> | 2024-10-04 11:53 | 53K | |
![[ ]](/icons/layout.gif) | Ironworkers Business..> | 2024-10-04 11:53 | 53K | |
![[ ]](/icons/layout.gif) | KUMAR guilty plea pr..> | 2024-10-04 11:53 | 53K | |
![[ ]](/icons/layout.gif) | Federal Grand Jury I..> | 2024-10-04 11:53 | 54K | |
![[ ]](/icons/layout.gif) | LI_Chiropractor_OWCP..> | 2024-10-04 11:53 | 54K | |
![[ ]](/icons/layout.gif) | Owner_Insurance_Firm..> | 2024-10-04 11:53 | 54K | |
![[ ]](/icons/layout.gif) | Construction Company..> | 2024-10-04 11:53 | 54K | |
![[ ]](/icons/layout.gif) | Troy Man Pleads Guil..> | 2024-10-04 11:53 | 54K | |
![[ ]](/icons/layout.gif) | West Palm Beach Man ..> | 2024-10-04 11:53 | 54K | |
![[ ]](/icons/layout.gif) | Nadeem Sentence Pres..> | 2024-10-04 11:53 | 54K | |
![[ ]](/icons/layout.gif) | Vertuccio Guilty Ple..> | 2024-10-04 11:53 | 55K | |
![[ ]](/icons/layout.gif) | Florida Business Own..> | 2024-10-04 11:53 | 55K | |
![[ ]](/icons/layout.gif) | Former Arkansas Lawm..> | 2024-10-04 11:53 | 56K | |
![[ ]](/icons/layout.gif) | Former Tax Preparer ..> | 2024-10-04 11:53 | 56K | |
![[ ]](/icons/layout.gif) | Former Postal Worker..> | 2024-10-04 11:53 | 56K | |
![[ ]](/icons/layout.gif) | BEDWELL Sentencing P..> | 2024-10-04 11:53 | 56K | |
![[ ]](/icons/layout.gif) | Servider Sentencing ..> | 2024-10-04 11:53 | 56K | |
![[ ]](/icons/layout.gif) | Louisiana_Doctor_Ple..> | 2024-10-04 11:53 | 56K | |
![[ ]](/icons/layout.gif) | Woodbury Woman Sente..> | 2024-10-04 11:53 | 57K | |
![[ ]](/icons/layout.gif) | BUILDING CONTRACTOR ..> | 2024-10-04 11:53 | 57K | |
![[ ]](/icons/layout.gif) | TwoContractorsAndOne..> | 2024-10-04 11:53 | 57K | |
![[ ]](/icons/layout.gif) | Bedwell Guilty Plea ..> | 2024-10-04 11:53 | 57K | |
![[ ]](/icons/layout.gif) | New Berlin Contracto..> | 2024-10-04 11:53 | 58K | |
![[ ]](/icons/layout.gif) | Sunderlage bankruptc..> | 2024-10-04 11:53 | 58K | |
![[ ]](/icons/layout.gif) | Bristol_TN_Man_Sente..> | 2024-10-04 11:53 | 58K | |
![[ ]](/icons/layout.gif) | Bello George Plea PR..> | 2024-10-04 11:53 | 58K | |
![[ ]](/icons/layout.gif) | Press Release Indict..> | 2024-10-04 11:53 | 58K | |
![[ ]](/icons/layout.gif) | Former Employee Of T..> | 2024-10-04 11:53 | 58K | |
![[ ]](/icons/layout.gif) | Former Owner and Man..> | 2024-10-04 11:53 | 58K | |
![[ ]](/icons/layout.gif) | North Suburban Chiro..> | 2024-10-04 11:53 | 58K | |
![[ ]](/icons/layout.gif) | AFLAC scam - Sledge ..> | 2024-10-04 11:53 | 58K | |
![[ ]](/icons/layout.gif) | Castellano Press Rel..> | 2024-10-04 11:53 | 58K | |
![[ ]](/icons/layout.gif) | Navillus Indictment ..> | 2024-10-04 11:53 | 59K | |
![[ ]](/icons/layout.gif) | Former State Employe..> | 2024-10-04 11:53 | 59K | |
![[ ]](/icons/layout.gif) | Two Defendants Plead..> | 2024-10-04 11:53 | 59K | |
![[ ]](/icons/layout.gif) | Physician_Partners_o..> | 2024-10-04 11:53 | 59K | |
![[ ]](/icons/layout.gif) | Stockton Woman Charg..> | 2024-10-04 11:53 | 60K | |
![[ ]](/icons/layout.gif) | Owner of Mall Kiosk ..> | 2024-10-04 11:53 | 60K | |
![[ ]](/icons/layout.gif) | Manning false stmt a..> | 2024-10-04 11:53 | 60K | |
![[ ]](/icons/layout.gif) | Washington County Bu..> | 2024-10-04 11:53 | 60K | |
![[ ]](/icons/layout.gif) | Lancaster Resident C..> | 2024-10-04 11:53 | 60K | |
![[ ]](/icons/layout.gif) | Lehigh Valley Man Ch..> | 2024-10-04 11:53 | 60K | |
![[ ]](/icons/layout.gif) | Former President of ..> | 2024-10-04 11:53 | 60K | |
![[ ]](/icons/layout.gif) | Granite Press Releas..> | 2024-10-04 11:53 | 60K | |
![[ ]](/icons/layout.gif) | Queens_Man_Sentenced..> | 2024-10-04 11:53 | 60K | |
![[ ]](/icons/layout.gif) | McClain-Gonzalez-Tor..> | 2024-10-04 11:53 | 60K | |
![[ ]](/icons/layout.gif) | Selection of Phase I..> | 2024-10-04 11:53 | 61K | |
![[ ]](/icons/layout.gif) | Mendez-MorenoPuente-..> | 2024-10-04 11:53 | 61K | |
![[ ]](/icons/layout.gif) | ILWU chiro scam - Go..> | 2024-10-04 11:53 | 61K | |
![[ ]](/icons/layout.gif) | Tishman DPA Press Re..> | 2024-10-04 11:53 | 61K | |
![[ ]](/icons/layout.gif) | Man Sentenced For Fr..> | 2024-10-04 11:53 | 61K | |
![[ ]](/icons/layout.gif) | CEO Gets More Than 1..> | 2024-10-04 11:53 | 61K | |
![[ ]](/icons/layout.gif) | AkalaDiameterSentenc..> | 2024-10-04 11:53 | 62K | |
![[ ]](/icons/layout.gif) | Three Former Employe..> | 2024-10-04 11:53 | 62K | |
![[ ]](/icons/layout.gif) | Former President of ..> | 2024-10-04 11:53 | 62K | |
![[ ]](/icons/layout.gif) | Massachusetts Asbest..> | 2024-10-04 11:53 | 62K | |
![[ ]](/icons/layout.gif) | AkalaDiameterPleaPR ..> | 2024-10-04 11:53 | 62K | |
![[ ]](/icons/layout.gif) | TEXAS MAN SENTENCED ..> | 2024-10-04 11:53 | 63K | |
![[ ]](/icons/layout.gif) | Manning indictment p..> | 2024-10-04 11:53 | 63K | |
![[ ]](/icons/layout.gif) | Five Individuals, In..> | 2024-10-04 11:53 | 63K | |
![[ ]](/icons/layout.gif) | Former Labor Departm..> | 2024-10-04 11:53 | 65K | |
![[ ]](/icons/layout.gif) | Landscaping Executiv..> | 2024-10-04 11:53 | 65K | |
![[ ]](/icons/layout.gif) | Former Employees Of ..> | 2024-10-04 11:53 | 65K | |
![[ ]](/icons/layout.gif) | Connecticut Man Foun..> | 2024-10-04 11:53 | 66K | |
![[ ]](/icons/layout.gif) | Former State Employe..> | 2024-10-04 11:53 | 66K | |
![[ ]](/icons/layout.gif) | Edinburg doctor and ..> | 2025-01-14 08:59 | 67K | |
![[ ]](/icons/layout.gif) | BempaBoateng-Benitez..> | 2024-10-04 11:53 | 67K | |
![[ ]](/icons/layout.gif) | Boston City Official..> | 2024-10-04 11:53 | 67K | |
![[ ]](/icons/layout.gif) | Vice President of Lo..> | 2024-10-04 11:53 | 68K | |
![[ ]](/icons/layout.gif) | Health Care Provider..> | 2024-10-04 11:53 | 68K | |
![[ ]](/icons/layout.gif) | Former Letter Carrie..> | 2024-10-04 11:53 | 70K | |
![[ ]](/icons/layout.gif) | Turner Woman Sentenc..> | 2024-10-04 11:53 | 70K | |
![[ ]](/icons/layout.gif) | Queens Couple Senten..> | 2024-09-23 10:21 | 70K | |
![[ ]](/icons/layout.gif) | Queens Couple Senten..> | 2024-10-04 11:53 | 70K | |
![[ ]](/icons/layout.gif) | Detroit_Man_Pleads_G..> | 2024-10-04 11:53 | 70K | |
![[ ]](/icons/layout.gif) | Corapeake Woman Plea..> | 2024-10-04 11:53 | 71K | |
![[ ]](/icons/layout.gif) | Houston Woman Senten..> | 2025-01-22 17:11 | 71K | |
![[ ]](/icons/layout.gif) | CFO and VP Sentenced..> | 2024-10-04 11:53 | 71K | |
![[ ]](/icons/layout.gif) | Kansas City Area Bus..> | 2024-10-04 11:53 | 72K | |
![[ ]](/icons/layout.gif) | Scranton Man Sentenc..> | 2025-03-04 07:53 | 72K | |
![[ ]](/icons/layout.gif) | Troy Man Arraigned o..> | 2024-10-04 11:53 | 72K | |
![[ ]](/icons/layout.gif) | Atlantic City Man Se..> | 2024-10-04 11:53 | 73K | |
![[ ]](/icons/layout.gif) | Executives Surgeons ..> | 2024-10-04 11:53 | 73K | |
![[ ]](/icons/layout.gif) | Nigerian National Ch..> | 2025-03-24 15:17 | 74K | |
![[ ]](/icons/layout.gif) | Mexican National Ple..> | 2024-11-04 18:06 | 74K | |
![[ ]](/icons/layout.gif) | Daytona Beach Man Se..> | 2025-02-19 08:21 | 74K | |
![[ ]](/icons/layout.gif) | Hancock County Man S..> | 2025-05-08 08:38 | 74K | |
![[ ]](/icons/layout.gif) | A.G. Schneiderman An..> | 2024-10-04 11:53 | 75K | |
![[ ]](/icons/layout.gif) | Mexican National Inv..> | 2025-03-10 08:32 | 75K | |
![[ ]](/icons/layout.gif) | Pharmacist guilty in..> | 2025-01-21 08:29 | 75K | |
![[ ]](/icons/layout.gif) | Businesswoman Pleads..> | 2024-10-04 11:53 | 75K | |
![[ ]](/icons/layout.gif) | Pagesfrom12.01.15.pdf | 2024-10-04 11:53 | 75K | |
![[ ]](/icons/layout.gif) | Hot Springs Man Sent..> | 2025-03-17 13:14 | 75K | |
![[ ]](/icons/layout.gif) | False disaster relie..> | 2025-05-02 11:00 | 75K | |
![[ ]](/icons/layout.gif) | ED_NY_Ho_Nguyen.pdf | 2024-10-04 11:53 | 76K | |
![[ ]](/icons/layout.gif) | Former Employee of t..> | 2025-06-26 10:32 | 76K | |
![[ ]](/icons/layout.gif) | Honduran Man Pleads ..> | 2025-05-15 17:20 | 76K | |
![[ ]](/icons/layout.gif) | Defendant Who Failed..> | 2025-03-26 08:15 | 76K | |
![[ ]](/icons/layout.gif) | Four Indicted on Fed..> | 2024-10-04 11:53 | 76K | |
![[ ]](/icons/layout.gif) | Charleston Restauran..> | 2024-10-04 11:53 | 76K | |
![[ ]](/icons/layout.gif) | Six Defendants Plead..> | 2024-10-04 11:53 | 76K | |
![[ ]](/icons/layout.gif) | State Contractor Cha..> | 2024-10-04 11:53 | 76K | |
![[ ]](/icons/layout.gif) | Nicolette Gizzi Sent..> | 2024-10-04 11:53 | 76K | |
![[ ]](/icons/layout.gif) | Tracy Woman Sentence..> | 2024-10-04 11:53 | 76K | |
![[ ]](/icons/layout.gif) | Former Acting Execut..> | 2024-10-04 11:53 | 76K | |
![[ ]](/icons/layout.gif) | Lancaster Resident S..> | 2024-10-04 11:53 | 76K | |
![[ ]](/icons/layout.gif) | Wesley Chapel Woman ..> | 2025-06-23 08:04 | 76K | |
![[ ]](/icons/layout.gif) | Big_Stone_Gap_Man_Se..> | 2024-10-04 11:53 | 77K | |
![[ ]](/icons/layout.gif) | Husband and wife ple..> | 2025-06-16 16:39 | 77K | |
![[ ]](/icons/layout.gif) | Boston Gang Member P..> | 2025-01-28 12:36 | 77K | |
![[ ]](/icons/layout.gif) | Restaurateur and Squ..> | 2024-10-04 11:53 | 77K | |
![[ ]](/icons/layout.gif) | Owner of Boston Area..> | 2025-04-03 08:33 | 77K | |
![[ ]](/icons/layout.gif) | Albany Woman Pleads ..> | 2025-02-13 13:41 | 77K | |
![[ ]](/icons/layout.gif) | Husband and Wife Own..> | 2024-10-04 11:53 | 77K | |
![[ ]](/icons/layout.gif) | Michigan_Woman_Sente..> | 2024-10-04 11:53 | 78K | |
![[ ]](/icons/layout.gif) | Stockton Woman Plead..> | 2024-10-04 11:53 | 78K | |
![[ ]](/icons/layout.gif) | Brazilian National A..> | 2025-03-19 08:43 | 78K | |
![[ ]](/icons/layout.gif) | Haverhill Man Pleads..> | 2025-02-14 08:58 | 78K | |
![[ ]](/icons/layout.gif) | Chicago Man Indicted..> | 2024-10-04 11:53 | 78K | |
![[ ]](/icons/layout.gif) | Contractor_Sentenced..> | 2024-10-04 11:53 | 78K | |
![[ ]](/icons/layout.gif) | USPS_Employee_Indict..> | 2024-10-04 11:53 | 78K | |
![[ ]](/icons/layout.gif) | FIRST DEFENDANT SENT..> | 2024-10-04 11:53 | 78K | |
![[ ]](/icons/layout.gif) | Brazilian National S..> | 2025-06-30 07:59 | 78K | |
![[ ]](/icons/layout.gif) | North Miami Beach Re..> | 2024-10-04 11:53 | 78K | |
![[ ]](/icons/layout.gif) | Las Vegas Man Pleads..> | 2025-05-27 08:32 | 78K | |
![[ ]](/icons/layout.gif) | First of Multiple In..> | 2024-12-27 08:45 | 78K | |
![[ ]](/icons/layout.gif) | Gordin news release ..> | 2024-10-04 11:53 | 78K | |
![[ ]](/icons/layout.gif) | Hartford Man Admits ..> | 2025-02-25 08:09 | 78K | |
![[ ]](/icons/layout.gif) | Madison news release..> | 2024-10-04 11:53 | 78K | |
![[ ]](/icons/layout.gif) | PA Office of Attorne..> | 2024-10-04 11:53 | 79K | |
![[ ]](/icons/layout.gif) | Clinton Man Sentence..> | 2024-12-18 17:21 | 79K | |
![[ ]](/icons/layout.gif) | VA Firefighter Admit..> | 2025-03-10 08:32 | 79K | |
![[ ]](/icons/layout.gif) | Arkansas_Woman_Plead..> | 2024-10-04 11:53 | 79K | |
![[ ]](/icons/layout.gif) | Three Indicted for U..> | 2024-10-22 16:45 | 79K | |
![[ ]](/icons/layout.gif) | Citrus Heights Woman..> | 2025-02-27 15:29 | 79K | |
![[ ]](/icons/layout.gif) | Dominican_National_P..> | 2024-10-04 11:53 | 79K | |
![[ ]](/icons/layout.gif) | Albany Man Pleads Gu..> | 2025-03-25 07:31 | 79K | |
![[ ]](/icons/layout.gif) | Boston Man Pleads Gu..> | 2024-10-04 11:53 | 79K | |
![[ ]](/icons/layout.gif) | Woburn Men Sentenced..> | 2025-03-31 10:03 | 79K | |
![[ ]](/icons/layout.gif) | Two Men Convicted of..> | 2024-10-04 11:53 | 79K | |
![[ ]](/icons/layout.gif) | Coleman news release..> | 2024-10-04 11:53 | 79K | |
![[ ]](/icons/layout.gif) | Dominican_National_S..> | 2024-10-04 11:53 | 79K | |
![[ ]](/icons/layout.gif) | D_NV_Guilty_Plea_UI.pdf | 2024-10-04 11:53 | 79K | |
![[ ]](/icons/layout.gif) | Company_Owner_Pleads..> | 2024-10-04 11:53 | 79K | |
![[ ]](/icons/layout.gif) | Woman admits to subm..> | 2024-10-04 11:53 | 79K | |
![[ ]](/icons/layout.gif) | Jury Convicts Lockpo..> | 2024-10-04 11:53 | 79K | |
![[ ]](/icons/layout.gif) | Company_Owner_Pleads..> | 2024-10-04 11:53 | 79K | |
![[ ]](/icons/layout.gif) | Detroit_Man_Convicte..> | 2024-10-04 11:53 | 80K | |
![[ ]](/icons/layout.gif) | Four Health Care Pro..> | 2024-10-04 11:53 | 80K | |
![[ ]](/icons/layout.gif) | Burgettstown_Man_Sen..> | 2024-10-04 11:53 | 80K | |
![[ ]](/icons/layout.gif) | General President of..> | 2025-01-29 17:15 | 80K | |
![[ ]](/icons/layout.gif) | Ringleader of 6.2M U..> | 2025-03-13 16:01 | 80K | |
![[ ]](/icons/layout.gif) | Arkansas_Woman_Sente..> | 2024-10-04 11:53 | 80K | |
![[ ]](/icons/layout.gif) | Jury Convicts Canadi..> | 2025-05-27 08:30 | 80K | |
![[ ]](/icons/layout.gif) | Ohio Company Sentenc..> | 2025-06-09 14:59 | 80K | |
![[ ]](/icons/layout.gif) | SUTTER COUNTY MAN SE..> | 2024-10-04 11:53 | 80K | |
![[ ]](/icons/layout.gif) | Fresno_Women_Charged..> | 2024-10-04 11:53 | 80K | |
![[ ]](/icons/layout.gif) | Cullerton news relea..> | 2024-10-04 11:53 | 80K | |
![[ ]](/icons/layout.gif) | Capitol Heights Man ..> | 2024-10-04 11:53 | 80K | |
![[ ]](/icons/layout.gif) | Three Sentenced for ..> | 2025-06-09 08:56 | 80K | |
![[ ]](/icons/layout.gif) | US Army Veteran And ..> | 2024-10-04 11:53 | 80K | |
![[ ]](/icons/layout.gif) | Siblings Plead Guilt..> | 2025-02-05 13:05 | 80K | |
![[ ]](/icons/layout.gif) | Former_Postal_Employ..> | 2024-10-04 11:53 | 80K | |
![[ ]](/icons/layout.gif) | Middle District Of F..> | 2024-10-04 11:53 | 80K | |
![[ ]](/icons/layout.gif) | Convicted Felon Plea..> | 2024-10-04 11:53 | 80K | |
![[ ]](/icons/layout.gif) | Roofing Company Owne..> | 2024-10-04 11:53 | 80K | |
![[ ]](/icons/layout.gif) | AC_Firefighter_Convi..> | 2024-10-04 11:53 | 80K | |
![[ ]](/icons/layout.gif) | Boston_Man_Charged_F..> | 2024-10-04 11:53 | 80K | |
![[ ]](/icons/layout.gif) | Repeat Fraudster Sen..> | 2024-10-04 11:53 | 80K | |
![[ ]](/icons/layout.gif) | Brazilian National P..> | 2025-05-14 08:45 | 81K | |
![[ ]](/icons/layout.gif) | Owner of Medford Con..> | 2024-12-11 08:03 | 81K | |
![[ ]](/icons/layout.gif) | Three Indicted Arrai..> | 2024-10-04 11:53 | 81K | |
![[ ]](/icons/layout.gif) | National Health Care..> | 2024-10-04 11:53 | 81K | |
![[ ]](/icons/layout.gif) | Southfield_Woman_Cha..> | 2024-10-04 11:53 | 81K | |
![[ ]](/icons/layout.gif) | TuckerJoanneSentence..> | 2024-10-04 11:53 | 81K | |
![[ ]](/icons/layout.gif) | MickleJonathanPleaPR..> | 2024-10-04 11:53 | 81K | |
![[ ]](/icons/layout.gif) | Suburban_Doctor_Char..> | 2024-10-04 11:53 | 81K | |
![[ ]](/icons/layout.gif) | U.S. Attorney's Offi..> | 2024-10-04 11:53 | 81K | |
![[ ]](/icons/layout.gif) | Colorado Man Pleads ..> | 2025-06-06 09:48 | 81K | |
![[ ]](/icons/layout.gif) | FL_Business_Exec_Cha..> | 2024-10-04 11:53 | 81K | |
![[ ]](/icons/layout.gif) | South_Florida_Man_In..> | 2024-10-04 11:53 | 81K | |
![[ ]](/icons/layout.gif) | Former_Stockton_Man_..> | 2024-10-04 11:53 | 81K | |
![[ ]](/icons/layout.gif) | Mexican National Sen..> | 2025-04-14 08:56 | 81K | |
![[ ]](/icons/layout.gif) | Middlefield Man Sent..> | 2024-10-04 11:53 | 81K | |
![[ ]](/icons/layout.gif) | Austin Area Chiropra..> | 2024-10-04 11:53 | 81K | |
![[ ]](/icons/layout.gif) | New York Doctor Char..> | 2024-10-23 13:16 | 81K | |
![[ ]](/icons/layout.gif) | Rhode Island Man Adm..> | 2025-04-28 08:05 | 81K | |
![[ ]](/icons/layout.gif) | Former State Employe..> | 2025-06-17 07:29 | 81K | |
![[ ]](/icons/layout.gif) | SW_VA_Man_Sentenced_..> | 2024-10-04 11:53 | 81K | |
![[ ]](/icons/layout.gif) | Sacramento Woman Ple..> | 2025-02-14 08:59 | 81K | |
![[ ]](/icons/layout.gif) | Mexican National Adm..> | 2024-10-25 08:13 | 81K | |
![[ ]](/icons/layout.gif) | Bristol_Tennessee_Wo..> | 2024-10-04 11:53 | 82K | |
![[ ]](/icons/layout.gif) | Center Line Resident..> | 2024-10-04 11:53 | 82K | |
![[ ]](/icons/layout.gif) | Las_Vegas_Woman_Plea..> | 2024-10-04 11:53 | 82K | |
![[ ]](/icons/layout.gif) | Clinic_owner_sentenc..> | 2024-10-04 11:53 | 82K | |
![[ ]](/icons/layout.gif) | Detroit Man Sentence..> | 2025-02-19 15:35 | 82K | |
![[ ]](/icons/layout.gif) | Albuquerque man indi..> | 2024-10-04 11:53 | 82K | |
![[ ]](/icons/layout.gif) | East Point, Georgia ..> | 2025-05-14 14:01 | 82K | |
![[ ]](/icons/layout.gif) | Two_VA_Inmates_Plead..> | 2024-10-04 11:53 | 82K | |
![[ ]](/icons/layout.gif) | Nigerian Man Charged..> | 2025-03-04 07:52 | 82K | |
![[ ]](/icons/layout.gif) | Fraud Conspiracy Lea..> | 2025-03-25 15:12 | 82K | |
![[ ]](/icons/layout.gif) | Florida couple plead..> | 2025-04-02 15:53 | 82K | |
![[ ]](/icons/layout.gif) | Kapolei Woman Indict..> | 2025-01-27 09:19 | 82K | |
![[ ]](/icons/layout.gif) | Rocky Hill Pharmacy ..> | 2024-11-05 07:31 | 82K | |
![[ ]](/icons/layout.gif) | Former_SUNY_Delhi_St..> | 2024-10-04 11:53 | 82K | |
![[ ]](/icons/layout.gif) | Oakland Woman Who Ma..> | 2025-04-01 08:15 | 82K | |
![[ ]](/icons/layout.gif) | Father_and_Son_Owner..> | 2024-10-04 11:53 | 82K | |
![[ ]](/icons/layout.gif) | Norfolk man sentence..> | 2025-04-17 11:14 | 82K | |
![[ ]](/icons/layout.gif) | Amsterdam Woman and ..> | 2024-10-04 11:53 | 82K | |
![[ ]](/icons/layout.gif) | Woburn Men Plead Gui..> | 2024-11-15 08:42 | 82K | |
![[ ]](/icons/layout.gif) | NW Arkansas Man Sent..> | 2025-02-24 16:08 | 82K | |
![[ ]](/icons/layout.gif) | Macon Resident Sente..> | 2024-10-04 11:53 | 82K | |
![[ ]](/icons/layout.gif) | Former Medical Pract..> | 2024-10-04 11:53 | 82K | |
![[ ]](/icons/layout.gif) | Holland_Couple_Sente..> | 2024-10-04 11:53 | 83K | |
![[ ]](/icons/layout.gif) | Atlantic County Man ..> | 2024-10-04 11:53 | 83K | |
![[ ]](/icons/layout.gif) | USAO_ED_ CA_Rosevill..> | 2024-10-04 11:53 | 83K | |
![[ ]](/icons/layout.gif) | Middlesex County Wom..> | 2025-06-26 10:32 | 83K | |
![[ ]](/icons/layout.gif) | Pawtucket Man Pleads..> | 2025-03-19 08:43 | 83K | |
![[ ]](/icons/layout.gif) | Las Vegas Man Senten..> | 2025-03-31 09:12 | 83K | |
![[ ]](/icons/layout.gif) | USAO_D_MA_Malden_Man..> | 2024-10-04 11:53 | 83K | |
![[ ]](/icons/layout.gif) | New York Couple Sent..> | 2024-10-04 11:53 | 83K | |
![[ ]](/icons/layout.gif) | 8 Members and Associ..> | 2024-10-04 11:53 | 83K | |
![[ ]](/icons/layout.gif) | Mexican National Ple..> | 2024-10-07 17:52 | 83K | |
![[ ]](/icons/layout.gif) | FL_Power_Company_Ple..> | 2024-10-04 11:53 | 83K | |
![[ ]](/icons/layout.gif) | Bergen County Man Se..> | 2025-06-02 09:00 | 83K | |
![[ ]](/icons/layout.gif) | Pontiac Man Pleads G..> | 2025-04-24 08:25 | 83K | |
![[ ]](/icons/layout.gif) | Man Sentenced to Thr..> | 2025-03-03 11:04 | 83K | |
![[ ]](/icons/layout.gif) | California Man Plead..> | 2024-10-04 11:53 | 83K | |
![[ ]](/icons/layout.gif) | Nigerian National Pl..> | 2024-10-04 11:53 | 83K | |
![[ ]](/icons/layout.gif) | Malden Woman Sentenc..> | 2025-02-04 13:21 | 83K | |
![[ ]](/icons/layout.gif) | Podiatrist and Patie..> | 2024-12-04 16:57 | 83K | |
![[ ]](/icons/layout.gif) | HCFU news release on..> | 2024-10-04 11:53 | 83K | |
![[ ]](/icons/layout.gif) | Passaic County Lawye..> | 2025-06-10 08:46 | 83K | |
![[ ]](/icons/layout.gif) | Big_Stone_Gap_Man_Pl..> | 2024-10-04 11:53 | 83K | |
![[ ]](/icons/layout.gif) | Pharmaceutical Marke..> | 2024-10-04 11:53 | 83K | |
![[ ]](/icons/layout.gif) | Rensselear_Man_Sente..> | 2024-10-04 11:53 | 83K | |
![[ ]](/icons/layout.gif) | Company_owners_admit..> | 2024-10-04 11:53 | 83K | |
![[ ]](/icons/layout.gif) | Louisiana Doctor Sen..> | 2024-10-04 11:53 | 83K | |
![[ ]](/icons/layout.gif) | Dothan Woman Sentenc..> | 2024-10-04 11:53 | 83K | |
![[ ]](/icons/layout.gif) | Lee_County_Woman_Ple..> | 2024-10-04 11:53 | 83K | |
![[ ]](/icons/layout.gif) | Atlantic County Doct..> | 2024-10-30 14:32 | 83K | |
![[ ]](/icons/layout.gif) | Russell_County_Woman..> | 2024-10-04 11:53 | 83K | |
![[ ]](/icons/layout.gif) | Florida_Man_Pleads_G..> | 2024-10-04 11:53 | 84K | |
![[ ]](/icons/layout.gif) | TuckerShaunSentenceP..> | 2024-10-04 11:53 | 84K | |
![[ ]](/icons/layout.gif) | Delaware Woman Admit..> | 2025-04-17 08:16 | 84K | |
![[ ]](/icons/layout.gif) | Boston Woman Sentenc..> | 2025-02-14 08:58 | 84K | |
![[ ]](/icons/layout.gif) | Two_Stoneham_Residen..> | 2024-10-04 11:53 | 84K | |
![[ ]](/icons/layout.gif) | Former_Detroit_Polic..> | 2024-10-04 11:53 | 84K | |
![[ ]](/icons/layout.gif) | Bristol_Tennessee_Wo..> | 2024-10-04 11:53 | 84K | |
![[ ]](/icons/layout.gif) | Romance Scammer Sent..> | 2024-10-04 11:53 | 84K | |
![[ ]](/icons/layout.gif) | Tampa_Woman_Sentence..> | 2024-10-04 11:53 | 84K | |
![[ ]](/icons/layout.gif) | Buffalo_Woman_Pleads..> | 2024-10-04 11:53 | 84K | |
![[ ]](/icons/layout.gif) | Second Defendant Ple..> | 2025-06-03 07:52 | 84K | |
![[ ]](/icons/layout.gif) | Former_COO_Global_Pr..> | 2024-10-04 11:53 | 84K | |
![[ ]](/icons/layout.gif) | Illinois_Man_Charged..> | 2024-10-04 11:53 | 84K | |
![[ ]](/icons/layout.gif) | New Jersey Man Convi..> | 2024-10-30 15:51 | 84K | |
![[ ]](/icons/layout.gif) | VA_Inmate_Sentenced_..> | 2024-10-04 11:53 | 84K | |
![[ ]](/icons/layout.gif) | Four Individuals Cha..> | 2025-05-27 08:32 | 84K | |
![[ ]](/icons/layout.gif) | Las Vegas Man Indict..> | 2025-03-17 08:40 | 84K | |
![[ ]](/icons/layout.gif) | Marion_Man_Sentenced..> | 2024-10-04 11:53 | 84K | |
![[ ]](/icons/layout.gif) | Florida Man Sentence..> | 2024-10-04 11:53 | 84K | |
![[ ]](/icons/layout.gif) | Four_Individuals_Cha..> | 2024-10-04 11:53 | 85K | |
![[ ]](/icons/layout.gif) | Man Sentenced for Us..> | 2024-10-04 11:53 | 85K | |
![[ ]](/icons/layout.gif) | Former Carpenters’..> | 2024-10-04 11:53 | 85K | |
![[ ]](/icons/layout.gif) | Former Cheyenne Wyom..> | 2024-10-04 11:53 | 85K | |
![[ ]](/icons/layout.gif) | Virginia_Man_Sentenc..> | 2024-10-04 11:53 | 85K | |
![[ ]](/icons/layout.gif) | Las_Vegas_Man_Senten..> | 2024-10-04 11:53 | 85K | |
![[ ]](/icons/layout.gif) | Leessa Augustine, Fo..> | 2025-06-17 17:38 | 85K | |
![[ ]](/icons/layout.gif) | Haverhill Man Arrest..> | 2024-10-04 11:53 | 85K | |
![[ ]](/icons/layout.gif) | Philadelphia_Contrac..> | 2024-10-04 11:53 | 85K | |
![[ ]](/icons/layout.gif) | Leessa Augustine, Fo..> | 2024-10-04 11:53 | 85K | |
![[ ]](/icons/layout.gif) | Three Baton Rouge In..> | 2025-05-12 09:15 | 85K | |
![[ ]](/icons/layout.gif) | Hampton man sentence..> | 2025-03-13 07:51 | 85K | |
![[ ]](/icons/layout.gif) | Department of Labor ..> | 2024-10-04 11:53 | 85K | |
![[ ]](/icons/layout.gif) | Six_People_Indicted_..> | 2024-10-04 11:53 | 85K | |
![[ ]](/icons/layout.gif) | California Man Sente..> | 2025-06-03 09:09 | 85K | |
![[ ]](/icons/layout.gif) | Washington man who s..> | 2024-10-04 11:53 | 85K | |
![[ ]](/icons/layout.gif) | Defendant Originally..> | 2024-10-04 11:53 | 85K | |
![[ ]](/icons/layout.gif) | Woonsocket_Businessm..> | 2024-10-04 11:53 | 85K | |
![[ ]](/icons/layout.gif) | Mexican National Sen..> | 2025-05-20 07:52 | 85K | |
![[ ]](/icons/layout.gif) | Sacramento Jury Conv..> | 2024-10-04 11:53 | 85K | |
![[ ]](/icons/layout.gif) | Second City Official..> | 2024-10-04 11:53 | 85K | |
![[ ]](/icons/layout.gif) | Longtime Gang Member..> | 2025-02-26 08:26 | 85K | |
![[ ]](/icons/layout.gif) | Owner of Boston Area..> | 2025-02-26 08:24 | 85K | |
![[ ]](/icons/layout.gif) | Forrest County Sibli..> | 2025-06-17 07:54 | 85K | |
![[ ]](/icons/layout.gif) | Former Labor Union P..> | 2024-10-04 11:53 | 85K | |
![[ ]](/icons/layout.gif) | Las Vegas Woman Plea..> | 2024-11-15 08:43 | 85K | |
![[ ]](/icons/layout.gif) | Woodbridge Man Plead..> | 2024-10-04 11:53 | 85K | |
![[ ]](/icons/layout.gif) | Two Executives Of Lo..> | 2025-03-17 08:33 | 85K | |
![[ ]](/icons/layout.gif) | Two_Men_Charged_With..> | 2024-10-04 11:53 | 85K | |
![[ ]](/icons/layout.gif) | H Block Gang Member ..> | 2025-07-11 08:15 | 85K | |
![[ ]](/icons/layout.gif) | Six Plead Guilty to ..> | 2024-10-04 11:53 | 85K | |
![[ ]](/icons/layout.gif) | Two Texas Residents ..> | 2025-05-27 08:33 | 85K | |
![[ ]](/icons/layout.gif) | Former-Union_Officer..> | 2024-10-04 11:53 | 85K | |
![[ ]](/icons/layout.gif) | Two_Tampa_Men_Plead_..> | 2024-10-04 11:53 | 85K | |
![[ ]](/icons/layout.gif) | Dominican_National_S..> | 2024-10-04 11:53 | 85K | |
![[ ]](/icons/layout.gif) | Wise_County_Man_Sent..> | 2024-10-04 11:53 | 86K | |
![[ ]](/icons/layout.gif) | Pound Va. Man Convic..> | 2024-10-04 11:53 | 86K | |
![[ ]](/icons/layout.gif) | Local Attorney Sente..> | 2024-10-04 11:53 | 86K | |
![[ ]](/icons/layout.gif) | Former_Claims_Manage..> | 2024-10-04 11:53 | 86K | |
![[ ]](/icons/layout.gif) | New Jersey Man Sente..> | 2025-03-10 08:32 | 86K | |
![[ ]](/icons/layout.gif) | California Man Sente..> | 2025-05-22 07:28 | 86K | |
![[ ]](/icons/layout.gif) | Father And Son Owner..> | 2024-10-04 11:53 | 86K | |
![[ ]](/icons/layout.gif) | Dudley_Man_Pleads_Gu..> | 2024-10-04 11:53 | 86K | |
![[ ]](/icons/layout.gif) | Bank Manager Sentenc..> | 2024-10-21 15:51 | 86K | |
![[ ]](/icons/layout.gif) | Former_Philadelphia_..> | 2024-10-04 11:53 | 86K | |
![[ ]](/icons/layout.gif) | Owner_RC_AutoSales_I..> | 2024-10-04 11:53 | 86K | |
![[ ]](/icons/layout.gif) | Granite City Chiropr..> | 2024-10-04 11:53 | 86K | |
![[ ]](/icons/layout.gif) | H Block Gang Member ..> | 2025-04-21 09:14 | 86K | |
![[ ]](/icons/layout.gif) | New_Jersey_Man_Arres..> | 2024-10-04 11:53 | 86K | |
![[ ]](/icons/layout.gif) | MD_Man_Charged_Fraud..> | 2024-10-04 11:53 | 86K | |
![[ ]](/icons/layout.gif) | Bank contractor indi..> | 2024-12-05 08:05 | 86K | |
![[ ]](/icons/layout.gif) | Nigerian Man Pleads ..> | 2025-04-24 08:27 | 86K | |
![[ ]](/icons/layout.gif) | Former Arizona Offic..> | 2024-10-04 11:53 | 86K | |
![[ ]](/icons/layout.gif) | Former_insurance_age..> | 2024-10-04 11:53 | 86K | |
![[ ]](/icons/layout.gif) | Former Union Officer..> | 2024-10-04 11:53 | 86K | |
![[ ]](/icons/layout.gif) | Pitts et al news rel..> | 2024-10-04 11:53 | 86K | |
![[ ]](/icons/layout.gif) | California_Man_Charg..> | 2024-10-04 11:53 | 86K | |
![[ ]](/icons/layout.gif) | Sacramento Dentist S..> | 2024-10-04 11:53 | 86K | |
![[ ]](/icons/layout.gif) | MI_Man_Sentenced_Sch..> | 2024-10-04 11:53 | 86K | |
![[ ]](/icons/layout.gif) | Texas_Man_Pleads_Gui..> | 2024-10-04 11:53 | 86K | |
![[ ]](/icons/layout.gif) | Nigerian Man Arreste..> | 2024-10-04 11:53 | 86K | |
![[ ]](/icons/layout.gif) | Shelton Man Admits F..> | 2025-03-04 07:53 | 87K | |
![[ ]](/icons/layout.gif) | Conspirators sentenc..> | 2025-06-16 16:53 | 87K | |
![[ ]](/icons/layout.gif) | Atlantic County New ..> | 2024-10-04 11:53 | 87K | |
![[ ]](/icons/layout.gif) | Beverly_Farms_Man_In..> | 2024-10-04 11:53 | 87K | |
![[ ]](/icons/layout.gif) | Debt Collection Outf..> | 2024-10-04 11:53 | 87K | |
![[ ]](/icons/layout.gif) | State_Prison_Inmates..> | 2024-10-04 11:53 | 87K | |
![[ ]](/icons/layout.gif) | Five_Plead_Guilty_to..> | 2024-10-04 11:53 | 87K | |
![[ ]](/icons/layout.gif) | Former Longshoreman ..> | 2025-07-16 14:29 | 87K | |
![[ ]](/icons/layout.gif) | Stoneham_Man_Indicte..> | 2024-10-04 11:53 | 87K | |
![[ ]](/icons/layout.gif) | Hampton_Iowa_Woman_P..> | 2024-10-04 11:53 | 87K | |
![[ ]](/icons/layout.gif) | Four defendants plea..> | 2024-10-04 11:53 | 87K | |
![[ ]](/icons/layout.gif) | Philadelphia_Woman_C..> | 2024-10-04 11:53 | 87K | |
![[ ]](/icons/layout.gif) | Drug Wholesaler Agre..> | 2024-12-31 08:26 | 87K | |
![[ ]](/icons/layout.gif) | Woburn Restaurant Ow..> | 2024-10-04 11:53 | 87K | |
![[ ]](/icons/layout.gif) | Two Men Indicted for..> | 2025-01-31 09:25 | 87K | |
![[ ]](/icons/layout.gif) | Leader of an Interna..> | 2024-10-09 10:18 | 87K | |
![[ ]](/icons/layout.gif) | Richland Man Indicte..> | 2024-10-04 11:53 | 87K | |
![[ ]](/icons/layout.gif) | Trio sentenced to pr..> | 2024-11-14 16:17 | 87K | |
![[ ]](/icons/layout.gif) | Stoneham_Man_Pleads_..> | 2024-10-04 11:53 | 87K | |
![[ ]](/icons/layout.gif) | Essex_County_Man_Adm..> | 2024-10-04 11:53 | 87K | |
![[ ]](/icons/layout.gif) | Rensselaer_Man_Plead..> | 2024-10-04 11:53 | 87K | |
![[ ]](/icons/layout.gif) | San Fernando Valley ..> | 2024-10-04 11:53 | 87K | |
![[ ]](/icons/layout.gif) | Former Officer Plead..> | 2024-10-31 08:20 | 87K | |
![[ ]](/icons/layout.gif) | Texas_Woman_Pleads_G..> | 2024-10-04 11:53 | 88K | |
![[ ]](/icons/layout.gif) | Boston Man Sentenced..> | 2024-11-19 08:42 | 88K | |
![[ ]](/icons/layout.gif) | Boston Woman Pleads ..> | 2024-10-04 11:53 | 88K | |
![[ ]](/icons/layout.gif) | Boston Man Pleads Gu..> | 2025-02-12 15:19 | 88K | |
![[ ]](/icons/layout.gif) | Hyde_Park_Man_Indict..> | 2024-10-04 11:53 | 88K | |
![[ ]](/icons/layout.gif) | Convicted Felon Admi..> | 2025-02-14 14:58 | 88K | |
![[ ]](/icons/layout.gif) | WHD_Plea_CDCA.pdf | 2024-10-04 11:53 | 88K | |
![[ ]](/icons/layout.gif) | Providence_Man_Admit..> | 2024-10-04 11:53 | 88K | |
![[ ]](/icons/layout.gif) | Virginia_Inmate_Plea..> | 2024-10-04 11:53 | 88K | |
![[ ]](/icons/layout.gif) | Lexington Man Pleads..> | 2025-06-09 08:56 | 88K | |
![[ ]](/icons/layout.gif) | Final Defendant Plea..> | 2025-05-22 18:13 | 88K | |
![[ ]](/icons/layout.gif) | Former 6-10 Construc..> | 2024-10-04 11:53 | 88K | |
![[ ]](/icons/layout.gif) | Coventry Woman Admit..> | 2024-10-04 11:53 | 88K | |
![[ ]](/icons/layout.gif) | Las_Vegas_Woman_Plea..> | 2024-10-04 11:53 | 88K | |
![[ ]](/icons/layout.gif) | President and Vice P..> | 2024-10-04 11:53 | 88K | |
![[ ]](/icons/layout.gif) | Former State Governm..> | 2025-01-10 07:47 | 88K | |
![[ ]](/icons/layout.gif) | City of Miami Reside..> | 2024-10-04 11:53 | 88K | |
![[ ]](/icons/layout.gif) | Schaller_Man_Sentenc..> | 2024-10-04 11:53 | 88K | |
![[ ]](/icons/layout.gif) | Rhode_Island_Man_Arr..> | 2024-10-04 11:53 | 89K | |
![[ ]](/icons/layout.gif) | Court Enjoins Fraudu..> | 2024-10-04 11:53 | 89K | |
![[ ]](/icons/layout.gif) | Ringleader of PPP Fr..> | 2025-05-05 09:28 | 89K | |
![[ ]](/icons/layout.gif) | Saratoga County Man ..> | 2024-10-04 11:53 | 89K | |
![[ ]](/icons/layout.gif) | Rensselaer_County_Ma..> | 2024-10-04 11:53 | 89K | |
![[ ]](/icons/layout.gif) | Former State Employe..> | 2025-05-13 08:15 | 89K | |
![[ ]](/icons/layout.gif) | Federal_Safety_and_H..> | 2024-10-04 11:53 | 89K | |
![[ ]](/icons/layout.gif) | Sunnyvale_Man_Senten..> | 2024-10-04 11:53 | 89K | |
![[ ]](/icons/layout.gif) | Georgia Man Sentence..> | 2025-01-06 19:18 | 89K | |
![[ ]](/icons/layout.gif) | Pharmaceutical Sales..> | 2024-10-04 11:53 | 89K | |
![[ ]](/icons/layout.gif) | Evelyn Blevins Sente..> | 2024-10-04 11:53 | 89K | |
![[ ]](/icons/layout.gif) | Two_Camden_County_Re..> | 2024-10-04 11:53 | 89K | |
![[ ]](/icons/layout.gif) | Providence Man on Ad..> | 2024-10-04 11:53 | 89K | |
![[ ]](/icons/layout.gif) | One Defendant Pleads..> | 2025-01-29 16:09 | 89K | |
![[ ]](/icons/layout.gif) | Charlotte_Man_Convic..> | 2024-10-04 11:53 | 89K | |
![[ ]](/icons/layout.gif) | Virginia_Woman_Plead..> | 2024-10-04 11:53 | 89K | |
![[ ]](/icons/layout.gif) | San_Francisco_Man_Pl..> | 2024-10-04 11:53 | 89K | |
![[ ]](/icons/layout.gif) | Georgia Man Pleads G..> | 2024-10-04 11:53 | 89K | |
![[ ]](/icons/layout.gif) | Providence Man Sente..> | 2024-10-04 11:53 | 89K | |
![[ ]](/icons/layout.gif) | Maryland Man Sentenc..> | 2024-10-04 11:53 | 89K | |
![[ ]](/icons/layout.gif) | Former Manager of Lo..> | 2024-10-04 11:53 | 89K | |
![[ ]](/icons/layout.gif) | Westwego Woman Indic..> | 2024-10-04 11:53 | 89K | |
![[ ]](/icons/layout.gif) | Live Entertainment C..> | 2025-07-10 09:00 | 90K | |
![[ ]](/icons/layout.gif) | Westwego Woman Guilt..> | 2025-05-20 07:52 | 90K | |
![[ ]](/icons/layout.gif) | 15 charged in scheme..> | 2025-03-27 13:43 | 90K | |
![[ ]](/icons/layout.gif) | Brooklyn Man Sentenc..> | 2025-05-21 15:20 | 90K | |
![[ ]](/icons/layout.gif) | Three Sentenced for ..> | 2025-05-27 08:29 | 90K | |
![[ ]](/icons/layout.gif) | Husband_Wife_Sentenc..> | 2024-10-04 11:53 | 90K | |
![[ ]](/icons/layout.gif) | North Miami Beach Re..> | 2024-10-04 11:53 | 90K | |
![[ ]](/icons/layout.gif) | Bronx Man Sentenced ..> | 2024-10-04 11:53 | 90K | |
![[ ]](/icons/layout.gif) | Three_California_Res..> | 2024-10-04 11:53 | 90K | |
![[ ]](/icons/layout.gif) | Leaders Of Brooklyn ..> | 2024-10-04 11:53 | 90K | |
![[ ]](/icons/layout.gif) | Annual Awards Ceremo..> | 2024-10-11 13:51 | 90K | |
![[ ]](/icons/layout.gif) | Camden County Man Ad..> | 2024-10-04 11:53 | 90K | |
![[ ]](/icons/layout.gif) | Schenectady Man Char..> | 2025-01-30 14:59 | 90K | |
![[ ]](/icons/layout.gif) | Immigration Attorney..> | 2024-10-04 11:53 | 90K | |
![[ ]](/icons/layout.gif) | 28 Charged in $9.5 M..> | 2024-10-04 11:53 | 90K | |
![[ ]](/icons/layout.gif) | Former Claims Examin..> | 2024-10-04 11:53 | 90K | |
![[ ]](/icons/layout.gif) | Brooklyn-Based Nined..> | 2025-04-09 18:25 | 90K | |
![[ ]](/icons/layout.gif) | Social_Security_Empl..> | 2024-10-04 11:53 | 90K | |
![[ ]](/icons/layout.gif) | Former State Governm..> | 2025-05-12 09:15 | 90K | |
![[ ]](/icons/layout.gif) | Riverside County Wom..> | 2025-06-20 07:53 | 91K | |
![[ ]](/icons/layout.gif) | Citrus Heights Man P..> | 2025-04-25 08:42 | 91K | |
![[ ]](/icons/layout.gif) | Hazleton_Man_Sentenc..> | 2024-10-04 11:53 | 91K | |
![[ ]](/icons/layout.gif) | Three Individuals Se..> | 2024-10-04 11:53 | 91K | |
![[ ]](/icons/layout.gif) | Former SBA Employee ..> | 2025-06-18 08:12 | 91K | |
![[ ]](/icons/layout.gif) | CFO_CT_Insurance_Fir..> | 2024-10-04 11:53 | 91K | |
![[ ]](/icons/layout.gif) | Pharmaceutical_Sales..> | 2024-10-04 11:53 | 91K | |
![[ ]](/icons/layout.gif) | Former_New_Bedford_M..> | 2024-10-04 11:53 | 91K | |
![[ ]](/icons/layout.gif) | Springfield_Woman_In..> | 2024-10-04 11:53 | 92K | |
![[ ]](/icons/layout.gif) | Lehi Man Sentenced f..> | 2024-10-04 11:53 | 92K | |
![[ ]](/icons/layout.gif) | Two Maryland Men Ind..> | 2024-12-20 14:47 | 92K | |
![[ ]](/icons/layout.gif) | Two Arizona DES Empl..> | 2025-02-11 15:50 | 92K | |
![[ ]](/icons/layout.gif) | North Providence Wom..> | 2024-10-04 11:53 | 92K | |
![[ ]](/icons/layout.gif) | Former Local 98 Busi..> | 2024-10-04 11:53 | 92K | |
![[ ]](/icons/layout.gif) | Former_Rogers_Compan..> | 2024-10-04 11:53 | 92K | |
![[ ]](/icons/layout.gif) | Rochester_Man_Who_Bi..> | 2024-10-04 11:53 | 92K | |
![[ ]](/icons/layout.gif) | Suburban_Chicago_Man..> | 2024-10-04 11:53 | 92K | |
![[ ]](/icons/layout.gif) | D_MD_Indictment_Rele..> | 2024-10-04 11:53 | 92K | |
![[ ]](/icons/layout.gif) | Eight_Individuals_In..> | 2024-10-04 11:53 | 92K | |
![[ ]](/icons/layout.gif) | Conspirators Sentenc..> | 2024-10-04 11:53 | 92K | |
![[ ]](/icons/layout.gif) | PUA Arrests-02152022..> | 2024-10-04 11:53 | 92K | |
![[ ]](/icons/layout.gif) | NATIONAL HEALTHCARE ..> | 2024-10-04 11:53 | 93K | |
![[ ]](/icons/layout.gif) | Woman Admits Multimi..> | 2024-10-04 11:53 | 93K | |
![[ ]](/icons/layout.gif) | Attorney General Miy..> | 2024-10-04 11:53 | 93K | |
![[ ]](/icons/layout.gif) | Fomer_LA_Woman_Indic..> | 2024-10-04 11:53 | 93K | |
![[ ]](/icons/layout.gif) | Twelve_Individuals_I..> | 2024-10-04 11:53 | 93K | |
![[ ]](/icons/layout.gif) | Former Amtrak Employ..> | 2025-07-18 09:38 | 93K | |
![[ ]](/icons/layout.gif) | Two_felons_sentenced..> | 2024-10-04 11:53 | 93K | |
![[ ]](/icons/layout.gif) | Springfield_Company_..> | 2024-10-04 11:53 | 93K | |
![[ ]](/icons/layout.gif) | Maryland Men Sentenc..> | 2024-10-04 11:53 | 93K | |
![[ ]](/icons/layout.gif) | Charlotte_Man_Is_Cha..> | 2024-10-04 11:53 | 93K | |
![[ ]](/icons/layout.gif) | Career_Coach_Pleads_..> | 2024-10-04 11:53 | 93K | |
![[ ]](/icons/layout.gif) | 25 Charged in Federa..> | 2024-10-04 11:53 | 93K | |
![[ ]](/icons/layout.gif) | Doctor Sentenced for..> | 2024-10-04 11:53 | 93K | |
![[ ]](/icons/layout.gif) | Two_Women_Charged_Wi..> | 2024-10-04 11:53 | 93K | |
![[ ]](/icons/layout.gif) | MARYLAND BUSINESSMAN..> | 2024-10-04 11:53 | 94K | |
![[ ]](/icons/layout.gif) | San Bernardino Count..> | 2024-11-06 08:26 | 94K | |
![[ ]](/icons/layout.gif) | Bank contractor sent..> | 2025-07-23 08:42 | 94K | |
![[ ]](/icons/layout.gif) | Owner of Farm Labor ..> | 2024-10-04 11:53 | 94K | |
![[ ]](/icons/layout.gif) | Six Philadelphia-Are..> | 2024-10-04 11:53 | 94K | |
![[ ]](/icons/layout.gif) | Georgia Woman Senten..> | 2024-10-25 14:30 | 94K | |
![[ ]](/icons/layout.gif) | Honduran National Pl..> | 2025-07-31 08:14 | 94K | |
![[ ]](/icons/layout.gif) | FORMER EDD EMPLOYEE ..> | 2024-10-04 11:53 | 94K | |
![[ ]](/icons/layout.gif) | Inglewood Woman Arre..> | 2025-07-08 13:45 | 94K | |
![[ ]](/icons/layout.gif) | Long Beach Man Sente..> | 2024-10-04 11:53 | 94K | |
![[ ]](/icons/layout.gif) | Six_Defendants_Charg..> | 2024-10-04 11:53 | 95K | |
![[ ]](/icons/layout.gif) | Maryland Man Pleads ..> | 2025-04-02 15:54 | 95K | |
![[ ]](/icons/layout.gif) | Nanticoke Man Charge..> | 2025-08-01 10:18 | 95K | |
![[ ]](/icons/layout.gif) | Postal Employee Plea..> | 2024-12-06 08:01 | 95K | |
![[ ]](/icons/layout.gif) | AZ_Man_Pleads_Guilty..> | 2024-10-04 11:53 | 95K | |
![[ ]](/icons/layout.gif) | Nigerian who defraud..> | 2025-01-29 08:43 | 95K | |
![[ ]](/icons/layout.gif) | Texas Pharmacist Sen..> | 2025-03-11 08:08 | 95K | |
![[ ]](/icons/layout.gif) | Leader of Yoga to th..> | 2025-06-30 15:18 | 95K | |
![[ ]](/icons/layout.gif) | Jury_Convicts_Maryla..> | 2024-10-04 11:53 | 95K | |
![[ ]](/icons/layout.gif) | MD Man Sentenced to ..> | 2025-04-07 09:09 | 95K | |
![[ ]](/icons/layout.gif) | SUTTER COUNTY WOMEN ..> | 2024-10-04 11:53 | 95K | |
![[ ]](/icons/layout.gif) | Former Manager Of In..> | 2024-10-04 11:53 | 95K | |
![[ ]](/icons/layout.gif) | york john sen.pdf | 2024-10-04 11:53 | 96K | |
![[ ]](/icons/layout.gif) | Nationwide Lawsuit F..> | 2024-12-18 16:00 | 96K | |
![[ ]](/icons/layout.gif) | Leesburg_Woman_Charg..> | 2024-10-04 11:53 | 96K | |
![[ ]](/icons/layout.gif) | Floral Company Pays ..> | 2024-10-04 11:53 | 96K | |
![[ ]](/icons/layout.gif) | Former NYCHA Superin..> | 2025-05-29 08:09 | 96K | |
![[ ]](/icons/layout.gif) | D.C. Corrections Off..> | 2024-10-04 11:53 | 96K | |
![[ ]](/icons/layout.gif) | Seven_charged_for_ro..> | 2024-10-04 11:53 | 96K | |
![[ ]](/icons/layout.gif) | Baltimore Man Senten..> | 2025-03-18 08:50 | 96K | |
![[ ]](/icons/layout.gif) | Tolland Man Charged ..> | 2025-07-03 08:26 | 96K | |
![[ ]](/icons/layout.gif) | Two Defendants Plead..> | 2024-10-04 11:53 | 96K | |
![[ ]](/icons/layout.gif) | Miami Man Sentenced ..> | 2025-06-25 07:48 | 96K | |
![[ ]](/icons/layout.gif) | Transit_Union_Plea.pdf | 2024-10-04 11:53 | 96K | |
![[ ]](/icons/layout.gif) | FCA_Pleads_Guilty_To..> | 2024-10-04 11:53 | 96K | |
![[ ]](/icons/layout.gif) | Florida Man Sentence..> | 2024-10-04 11:53 | 97K | |
![[ ]](/icons/layout.gif) | Five People Indicted..> | 2025-07-29 09:04 | 97K | |
![[ ]](/icons/layout.gif) | Social Security Admi..> | 2025-07-03 08:27 | 97K | |
![[ ]](/icons/layout.gif) | Two_SCI_Inmates_Two_..> | 2024-10-04 11:53 | 97K | |
![[ ]](/icons/layout.gif) | Serial Fraudster Sen..> | 2025-02-03 13:18 | 97K | |
![[ ]](/icons/layout.gif) | Former CEO of Los An..> | 2024-10-04 11:53 | 97K | |
![[ ]](/icons/layout.gif) | Baltimore Man Pleads..> | 2025-05-15 09:43 | 97K | |
![[ ]](/icons/layout.gif) | Melrose_Man_Sentence..> | 2024-10-04 11:53 | 97K | |
![[ ]](/icons/layout.gif) | Owner_Insurance_Firm..> | 2024-10-04 11:53 | 97K | |
![[ ]](/icons/layout.gif) | New_Cumberland_Man_S..> | 2024-10-04 11:53 | 97K | |
![[ ]](/icons/layout.gif) | Defendant_Charged_In..> | 2024-10-04 11:53 | 97K | |
![[ ]](/icons/layout.gif) | Chicago Attorney Ind..> | 2024-12-20 08:48 | 97K | |
![[ ]](/icons/layout.gif) | Olathe Women Schemes..> | 2024-10-04 11:53 | 97K | |
![[ ]](/icons/layout.gif) | Cook County Man Sent..> | 2024-10-04 11:53 | 97K | |
![[ ]](/icons/layout.gif) | CEO and Medical Dire..> | 2025-08-01 08:15 | 97K | |
![[ ]](/icons/layout.gif) | Dominican National S..> | 2024-10-04 11:53 | 97K | |
![[ ]](/icons/layout.gif) | Former NYCHA Superin..> | 2025-05-07 07:47 | 97K | |
![[ ]](/icons/layout.gif) | Old_Town_Man_Pleads_..> | 2024-10-04 11:53 | 97K | |
![[ ]](/icons/layout.gif) | Pain-Management Doct..> | 2025-01-23 08:40 | 97K | |
![[ ]](/icons/layout.gif) | D_MA_Release.pdf | 2024-10-04 11:53 | 97K | |
![[ ]](/icons/layout.gif) | USAO_ED_MI_Former_In..> | 2024-10-04 11:53 | 98K | |
![[ ]](/icons/layout.gif) | SD_MS_Release.pdf | 2024-10-04 11:53 | 98K | |
![[ ]](/icons/layout.gif) | Man Sentenced to Eig..> | 2024-10-04 11:53 | 98K | |
![[ ]](/icons/layout.gif) | Federal Grand Jury i..> | 2025-08-01 08:00 | 98K | |
![[ ]](/icons/layout.gif) | H-Block Gang Member ..> | 2025-08-01 08:17 | 98K | |
![[ ]](/icons/layout.gif) | Former NYCHA Superin..> | 2025-02-26 17:05 | 98K | |
![[ ]](/icons/layout.gif) | Troy Man Charged Wit..> | 2024-12-20 08:48 | 98K | |
![[ ]](/icons/layout.gif) | Texan_Sentenced_CARE..> | 2024-10-04 11:53 | 98K | |
![[ ]](/icons/layout.gif) | Owners of Northern A..> | 2025-07-17 14:38 | 98K | |
![[ ]](/icons/layout.gif) | Union Officials Plea..> | 2024-10-04 11:53 | 98K | |
![[ ]](/icons/layout.gif) | Mexican And Honduran..> | 2024-10-04 11:53 | 98K | |
![[ ]](/icons/layout.gif) | Florida Woman Senten..> | 2025-04-28 16:33 | 98K | |
![[ ]](/icons/layout.gif) | Ex-Husband of RHNJ S..> | 2024-10-16 08:26 | 98K | |
![[ ]](/icons/layout.gif) | ND_IL_Release.pdf | 2024-10-04 11:53 | 98K | |
![[ ]](/icons/layout.gif) | Former_Union_Officia..> | 2024-10-04 11:53 | 98K | |
![[ ]](/icons/layout.gif) | Former_UAW_Regional_..> | 2024-10-04 11:53 | 98K | |
![[ ]](/icons/layout.gif) | Electrical Contracto..> | 2024-10-04 11:53 | 98K | |
![[ ]](/icons/layout.gif) | Two_Marketers_Senten..> | 2024-10-04 11:53 | 99K | |
![[ ]](/icons/layout.gif) | Monessen_Woman_Sente..> | 2024-10-04 11:53 | 99K | |
![[ ]](/icons/layout.gif) | MO_State_Employee_Ac..> | 2024-10-04 11:53 | 99K | |
![[ ]](/icons/layout.gif) | Two Houston Resident..> | 2024-10-04 11:53 | 99K | |
![[ ]](/icons/layout.gif) | Novi_Man_Charged_UI_..> | 2024-10-04 11:53 | 99K | |
![[ ]](/icons/layout.gif) | Former_Bath_Iron_Wor..> | 2024-10-04 11:53 | 99K | |
![[ ]](/icons/layout.gif) | Nigerian_National_Ch..> | 2024-10-04 11:53 | 99K | |
![[ ]](/icons/layout.gif) | Defendant Sentenced ..> | 2024-10-04 11:53 | 99K | |
![[ ]](/icons/layout.gif) | Jury Finds Tampa Man..> | 2024-10-04 11:53 | 99K | |
![[ ]](/icons/layout.gif) | D_NJ_Release_2.pdf | 2024-10-04 11:53 | 99K | |
![[ ]](/icons/layout.gif) | Everett Man Sentence..> | 2024-10-04 11:53 | 99K | |
![[ ]](/icons/layout.gif) | D_MA_Lawrence.pdf | 2024-10-04 11:53 | 99K | |
![[ ]](/icons/layout.gif) | Longtime Gang Member..> | 2025-07-29 09:04 | 99K | |
![[ ]](/icons/layout.gif) | Middlefield_Man_Plea..> | 2024-10-04 11:53 | 99K | |
![[ ]](/icons/layout.gif) | Dudley_Man_Arrested_..> | 2024-10-04 11:53 | 99K | |
![[ ]](/icons/layout.gif) | Additional_Charges_C..> | 2024-10-04 11:53 | 99K | |
![[ ]](/icons/layout.gif) | H Block Gang Member ..> | 2025-04-11 07:46 | 100K | |
![[ ]](/icons/layout.gif) | San Francisco Acupun..> | 2024-10-04 11:53 | 100K | |
![[ ]](/icons/layout.gif) | Former_Air_Force_Emp..> | 2024-10-04 11:53 | 100K | |
![[ ]](/icons/layout.gif) | Leader Of $23 Millio..> | 2025-03-28 08:38 | 100K | |
![[ ]](/icons/layout.gif) | Brockton_Man_Charged..> | 2024-10-04 11:53 | 100K | |
![[ ]](/icons/layout.gif) | Omaha Company Senten..> | 2024-10-04 11:53 | 100K | |
![[ ]](/icons/layout.gif) | Boston Man Sentenced..> | 2024-12-20 08:48 | 100K | |
![[ ]](/icons/layout.gif) | Former Bureau of Lab..> | 2025-04-04 08:08 | 100K | |
![[ ]](/icons/layout.gif) | Leicester_Man_Arrest..> | 2024-10-04 11:53 | 100K | |
![[ ]](/icons/layout.gif) | Former_Employee_Yout..> | 2024-10-04 11:53 | 100K | |
![[ ]](/icons/layout.gif) | Former_Postal_Employ..> | 2024-10-04 11:53 | 100K | |
![[ ]](/icons/layout.gif) | West New York Financ..> | 2024-11-19 13:32 | 100K | |
![[ ]](/icons/layout.gif) | Former Union Officia..> | 2024-10-04 11:53 | 100K | |
![[ ]](/icons/layout.gif) | D_NJ_Release.pdf | 2024-10-04 11:53 | 100K | |
![[ ]](/icons/layout.gif) | Baldwinsville Man Se..> | 2024-10-04 11:53 | 100K | |
![[ ]](/icons/layout.gif) | Former EDD Employee ..> | 2025-03-28 14:37 | 100K | |
![[ ]](/icons/layout.gif) | Allen_Park_Tax_Prepa..> | 2024-10-04 11:53 | 100K | |
![[ ]](/icons/layout.gif) | Everett Man Pleads G..> | 2024-10-04 11:53 | 100K | |
![[ ]](/icons/layout.gif) | Former Mail Carrier ..> | 2024-10-04 11:53 | 100K | |
![[ ]](/icons/layout.gif) | Louisville_Pharmacis..> | 2024-10-04 11:53 | 100K | |
![[ ]](/icons/layout.gif) | Waterbury_Man_Charge..> | 2024-10-04 11:53 | 100K | |
![[ ]](/icons/layout.gif) | Saratoga_Springs_Man..> | 2024-10-04 11:53 | 100K | |
![[ ]](/icons/layout.gif) | Acton_and_Manchester..> | 2024-10-04 11:53 | 100K | |
![[ ]](/icons/layout.gif) | Seven Maryland Resid..> | 2024-10-04 11:53 | 100K | |
![[ ]](/icons/layout.gif) | Former SBA Employee ..> | 2024-10-04 11:53 | 101K | |
![[ ]](/icons/layout.gif) | Bergen County, New J..> | 2024-10-04 11:53 | 101K | |
![[ ]](/icons/layout.gif) | Three_Men_Sentenced_..> | 2024-10-04 11:53 | 101K | |
![[ ]](/icons/layout.gif) | Detroit Man Sentence..> | 2024-10-04 11:53 | 101K | |
![[ ]](/icons/layout.gif) | IN_Woman_Sentenced_2..> | 2024-10-04 11:53 | 101K | |
![[ ]](/icons/layout.gif) | Couple Indicted For ..> | 2024-10-04 11:53 | 101K | |
![[ ]](/icons/layout.gif) | Haverhill Man Indict..> | 2024-10-04 11:53 | 101K | |
![[ ]](/icons/layout.gif) | Pharmacist_sent_to_p..> | 2024-10-04 11:53 | 101K | |
![[ ]](/icons/layout.gif) | Former LWC Subcontra..> | 2025-07-25 07:59 | 101K | |
![[ ]](/icons/layout.gif) | Owner of Gire Roofin..> | 2024-10-04 11:53 | 101K | |
![[ ]](/icons/layout.gif) | Weymouth Man Pleads ..> | 2025-07-16 08:02 | 101K | |
![[ ]](/icons/layout.gif) | East_Chicago_Woman_C..> | 2024-10-04 11:53 | 101K | |
![[ ]](/icons/layout.gif) | Twenty Seven Indiana..> | 2024-10-04 11:53 | 101K | |
![[ ]](/icons/layout.gif) | Former_Uniontown_Man..> | 2024-10-04 11:53 | 101K | |
![[ ]](/icons/layout.gif) | Former_Illinois_Stat..> | 2024-10-04 11:53 | 101K | |
![[ ]](/icons/layout.gif) | Philadelphia, Lehigh..> | 2024-10-04 11:53 | 101K | |
![[ ]](/icons/layout.gif) | Boston Gang Member S..> | 2025-06-27 08:12 | 101K | |
![[ ]](/icons/layout.gif) | Two Men Sentenced fo..> | 2024-10-04 11:53 | 101K | |
![[ ]](/icons/layout.gif) | Florida Businessman ..> | 2025-02-21 07:50 | 101K | |
![[ ]](/icons/layout.gif) | Owner of Boston Pizz..> | 2024-10-28 10:42 | 101K | |
![[ ]](/icons/layout.gif) | Suffolk County Corre..> | 2024-12-13 11:53 | 101K | |
![[ ]](/icons/layout.gif) | Former_Branch_Manage..> | 2024-10-04 11:53 | 101K | |
![[ ]](/icons/layout.gif) | Las_Vegas_Woman_Sent..> | 2024-10-04 11:53 | 101K | |
![[ ]](/icons/layout.gif) | ElHadik_plea_AUS.pdf | 2024-10-04 11:53 | 101K | |
![[ ]](/icons/layout.gif) | Bergen County, New J..> | 2024-10-04 11:53 | 102K | |
![[ ]](/icons/layout.gif) | Portland Man Sentenc..> | 2024-10-21 09:23 | 102K | |
![[ ]](/icons/layout.gif) | FCA_US_LLC_Charged_f..> | 2024-10-04 11:53 | 102K | |
![[ ]](/icons/layout.gif) | Former President of ..> | 2024-10-04 11:53 | 102K | |
![[ ]](/icons/layout.gif) | Second Wayne County ..> | 2024-10-04 11:53 | 102K | |
![[ ]](/icons/layout.gif) | Owner Of Insurance F..> | 2024-10-04 11:53 | 102K | |
![[ ]](/icons/layout.gif) | San Francisco Acupun..> | 2024-10-04 11:53 | 102K | |
![[ ]](/icons/layout.gif) | Brothers_Chicago_Cha..> | 2024-10-04 11:53 | 102K | |
![[ ]](/icons/layout.gif) | Hampton_Gang_Member_..> | 2024-10-04 11:53 | 102K | |
![[ ]](/icons/layout.gif) | Passaic_County_Lawye..> | 2024-10-04 11:53 | 102K | |
![[ ]](/icons/layout.gif) | Second Canadian resi..> | 2024-10-04 11:53 | 102K | |
![[ ]](/icons/layout.gif) | Former Carpenters Be..> | 2024-10-04 11:53 | 102K | |
![[ ]](/icons/layout.gif) | Las Vegas Woman Indi..> | 2024-10-04 11:53 | 102K | |
![[ ]](/icons/layout.gif) | Philly_Contractor_Co..> | 2024-10-04 11:53 | 102K | |
![[ ]](/icons/layout.gif) | Iowa Farmer Sentence..> | 2024-10-15 09:18 | 102K | |
![[ ]](/icons/layout.gif) | Nursing Home Operato..> | 2024-10-04 11:53 | 102K | |
![[ ]](/icons/layout.gif) | Batavia_Woman_Pleads..> | 2024-10-04 11:53 | 102K | |
![[ ]](/icons/layout.gif) | Former NYCHA Superin..> | 2025-02-03 08:16 | 102K | |
![[ ]](/icons/layout.gif) | Business Manager and..> | 2024-10-04 11:53 | 102K | |
![[ ]](/icons/layout.gif) | NOLA_Company_Sentenc..> | 2024-10-04 11:53 | 102K | |
![[ ]](/icons/layout.gif) | Two_Chicago_Physicia..> | 2024-10-04 11:53 | 102K | |
![[ ]](/icons/layout.gif) | Dominican_National_P..> | 2024-10-04 11:53 | 102K | |
![[ ]](/icons/layout.gif) | New Britain Woman Ad..> | 2025-04-04 08:05 | 102K | |
![[ ]](/icons/layout.gif) | Haney_plea_AUS 12.14..> | 2024-10-04 11:53 | 102K | |
![[ ]](/icons/layout.gif) | Financial_Secretary-..> | 2024-10-04 11:53 | 102K | |
![[ ]](/icons/layout.gif) | Pierre_Woman_Charged..> | 2024-10-04 11:53 | 102K | |
![[ ]](/icons/layout.gif) | Former_SUNY_Student_..> | 2024-10-04 11:53 | 102K | |
![[ ]](/icons/layout.gif) | Sarasota_Man_Sentenc..> | 2024-10-04 11:53 | 102K | |
![[ ]](/icons/layout.gif) | Lebanon_County_Man_S..> | 2024-10-04 11:53 | 102K | |
![[ ]](/icons/layout.gif) | Former Postal Employ..> | 2024-10-04 11:53 | 102K | |
![[ ]](/icons/layout.gif) | Hampton_Man_Pleads_G..> | 2024-10-04 11:53 | 103K | |
![[ ]](/icons/layout.gif) | Troy Man Pleads Guil..> | 2024-10-04 11:53 | 103K | |
![[ ]](/icons/layout.gif) | Two_Postal_Employees..> | 2024-10-04 11:53 | 103K | |
![[ ]](/icons/layout.gif) | Former_IL_State_Sen_..> | 2024-10-04 11:53 | 103K | |
![[ ]](/icons/layout.gif) | Fairfield County Hed..> | 2024-10-04 11:53 | 103K | |
![[ ]](/icons/layout.gif) | NJ_Man_Admits_Steali..> | 2024-10-04 11:53 | 103K | |
![[ ]](/icons/layout.gif) | Three West Tennessee..> | 2025-07-01 08:07 | 103K | |
![[ ]](/icons/layout.gif) | Batavia_Woman_Arrest..> | 2024-10-04 11:53 | 103K | |
![[ ]](/icons/layout.gif) | Woodbridge man plead..> | 2024-10-04 11:53 | 103K | |
![[ ]](/icons/layout.gif) | Two Consulting Compa..> | 2025-03-21 08:46 | 103K | |
![[ ]](/icons/layout.gif) | Detroit_Man_Sentence..> | 2024-10-04 11:53 | 103K | |
![[ ]](/icons/layout.gif) | Former Massachusetts..> | 2025-02-10 09:14 | 103K | |
![[ ]](/icons/layout.gif) | Four Sentenced in 11..> | 2025-05-09 08:05 | 103K | |
![[ ]](/icons/layout.gif) | Monmouth_County_Man_..> | 2024-10-04 11:53 | 103K | |
![[ ]](/icons/layout.gif) | Justice_Department_F..> | 2024-10-04 11:53 | 103K | |
![[ ]](/icons/layout.gif) | New York Man Sentenc..> | 2025-04-04 08:07 | 103K | |
![[ ]](/icons/layout.gif) | D_WV_UI_Scheme.pdf | 2024-10-04 11:53 | 103K | |
![[ ]](/icons/layout.gif) | Political Organizer ..> | 2025-02-14 08:58 | 103K | |
![[ ]](/icons/layout.gif) | IL_Man_Sentenced_55_..> | 2024-10-04 11:53 | 103K | |
![[ ]](/icons/layout.gif) | Norton_Man_Sentenced..> | 2024-10-04 11:53 | 103K | |
![[ ]](/icons/layout.gif) | CA_Man_Pleads_Guilty..> | 2024-10-04 11:53 | 103K | |
![[ ]](/icons/layout.gif) | John_Doe_Charged_Sup..> | 2024-10-04 11:53 | 103K | |
![[ ]](/icons/layout.gif) | Union_Members_Plead_..> | 2024-10-04 11:53 | 103K | |
![[ ]](/icons/layout.gif) | South_Jersey_Dr.D_NJ..> | 2024-10-04 11:53 | 103K | |
![[ ]](/icons/layout.gif) | Los Angeles Man Plea..> | 2024-10-04 11:53 | 103K | |
![[ ]](/icons/layout.gif) | General_Contracting_..> | 2024-10-04 11:53 | 104K | |
![[ ]](/icons/layout.gif) | Bristol_Man_Sentence..> | 2024-10-04 11:53 | 104K | |
![[ ]](/icons/layout.gif) | Bergen County Man Ad..> | 2024-10-04 11:53 | 104K | |
![[ ]](/icons/layout.gif) | Southwest_Man_Senten..> | 2024-10-04 11:53 | 104K | |
![[ ]](/icons/layout.gif) | Texas_Man_Pleads_Gui..> | 2024-10-04 11:53 | 104K | |
![[ ]](/icons/layout.gif) | Ocean_County_Insuran..> | 2024-10-04 11:53 | 104K | |
![[ ]](/icons/layout.gif) | Former Atlanta Regio..> | 2024-10-04 11:53 | 104K | |
![[ ]](/icons/layout.gif) | California Man Charg..> | 2024-10-04 11:53 | 104K | |
![[ ]](/icons/layout.gif) | DNJ_OSHA.pdf | 2024-10-04 11:53 | 104K | |
![[ ]](/icons/layout.gif) | Tampa_Men_Sentenced_..> | 2024-10-04 11:53 | 104K | |
![[ ]](/icons/layout.gif) | Plymouth Man Pleads ..> | 2024-10-04 11:53 | 104K | |
![[ ]](/icons/layout.gif) | CA_Woman_Pleads_guil..> | 2024-10-04 11:53 | 104K | |
![[ ]](/icons/layout.gif) | Former_PR_Sen_Former..> | 2024-10-04 11:53 | 104K | |
![[ ]](/icons/layout.gif) | Castlewood_man_Sente..> | 2024-10-04 11:53 | 104K | |
![[ ]](/icons/layout.gif) | ED_MI_UI_Indicted.pdf | 2024-10-04 11:53 | 104K | |
![[ ]](/icons/layout.gif) | Former_NYC_Dept_of_B..> | 2024-10-04 11:53 | 104K | |
![[ ]](/icons/layout.gif) | Three_Charged_Steali..> | 2024-10-04 11:53 | 104K | |
![[ ]](/icons/layout.gif) | CT_Nursing_Home_Oper..> | 2024-10-04 11:53 | 104K | |
![[ ]](/icons/layout.gif) | Owner Of Hudson Coun..> | 2024-10-04 11:53 | 104K | |
![[ ]](/icons/layout.gif) | NJ_Man_Indicted_Frau..> | 2024-10-04 11:53 | 104K | |
![[ ]](/icons/layout.gif) | Dodge_County_Strip_C..> | 2024-10-04 11:53 | 104K | |
![[ ]](/icons/layout.gif) | Five People Charged ..> | 2024-10-04 11:53 | 104K | |
![[ ]](/icons/layout.gif) | Tampa_Woman_Charged_..> | 2024-10-04 11:53 | 105K | |
![[ ]](/icons/layout.gif) | SW_VA_Man_Sentenced_..> | 2024-10-04 11:53 | 105K | |
![[ ]](/icons/layout.gif) | College_Football_Pla..> | 2024-10-04 11:53 | 105K | |
![[ ]](/icons/layout.gif) | Construction Manager..> | 2025-05-29 08:07 | 105K | |
![[ ]](/icons/layout.gif) | Former_Treasurer_of_..> | 2024-10-04 11:53 | 105K | |
![[ ]](/icons/layout.gif) | NDGA_Atl_UI.pdf | 2024-10-04 11:53 | 105K | |
![[ ]](/icons/layout.gif) | PA_Inmate_Sentenced_..> | 2024-10-04 11:53 | 105K | |
![[ ]](/icons/layout.gif) | FL_Man_Sentenced_COV..> | 2024-10-04 11:53 | 105K | |
![[ ]](/icons/layout.gif) | Former Vice Presiden..> | 2024-10-04 11:53 | 105K | |
![[ ]](/icons/layout.gif) | Baton Rouge Doctor S..> | 2024-10-04 11:53 | 105K | |
![[ ]](/icons/layout.gif) | Six_Defendants_Arres..> | 2024-10-04 11:53 | 105K | |
![[ ]](/icons/layout.gif) | Two_Charged_Particip..> | 2024-10-04 11:53 | 105K | |
![[ ]](/icons/layout.gif) | Vietnamese National ..> | 2024-11-19 08:40 | 105K | |
![[ ]](/icons/layout.gif) | Fort Smith Arms Deal..> | 2024-10-04 11:53 | 105K | |
![[ ]](/icons/layout.gif) | Three Sutter County ..> | 2024-10-04 11:53 | 105K | |
![[ ]](/icons/layout.gif) | COVID-19 Testing Fra..> | 2024-10-04 11:53 | 105K | |
![[ ]](/icons/layout.gif) | Sioux_City_Woman_Sen..> | 2024-10-04 11:53 | 105K | |
![[ ]](/icons/layout.gif) | Manager of Clothing ..> | 2024-10-04 11:53 | 105K | |
![[ ]](/icons/layout.gif) | Members of Violent â..> | 2025-06-27 08:10 | 105K | |
![[ ]](/icons/layout.gif) | Pain Doctors Sentenc..> | 2024-10-04 11:53 | 105K | |
![[ ]](/icons/layout.gif) | Essex_County_Man_Sen..> | 2024-10-04 11:53 | 105K | |
![[ ]](/icons/layout.gif) | Abel Nazario-Quinone..> | 2024-10-04 11:53 | 105K | |
![[ ]](/icons/layout.gif) | Leicester_Woman_and_..> | 2024-10-04 11:53 | 105K | |
![[ ]](/icons/layout.gif) | Camden_County_Man_Ad..> | 2024-10-04 11:53 | 105K | |
![[ ]](/icons/layout.gif) | Doctor_Admits_Crimin..> | 2024-10-04 11:53 | 105K | |
![[ ]](/icons/layout.gif) | CA_Marketer_Sentence..> | 2024-10-04 11:53 | 105K | |
![[ ]](/icons/layout.gif) | Former President Of ..> | 2024-10-04 11:53 | 105K | |
![[ ]](/icons/layout.gif) | Office_Manager_and_S..> | 2024-10-04 11:53 | 105K | |
![[ ]](/icons/layout.gif) | Two_NJ_Men_Admit_Hea..> | 2024-10-04 11:53 | 105K | |
![[ ]](/icons/layout.gif) | Illinois Man Sentenc..> | 2024-10-04 11:53 | 105K | |
![[ ]](/icons/layout.gif) | Strauss_sentenced.pdf | 2024-10-04 11:53 | 106K | |
![[ ]](/icons/layout.gif) | Midlothian_Woman_Ple..> | 2024-10-04 11:53 | 106K | |
![[ ]](/icons/layout.gif) | Simsbury Man Sentenc..> | 2024-10-04 11:53 | 106K | |
![[ ]](/icons/layout.gif) | Maryland Department ..> | 2024-10-04 11:53 | 106K | |
![[ ]](/icons/layout.gif) | Lackawanna County Ma..> | 2024-10-04 11:53 | 106K | |
![[ ]](/icons/layout.gif) | Lawrence_Woman_Sente..> | 2024-10-04 11:53 | 106K | |
![[ ]](/icons/layout.gif) | Mexican National Adm..> | 2024-11-25 08:14 | 106K | |
![[ ]](/icons/layout.gif) | Texas_Defraud_NDCA.pdf | 2024-10-04 11:53 | 106K | |
![[ ]](/icons/layout.gif) | SDNY_UI_Release.pdf | 2024-10-04 11:53 | 106K | |
![[ ]](/icons/layout.gif) | Fourteen Individuals..> | 2024-10-04 11:53 | 106K | |
![[ ]](/icons/layout.gif) | Stoneham_Woman_Plead..> | 2024-10-04 11:53 | 106K | |
![[ ]](/icons/layout.gif) | Virginia_Company_Pay..> | 2024-10-04 11:53 | 106K | |
![[ ]](/icons/layout.gif) | Eleven_Defendants_Fa..> | 2024-10-04 11:53 | 106K | |
![[ ]](/icons/layout.gif) | TX_Woman_Sentenced_U..> | 2024-10-04 11:53 | 106K | |
![[ ]](/icons/layout.gif) | Two Boston City Hall..> | 2024-10-04 11:53 | 106K | |
![[ ]](/icons/layout.gif) | Tracy_Woman_Indicted..> | 2024-10-04 11:53 | 106K | |
![[ ]](/icons/layout.gif) | SW_VA_Man_Sentenced_..> | 2024-10-04 11:53 | 106K | |
![[ ]](/icons/layout.gif) | MI_Man_Arrested_UI_F..> | 2024-10-04 11:53 | 106K | |
![[ ]](/icons/layout.gif) | Two Boston City Hall..> | 2024-10-04 11:53 | 106K | |
![[ ]](/icons/layout.gif) | Southern District of..> | 2024-10-04 11:53 | 106K | |
![[ ]](/icons/layout.gif) | Florida Man Sentence..> | 2024-10-04 11:53 | 106K | |
![[ ]](/icons/layout.gif) | Boston_Man_Pleads_Gu..> | 2024-10-04 11:53 | 106K | |
![[ ]](/icons/layout.gif) | Long_Island_Woman_Se..> | 2024-10-04 11:53 | 106K | |
![[ ]](/icons/layout.gif) | Two_Sentenced_Conspi..> | 2024-10-04 11:53 | 106K | |
![[ ]](/icons/layout.gif) | Lawrence_Woman_Plead..> | 2024-10-04 11:53 | 106K | |
![[ ]](/icons/layout.gif) | SDNY_Teamsters_Sente..> | 2024-10-04 11:53 | 106K | |
![[ ]](/icons/layout.gif) | Nigerian_national_in..> | 2024-10-04 11:53 | 106K | |
![[ ]](/icons/layout.gif) | 68 Defendants Charge..> | 2024-10-04 11:53 | 106K | |
![[ ]](/icons/layout.gif) | Texas Man Indicted f..> | 2024-10-04 11:53 | 107K | |
![[ ]](/icons/layout.gif) | Two_Defendants_Charg..> | 2024-10-04 11:53 | 107K | |
![[ ]](/icons/layout.gif) | Queens_Man_Pleads_Gu..> | 2024-10-04 11:53 | 107K | |
![[ ]](/icons/layout.gif) | Allen Park Man Sente..> | 2024-10-04 11:53 | 107K | |
![[ ]](/icons/layout.gif) | Former_New_Bedford_M..> | 2024-10-04 11:53 | 107K | |
![[ ]](/icons/layout.gif) | New_Orleans_Company_..> | 2024-10-04 11:53 | 107K | |
![[ ]](/icons/layout.gif) | Former_Dept_of_Unemp..> | 2024-10-04 11:53 | 107K | |
![[ ]](/icons/layout.gif) | Two_Charged_Submitti..> | 2024-10-04 11:53 | 107K | |
![[ ]](/icons/layout.gif) | Houma Man Sentenced ..> | 2024-10-04 11:53 | 107K | |
![[ ]](/icons/layout.gif) | Iowa_Man_Sentenced_F..> | 2024-10-04 11:53 | 107K | |
![[ ]](/icons/layout.gif) | Bank Manager Admits ..> | 2024-10-04 11:53 | 107K | |
![[ ]](/icons/layout.gif) | Boston_Man_Sentenced..> | 2024-10-04 11:53 | 107K | |
![[ ]](/icons/layout.gif) | Rusk_County_Man_Plea..> | 2024-10-04 11:53 | 107K | |
![[ ]](/icons/layout.gif) | Doctor_Admits_Health..> | 2024-10-04 11:53 | 107K | |
![[ ]](/icons/layout.gif) | Sioux_City_Woman_Ple..> | 2024-10-04 11:53 | 107K | |
![[ ]](/icons/layout.gif) | Former_Local_Union_V..> | 2024-10-04 11:53 | 107K | |
![[ ]](/icons/layout.gif) | Tampa_Man_Sentenced_..> | 2024-10-04 11:53 | 107K | |
![[ ]](/icons/layout.gif) | Portsmouth_Woman_Ple..> | 2024-10-04 11:53 | 107K | |
![[ ]](/icons/layout.gif) | Nigerian Man Sentenc..> | 2024-10-04 11:53 | 107K | |
![[ ]](/icons/layout.gif) | Former_Rogers_Compan..> | 2024-10-04 11:53 | 107K | |
![[ ]](/icons/layout.gif) | Jefferson_City_Busin..> | 2024-10-04 11:53 | 107K | |
![[ ]](/icons/layout.gif) | Federal Indictment C..> | 2024-10-04 11:53 | 107K | |
![[ ]](/icons/layout.gif) | Midlothian_Woman_Sen..> | 2024-10-04 11:53 | 107K | |
![[ ]](/icons/layout.gif) | South Jersey Woman A..> | 2024-10-04 11:53 | 107K | |
![[ ]](/icons/layout.gif) | Former Executive Dir..> | 2024-10-04 11:53 | 107K | |
![[ ]](/icons/layout.gif) | Prince George’s Ma..> | 2025-07-24 08:03 | 107K | |
![[ ]](/icons/layout.gif) | Boston_Man_Pleads_Gu..> | 2024-10-04 11:53 | 107K | |
![[ ]](/icons/layout.gif) | Former Pharmacy Empl..> | 2024-10-04 11:53 | 107K | |
![[ ]](/icons/layout.gif) | Houston_woman_charge..> | 2024-10-04 11:53 | 107K | |
![[ ]](/icons/layout.gif) | Self-Described Pasto..> | 2025-05-12 09:15 | 107K | |
![[ ]](/icons/layout.gif) | Providence_Man_Detai..> | 2024-10-04 11:53 | 107K | |
![[ ]](/icons/layout.gif) | Former_NYPD_Sergeant..> | 2024-10-04 11:53 | 107K | |
![[ ]](/icons/layout.gif) | Florida Man Pleads G..> | 2024-10-04 11:53 | 107K | |
![[ ]](/icons/layout.gif) | GA_Man_Pleads_Guilty..> | 2024-10-04 11:53 | 107K | |
![[ ]](/icons/layout.gif) | VA_Beach_Woman_Sente..> | 2024-10-04 11:53 | 107K | |
![[ ]](/icons/layout.gif) | Two_Niagara_County_M..> | 2024-10-04 11:53 | 108K | |
![[ ]](/icons/layout.gif) | Randa Allison Senten..> | 2024-10-04 11:53 | 108K | |
![[ ]](/icons/layout.gif) | Executive of Louisia..> | 2024-11-14 08:43 | 108K | |
![[ ]](/icons/layout.gif) | Former President Of ..> | 2024-10-04 11:53 | 108K | |
![[ ]](/icons/layout.gif) | Former President Of ..> | 2024-10-04 11:53 | 108K | |
![[ ]](/icons/layout.gif) | Charleston Doctor Pl..> | 2024-10-04 11:53 | 108K | |
![[ ]](/icons/layout.gif) | Father and Son Brook..> | 2024-10-04 11:53 | 108K | |
![[ ]](/icons/layout.gif) | State_Contractor_Sen..> | 2024-10-04 11:53 | 108K | |
![[ ]](/icons/layout.gif) | 8_Civillian_Employee..> | 2024-10-04 11:53 | 108K | |
![[ ]](/icons/layout.gif) | Former Farm Foreman ..> | 2024-10-04 11:53 | 108K | |
![[ ]](/icons/layout.gif) | Navillus_Constructio..> | 2024-10-04 11:53 | 108K | |
![[ ]](/icons/layout.gif) | Four_Sentenced_Role_..> | 2024-10-04 11:53 | 108K | |
![[ ]](/icons/layout.gif) | Two_Niagara_County_M..> | 2024-10-04 11:53 | 108K | |
![[ ]](/icons/layout.gif) | Six Defendants Arres..> | 2024-10-04 11:53 | 108K | |
![[ ]](/icons/layout.gif) | Philly_Pyschiatrist_..> | 2024-10-04 11:53 | 108K | |
![[ ]](/icons/layout.gif) | Rocky River business..> | 2024-10-04 11:53 | 108K | |
![[ ]](/icons/layout.gif) | Williamsburg_Busines..> | 2024-10-04 11:53 | 108K | |
![[ ]](/icons/layout.gif) | Nigerian_National_in..> | 2024-10-04 11:53 | 108K | |
![[ ]](/icons/layout.gif) | Nigerian_citizen_cha..> | 2024-10-04 11:53 | 108K | |
![[ ]](/icons/layout.gif) | West Suburban Dermat..> | 2024-10-04 11:53 | 108K | |
![[ ]](/icons/layout.gif) | Metro-Atlanta Man Ch..> | 2024-10-04 11:53 | 108K | |
![[ ]](/icons/layout.gif) | Attorney Consultant ..> | 2024-10-04 11:53 | 108K | |
![[ ]](/icons/layout.gif) | Orange County Woman ..> | 2024-10-04 11:53 | 108K | |
![[ ]](/icons/layout.gif) | Chester_County_Man_S..> | 2024-10-04 11:53 | 108K | |
![[ ]](/icons/layout.gif) | NDOK_UI.pdf | 2024-10-04 11:53 | 108K | |
![[ ]](/icons/layout.gif) | West_Warwick_Man_Ind..> | 2024-10-04 11:53 | 108K | |
![[ ]](/icons/layout.gif) | Medical_Sales_Rep_Se..> | 2024-10-04 11:53 | 108K | |
![[ ]](/icons/layout.gif) | Texas_Man_Sentenced_..> | 2024-10-04 11:53 | 109K | |
![[ ]](/icons/layout.gif) | Medical_Sales_Rep_Fo..> | 2024-10-04 11:53 | 109K | |
![[ ]](/icons/layout.gif) | West_Warwick_Man_Sen..> | 2024-10-04 11:53 | 109K | |
![[ ]](/icons/layout.gif) | Wayne County Man Sen..> | 2024-10-04 11:53 | 109K | |
![[ ]](/icons/layout.gif) | Woman_Previously_Cha..> | 2024-10-04 11:53 | 109K | |
![[ ]](/icons/layout.gif) | Four_Charlotte_Men_S..> | 2024-10-04 11:53 | 109K | |
![[ ]](/icons/layout.gif) | Organizer_of_Conspir..> | 2024-10-04 11:53 | 109K | |
![[ ]](/icons/layout.gif) | USAO_D-PR_Release.pdf | 2024-10-04 11:53 | 109K | |
![[ ]](/icons/layout.gif) | CEO of Non-Profit th..> | 2024-11-26 08:55 | 109K | |
![[ ]](/icons/layout.gif) | Previously Convicted..> | 2024-12-09 17:45 | 109K | |
![[ ]](/icons/layout.gif) | Hyattsville Man Plea..> | 2024-10-04 11:53 | 109K | |
![[ ]](/icons/layout.gif) | President and Vice P..> | 2024-10-04 11:53 | 109K | |
![[ ]](/icons/layout.gif) | Sandown_Man_Pleads_G..> | 2024-10-04 11:53 | 109K | |
![[ ]](/icons/layout.gif) | Three Former Local 9..> | 2024-10-04 11:53 | 109K | |
![[ ]](/icons/layout.gif) | District_Judge_Enter..> | 2024-10-04 11:53 | 109K | |
![[ ]](/icons/layout.gif) | Serial Fraudster Sen..> | 2024-10-04 11:53 | 109K | |
![[ ]](/icons/layout.gif) | Serial_Fraudster_Sen..> | 2024-10-04 11:53 | 109K | |
![[ ]](/icons/layout.gif) | Castro_Valley_Reside..> | 2024-10-04 11:53 | 109K | |
![[ ]](/icons/layout.gif) | Indian_Trail_Man_Sen..> | 2024-10-04 11:53 | 109K | |
![[ ]](/icons/layout.gif) | Electrostim Medical ..> | 2024-10-04 11:53 | 109K | |
![[ ]](/icons/layout.gif) | Sumerour Trial NDTX ..> | 2024-10-04 11:53 | 109K | |
![[ ]](/icons/layout.gif) | MO_Couple_Plead_Guil..> | 2024-10-04 11:53 | 109K | |
![[ ]](/icons/layout.gif) | Rusk County Man Sent..> | 2024-10-04 11:53 | 110K | |
![[ ]](/icons/layout.gif) | Organized_Crime_Drug..> | 2024-10-04 11:53 | 110K | |
![[ ]](/icons/layout.gif) | Leader sent to priso..> | 2024-10-04 11:53 | 110K | |
![[ ]](/icons/layout.gif) | Prince George’s Co..> | 2024-10-04 11:53 | 110K | |
![[ ]](/icons/layout.gif) | Utah Restaurant Owne..> | 2024-10-04 11:53 | 110K | |
![[ ]](/icons/layout.gif) | Former_State_Employe..> | 2024-10-04 11:53 | 110K | |
![[ ]](/icons/layout.gif) | Rochester_Man_Second..> | 2024-10-04 11:53 | 110K | |
![[ ]](/icons/layout.gif) | O.C. Man Faces Feder..> | 2024-10-04 11:53 | 110K | |
![[ ]](/icons/layout.gif) | General_Contractor_P..> | 2024-10-04 11:53 | 110K | |
![[ ]](/icons/layout.gif) | moving-company-owner..> | 2024-10-04 11:53 | 110K | |
![[ ]](/icons/layout.gif) | 4_Defendants_Charged..> | 2024-10-04 11:53 | 110K | |
![[ ]](/icons/layout.gif) | Metro_ATL_man_charge..> | 2024-10-04 11:53 | 110K | |
![[ ]](/icons/layout.gif) | Twenty_Arrested_Char..> | 2024-10-04 11:53 | 110K | |
![[ ]](/icons/layout.gif) | Former_Waterloo_Medi..> | 2024-10-04 11:53 | 110K | |
![[ ]](/icons/layout.gif) | Former Bureau Of Pri..> | 2024-10-04 11:53 | 110K | |
![[ ]](/icons/layout.gif) | Blankenship Sentence..> | 2024-10-04 11:53 | 110K | |
![[ ]](/icons/layout.gif) | MI_AG_News_Release.pdf | 2024-10-04 11:53 | 110K | |
![[ ]](/icons/layout.gif) | WTC USAO EDVA Press ..> | 2024-10-04 11:53 | 110K | |
![[ ]](/icons/layout.gif) | Two Men Plead Guilty..> | 2024-10-04 11:53 | 111K | |
![[ ]](/icons/layout.gif) | Company Owner Pleads..> | 2024-10-04 11:53 | 111K | |
![[ ]](/icons/layout.gif) | Local Businessman Se..> | 2024-10-04 11:53 | 111K | |
![[ ]](/icons/layout.gif) | 14_Individuals_Charg..> | 2024-10-04 11:53 | 111K | |
![[ ]](/icons/layout.gif) | Previously Convicted..> | 2025-04-10 09:45 | 111K | |
![[ ]](/icons/layout.gif) | Former_ESD_Employee_..> | 2024-10-04 11:53 | 111K | |
![[ ]](/icons/layout.gif) | Eight Former State E..> | 2024-10-04 11:53 | 111K | |
![[ ]](/icons/layout.gif) | Four South Florida R..> | 2024-10-04 11:53 | 111K | |
![[ ]](/icons/layout.gif) | Alabama Woman Senten..> | 2024-10-04 11:53 | 111K | |
![[ ]](/icons/layout.gif) | Parkville_Man_Pleads..> | 2024-10-04 11:53 | 111K | |
![[ ]](/icons/layout.gif) | Tewksbury Woman Sent..> | 2024-10-04 11:53 | 111K | |
![[ ]](/icons/layout.gif) | Houston Pharmacist S..> | 2024-10-04 11:53 | 111K | |
![[ ]](/icons/layout.gif) | Owner_of_a_Tanker_Co..> | 2024-10-04 11:53 | 111K | |
![[ ]](/icons/layout.gif) | President Of Labor U..> | 2024-10-04 11:53 | 111K | |
![[ ]](/icons/layout.gif) | D_MA_UI.pdf | 2024-10-04 11:53 | 111K | |
![[ ]](/icons/layout.gif) | Four Defendants Sent..> | 2024-10-04 11:53 | 112K | |
![[ ]](/icons/layout.gif) | Long Island Woman In..> | 2024-10-04 11:53 | 112K | |
![[ ]](/icons/layout.gif) | Former_State_Employe..> | 2024-10-04 11:53 | 112K | |
![[ ]](/icons/layout.gif) | South Bay Resident C..> | 2024-10-04 11:53 | 112K | |
![[ ]](/icons/layout.gif) | Byrns Plea MDFL WDMO..> | 2024-10-04 11:53 | 112K | |
![[ ]](/icons/layout.gif) | Medford Contractor S..> | 2024-10-04 11:53 | 112K | |
![[ ]](/icons/layout.gif) | Houston_area_residen..> | 2024-10-04 11:53 | 112K | |
![[ ]](/icons/layout.gif) | Hot_Springs_Man_Plea..> | 2024-10-04 11:53 | 112K | |
![[ ]](/icons/layout.gif) | California_Employmen..> | 2024-10-04 11:53 | 112K | |
![[ ]](/icons/layout.gif) | Seven_People_Indcite..> | 2024-10-04 11:53 | 112K | |
![[ ]](/icons/layout.gif) | Ex-Congressman Georg..> | 2025-04-28 08:03 | 112K | |
![[ ]](/icons/layout.gif) | Kurusu_ALP_plea.pdf | 2024-10-04 11:53 | 112K | |
![[ ]](/icons/layout.gif) | 11_Romance_Scammers_..> | 2024-10-04 11:53 | 112K | |
![[ ]](/icons/layout.gif) | Texas_Man_Pleads_Gui..> | 2024-10-04 11:53 | 112K | |
![[ ]](/icons/layout.gif) | CDCA_Mail_Fraud.pdf | 2024-10-04 11:53 | 112K | |
![[ ]](/icons/layout.gif) | Leadership Of Yoga T..> | 2024-10-04 11:53 | 112K | |
![[ ]](/icons/layout.gif) | CEO Of Denver Techno..> | 2024-10-04 11:53 | 112K | |
![[ ]](/icons/layout.gif) | Former UAW Vice Pres..> | 2024-10-04 11:53 | 112K | |
![[ ]](/icons/layout.gif) | Founders_Boston_Nonp..> | 2024-10-04 11:53 | 112K | |
![[ ]](/icons/layout.gif) | Vista_Man_Pleads_Gui..> | 2024-10-04 11:53 | 113K | |
![[ ]](/icons/layout.gif) | Kurusu_ALP_sen_final..> | 2024-10-04 11:53 | 113K | |
![[ ]](/icons/layout.gif) | Rodriguez_Rafael_SA_..> | 2024-10-04 11:53 | 113K | |
![[ ]](/icons/layout.gif) | Home_healthcare_comp..> | 2024-10-04 11:53 | 113K | |
![[ ]](/icons/layout.gif) | Local_98_Leader_Phil..> | 2024-10-04 11:53 | 113K | |
![[ ]](/icons/layout.gif) | Improper Payments Au..> | 2024-10-04 11:53 | 113K | |
![[ ]](/icons/layout.gif) | Fort_Smith_Arms_Deal..> | 2024-10-04 11:53 | 113K | |
![[ ]](/icons/layout.gif) | Southfield_Resident_..> | 2024-10-04 11:53 | 113K | |
![[ ]](/icons/layout.gif) | EDMI_Williams.pdf | 2024-10-04 11:53 | 113K | |
![[ ]](/icons/layout.gif) | Former_WA_State_ESD_..> | 2024-10-04 11:53 | 113K | |
![[ ]](/icons/layout.gif) | Camarillo Man Senten..> | 2024-10-04 11:53 | 113K | |
![[ ]](/icons/layout.gif) | Fourth Defendant in ..> | 2024-10-04 11:53 | 113K | |
![[ ]](/icons/layout.gif) | Two_Postal_Service_E..> | 2024-10-04 11:53 | 114K | |
![[ ]](/icons/layout.gif) | Former Senior UAW Of..> | 2024-10-04 11:53 | 114K | |
![[ ]](/icons/layout.gif) | Haney_Gray_sen_AUS_f..> | 2024-10-04 11:53 | 114K | |
![[ ]](/icons/layout.gif) | Maryland Man Previou..> | 2024-10-04 11:53 | 114K | |
![[ ]](/icons/layout.gif) | Manhattan U.S. Attor..> | 2024-10-04 11:53 | 114K | |
![[ ]](/icons/layout.gif) | Former UAW Vice Pres..> | 2024-10-04 11:53 | 114K | |
![[ ]](/icons/layout.gif) | Business_Owner_Sente..> | 2024-10-04 11:53 | 114K | |
![[ ]](/icons/layout.gif) | Doctor and Office Ma..> | 2024-10-04 11:53 | 114K | |
![[ ]](/icons/layout.gif) | Nigerian_hacker_and_..> | 2024-10-04 11:53 | 114K | |
![[ ]](/icons/layout.gif) | USAO_OWCP_Release.pdf | 2024-10-04 11:53 | 114K | |
![[ ]](/icons/layout.gif) | Former veteran’s s..> | 2025-07-21 07:54 | 114K | |
![[ ]](/icons/layout.gif) | National Health Care..> | 2025-07-01 08:06 | 114K | |
![[ ]](/icons/layout.gif) | Husband_and_Wife_Tea..> | 2024-10-04 11:53 | 115K | |
![[ ]](/icons/layout.gif) | 4 Southern Californi..> | 2025-04-25 08:50 | 115K | |
![[ ]](/icons/layout.gif) | Political Organizer ..> | 2025-07-24 09:20 | 115K | |
![[ ]](/icons/layout.gif) | Defendants_Charged_M..> | 2024-10-04 11:53 | 115K | |
![[ ]](/icons/layout.gif) | Former_Chiropractor_..> | 2024-10-04 11:53 | 115K | |
![[ ]](/icons/layout.gif) | Former State Senator..> | 2024-10-04 11:53 | 115K | |
![[ ]](/icons/layout.gif) | Chiropractor_CD_CA_R..> | 2024-10-04 11:53 | 115K | |
![[ ]](/icons/layout.gif) | Tampa_FL_Man_Facing_..> | 2024-10-04 11:53 | 115K | |
![[ ]](/icons/layout.gif) | dayton-couple-charge..> | 2024-10-04 11:53 | 115K | |
![[ ]](/icons/layout.gif) | D_RI_CARES.pdf | 2024-10-04 11:53 | 115K | |
![[ ]](/icons/layout.gif) | Convicted of a Drive..> | 2025-02-03 14:41 | 115K | |
![[ ]](/icons/layout.gif) | Three_Defendants_Sen..> | 2024-10-04 11:53 | 115K | |
![[ ]](/icons/layout.gif) | Former_Fin_Sec-Treas..> | 2024-10-04 11:53 | 115K | |
![[ ]](/icons/layout.gif) | Ex-Labor_Leader_Char..> | 2024-10-04 11:53 | 116K | |
![[ ]](/icons/layout.gif) | Former International..> | 2024-10-04 11:53 | 116K | |
![[ ]](/icons/layout.gif) | SDNY_Connecticut_Ins..> | 2024-10-04 11:53 | 116K | |
![[ ]](/icons/layout.gif) | Two Former Fiat Chry..> | 2024-10-04 11:53 | 116K | |
![[ ]](/icons/layout.gif) | Owner of Boston Pizz..> | 2024-10-04 11:53 | 116K | |
![[ ]](/icons/layout.gif) | Man_Sentenced_3_Year..> | 2024-10-04 11:53 | 116K | |
![[ ]](/icons/layout.gif) | Former_Chiropractor_..> | 2024-10-04 11:53 | 116K | |
![[ ]](/icons/layout.gif) | UTC_settlement_civil..> | 2024-10-04 11:53 | 116K | |
![[ ]](/icons/layout.gif) | Virginia Man Sentenc..> | 2025-07-03 08:27 | 116K | |
![[ ]](/icons/layout.gif) | Rancho_CD_CA_Release..> | 2024-10-04 11:53 | 116K | |
![[ ]](/icons/layout.gif) | Former Congressman G..> | 2024-10-04 11:53 | 117K | |
![[ ]](/icons/layout.gif) | Two supervisors at a..> | 2024-10-04 11:53 | 117K | |
![[ ]](/icons/layout.gif) | 3_FL_Residents_Sente..> | 2024-10-04 11:53 | 117K | |
![[ ]](/icons/layout.gif) | DOJ_Announces_COVID-..> | 2024-10-04 11:53 | 117K | |
![[ ]](/icons/layout.gif) | Baltimore_Man_Senten..> | 2024-10-04 11:53 | 117K | |
![[ ]](/icons/layout.gif) | Six_People_Indicted_..> | 2024-10-04 11:53 | 117K | |
![[ ]](/icons/layout.gif) | Former UAW Midwest C..> | 2024-10-04 11:53 | 117K | |
![[ ]](/icons/layout.gif) | Eight Members and As..> | 2025-06-16 16:53 | 118K | |
![[ ]](/icons/layout.gif) | OK_Otheropedic_Surge..> | 2024-10-04 11:53 | 118K | |
![[ ]](/icons/layout.gif) | Local 98 Leader John..> | 2024-10-04 11:53 | 118K | |
![[ ]](/icons/layout.gif) | Georgia Woman Senten..> | 2024-10-04 11:53 | 118K | |
![[ ]](/icons/layout.gif) | Former Massachusetts..> | 2024-10-04 11:53 | 118K | |
![[ ]](/icons/layout.gif) | MD_Defense_Contracto..> | 2024-10-04 11:53 | 118K | |
![[ ]](/icons/layout.gif) | Texas Man Sentenced ..> | 2024-10-04 11:53 | 118K | |
![[ ]](/icons/layout.gif) | COLUMBUS DOCTOR TO P..> | 2024-10-04 11:53 | 118K | |
![[ ]](/icons/layout.gif) | 3_Inland_Empire_Wome..> | 2024-10-04 11:53 | 118K | |
![[ ]](/icons/layout.gif) | Queens Couple Pleads..> | 2024-10-04 11:53 | 118K | |
![[ ]](/icons/layout.gif) | Gary_Jones_Guilty_Pl..> | 2024-10-04 11:53 | 118K | |
![[ ]](/icons/layout.gif) | Florida Man Pleads G..> | 2025-03-27 08:01 | 118K | |
![[ ]](/icons/layout.gif) | Four_Charged_Labor_T..> | 2024-10-04 11:53 | 119K | |
![[ ]](/icons/layout.gif) | Nigerian_state_offic..> | 2024-10-04 11:53 | 119K | |
![[ ]](/icons/layout.gif) | Former_UAW_President..> | 2024-10-04 11:53 | 119K | |
![[ ]](/icons/layout.gif) | CD_CA_Rapper_UI.pdf | 2024-10-04 11:53 | 119K | |
![[ ]](/icons/layout.gif) | Marcotte Plea MDFL F..> | 2024-10-04 11:53 | 119K | |
![[ ]](/icons/layout.gif) | Four_MD_Residents_Fa..> | 2024-10-04 11:53 | 119K | |
![[ ]](/icons/layout.gif) | Roofing Company Prin..> | 2024-10-04 11:53 | 119K | |
![[ ]](/icons/layout.gif) | Honduran National Pl..> | 2024-10-04 11:53 | 119K | |
![[ ]](/icons/layout.gif) | Boston Man Sentenced..> | 2024-10-04 11:53 | 119K | |
![[ ]](/icons/layout.gif) | MD_Man_Facing_Indict..> | 2024-10-04 11:53 | 119K | |
![[ ]](/icons/layout.gif) | 10 District Men Arre..> | 2024-10-04 11:53 | 119K | |
![[ ]](/icons/layout.gif) | SD_CA_EDD.pdf | 2024-10-04 11:53 | 119K | |
![[ ]](/icons/layout.gif) | Rapper_who_Bragged_A..> | 2024-10-04 11:53 | 119K | |
![[ ]](/icons/layout.gif) | Couple_Indicted_PUA_..> | 2024-10-04 11:53 | 119K | |
![[ ]](/icons/layout.gif) | Plantation Resident ..> | 2024-10-04 11:53 | 120K | |
![[ ]](/icons/layout.gif) | Third Former NYCHA S..> | 2024-12-16 08:27 | 120K | |
![[ ]](/icons/layout.gif) | Thirteen_Defendants_..> | 2024-10-04 11:53 | 120K | |
![[ ]](/icons/layout.gif) | Queens_Woman_Charged..> | 2024-10-04 11:53 | 121K | |
![[ ]](/icons/layout.gif) | US Attorney Federal ..> | 2024-10-04 11:53 | 121K | |
![[ ]](/icons/layout.gif) | One-Time_EDD_Employe..> | 2024-10-04 11:53 | 121K | |
![[ ]](/icons/layout.gif) | 6_Physical_Therapist..> | 2024-10-04 11:53 | 121K | |
![[ ]](/icons/layout.gif) | USAO_D_NJ_Morris_Cou..> | 2024-10-04 11:53 | 121K | |
![[ ]](/icons/layout.gif) | Florida Man Who Boug..> | 2025-03-28 08:02 | 121K | |
![[ ]](/icons/layout.gif) | Contractor Charged w..> | 2024-10-04 11:53 | 122K | |
![[ ]](/icons/layout.gif) | SD-MS Release.pdf | 2024-10-04 11:53 | 122K | |
![[ ]](/icons/layout.gif) | Doctor And Three Oth..> | 2024-10-04 11:53 | 122K | |
![[ ]](/icons/layout.gif) | Columbus_man_charged..> | 2024-10-04 11:53 | 122K | |
![[ ]](/icons/layout.gif) | Defendants_Charged_M..> | 2024-10-04 11:53 | 122K | |
![[ ]](/icons/layout.gif) | Citrus Heights Coupl..> | 2024-10-04 11:53 | 122K | |
![[ ]](/icons/layout.gif) | United States Resolv..> | 2024-10-04 11:53 | 122K | |
![[ ]](/icons/layout.gif) | Albany_Man_Arraigned..> | 2024-10-04 11:53 | 122K | |
![[ ]](/icons/layout.gif) | Rapper_Who_Boasted_i..> | 2024-10-04 11:53 | 122K | |
![[ ]](/icons/layout.gif) | Former NYCHA Superin..> | 2024-10-21 08:40 | 122K | |
![[ ]](/icons/layout.gif) | Bucks_County_Drug_Ma..> | 2024-10-04 11:53 | 123K | |
![[ ]](/icons/layout.gif) | Albany_Man_Pleads_Gu..> | 2024-10-04 11:53 | 123K | |
![[ ]](/icons/layout.gif) | St. Joseph Woman Sen..> | 2024-10-04 11:53 | 123K | |
![[ ]](/icons/layout.gif) | 9_San_Diego_Resident..> | 2024-10-04 11:53 | 123K | |
![[ ]](/icons/layout.gif) | Two Dallas Area Clin..> | 2024-10-04 11:53 | 123K | |
![[ ]](/icons/layout.gif) | Waterbury Man Senten..> | 2024-10-04 11:53 | 123K | |
![[ ]](/icons/layout.gif) | Former EDD Employee ..> | 2024-10-04 11:53 | 124K | |
![[ ]](/icons/layout.gif) | Woman and Her Two Da..> | 2024-10-04 11:53 | 124K | |
![[ ]](/icons/layout.gif) | Cardinal Lawn and La..> | 2024-10-04 11:53 | 125K | |
![[ ]](/icons/layout.gif) | Walgreens Agrees to ..> | 2025-04-21 14:26 | 125K | |
![[ ]](/icons/layout.gif) | Georgia Woman Senten..> | 2024-10-04 11:53 | 125K | |
![[ ]](/icons/layout.gif) | Meth Kingpin Sentenc..> | 2024-10-04 11:53 | 125K | |
![[ ]](/icons/layout.gif) | North Miami Resident..> | 2024-10-04 11:53 | 125K | |
![[ ]](/icons/layout.gif) | Justice Department F..> | 2025-01-21 08:30 | 125K | |
![[ ]](/icons/layout.gif) | Foreign_National_Sen..> | 2024-10-04 11:53 | 125K | |
![[ ]](/icons/layout.gif) | Man_Admits_Participa..> | 2024-10-04 11:53 | 125K | |
![[ ]](/icons/layout.gif) | Federal_Criminal_Civ..> | 2024-10-04 11:53 | 126K | |
![[ ]](/icons/layout.gif) | Maryland Man Facing ..> | 2024-10-07 09:01 | 126K | |
![[ ]](/icons/layout.gif) | 3_MD_Men_Facing_Fed_..> | 2024-10-04 11:53 | 126K | |
![[ ]](/icons/layout.gif) | Stockton Man Arreste..> | 2024-10-04 11:53 | 127K | |
![[ ]](/icons/layout.gif) | Former State Contrac..> | 2024-10-04 11:53 | 127K | |
![[ ]](/icons/layout.gif) | Three_Indicted_Force..> | 2024-10-04 11:53 | 127K | |
![[ ]](/icons/layout.gif) | Six Individuals, Inc..> | 2024-10-04 11:53 | 127K | |
![[ ]](/icons/layout.gif) | Hyattsville_Man_Plea..> | 2024-10-04 11:53 | 127K | |
![[ ]](/icons/layout.gif) | Immigration-Related ..> | 2025-03-07 08:39 | 127K | |
![[ ]](/icons/layout.gif) | Florida Woman Pleads..> | 2024-11-14 08:43 | 127K | |
![[ ]](/icons/layout.gif) | Chicago_Man_Convicte..> | 2024-10-04 11:53 | 127K | |
![[ ]](/icons/layout.gif) | FL_Woman_Pleads_Guil..> | 2024-10-04 11:53 | 127K | |
![[ ]](/icons/layout.gif) | Leader of Baltimore ..> | 2024-10-04 11:53 | 127K | |
![[ ]](/icons/layout.gif) | State and Federal Of..> | 2024-10-04 11:53 | 127K | |
![[ ]](/icons/layout.gif) | Three_men_sentenced_..> | 2024-10-04 11:53 | 128K | |
![[ ]](/icons/layout.gif) | Dana Adkins Sentence..> | 2024-10-04 11:53 | 128K | |
![[ ]](/icons/layout.gif) | Individual_Sentenced..> | 2024-10-04 11:53 | 129K | |
![[ ]](/icons/layout.gif) | 8_Defendants_Facing_..> | 2024-10-04 11:53 | 129K | |
![[ ]](/icons/layout.gif) | Podiatrist_Patient_R..> | 2024-10-04 11:53 | 129K | |
![[ ]](/icons/layout.gif) | Manchester Man Arres..> | 2024-10-04 11:53 | 130K | |
![[ ]](/icons/layout.gif) | EDPA_Prison_PUA.pdf | 2024-10-04 11:53 | 130K | |
![[ ]](/icons/layout.gif) | Nebraska_Railcar_Cle..> | 2024-10-04 11:53 | 130K | |
![[ ]](/icons/layout.gif) | Rochester Man Pleads..> | 2024-10-04 11:53 | 130K | |
![[ ]](/icons/layout.gif) | United States Attorn..> | 2024-10-04 11:53 | 130K | |
![[ ]](/icons/layout.gif) | Gloucester County Ma..> | 2024-10-04 11:53 | 130K | |
![[ ]](/icons/layout.gif) | Two Jacksonville Com..> | 2024-10-04 11:53 | 130K | |
![[ ]](/icons/layout.gif) | 6_Texas_Pharmacy_Own..> | 2024-10-04 11:53 | 131K | |
![[ ]](/icons/layout.gif) | Second Former NYCHA ..> | 2024-11-25 08:15 | 131K | |
![[ ]](/icons/layout.gif) | Improper Payments Au..> | 2024-10-04 11:53 | 131K | |
![[ ]](/icons/layout.gif) | Former Medical Assis..> | 2024-10-04 11:53 | 131K | |
![[ ]](/icons/layout.gif) | Architects_48_Millio..> | 2024-10-04 11:53 | 131K | |
![[ ]](/icons/layout.gif) | Morris County Woman ..> | 2024-10-04 11:53 | 131K | |
![[ ]](/icons/layout.gif) | Two Chicago Women He..> | 2024-10-04 11:53 | 131K | |
![[ ]](/icons/layout.gif) | Four_People_Sentence..> | 2024-10-04 11:53 | 131K | |
![[ ]](/icons/layout.gif) | Nine_Defendants_Sent..> | 2024-10-04 11:53 | 132K | |
![[ ]](/icons/layout.gif) | South Florida Constr..> | 2024-10-04 11:53 | 132K | |
![[ ]](/icons/layout.gif) | Illinois Man Sentenc..> | 2024-10-04 11:53 | 132K | |
![[ ]](/icons/layout.gif) | Owner_Tanker_Truck_R..> | 2024-10-04 11:53 | 132K | |
![[ ]](/icons/layout.gif) | Alexandria Man Plead..> | 2024-10-04 11:53 | 132K | |
![[ ]](/icons/layout.gif) | Seven_Individuals_In..> | 2024-10-04 11:53 | 132K | |
![[ ]](/icons/layout.gif) | 5 Charged in Alleged..> | 2025-03-07 08:36 | 133K | |
![[ ]](/icons/layout.gif) | Two_Individuals_Conv..> | 2024-10-04 11:53 | 133K | |
![[ ]](/icons/layout.gif) | Member of Local 401 ..> | 2024-10-04 11:53 | 133K | |
![[ ]](/icons/layout.gif) | Former Ironworkers B..> | 2024-10-04 11:53 | 133K | |
![[ ]](/icons/layout.gif) | Foreign National Ple..> | 2024-10-04 11:53 | 133K | |
![[ ]](/icons/layout.gif) | Former Missouri Stat..> | 2024-10-04 11:53 | 134K | |
![[ ]](/icons/layout.gif) | Former Arizona Man S..> | 2024-10-04 11:53 | 134K | |
![[ ]](/icons/layout.gif) | Former_insurance_age..> | 2024-10-04 11:53 | 134K | |
![[ ]](/icons/layout.gif) | Plymouth Man Arreste..> | 2024-10-04 11:53 | 134K | |
![[ ]](/icons/layout.gif) | QUEENS MAN SENTENCED..> | 2024-10-04 11:53 | 134K | |
![[ ]](/icons/layout.gif) | Former State Employe..> | 2024-10-04 11:53 | 135K | |
![[ ]](/icons/layout.gif) | Kenneth Sun Plea DNJ..> | 2024-10-04 11:53 | 135K | |
![[ ]](/icons/layout.gif) | Former Teamster Lead..> | 2024-10-04 11:53 | 135K | |
![[ ]](/icons/layout.gif) | Former Employee of T..> | 2024-10-04 11:53 | 136K | |
![[ ]](/icons/layout.gif) | Stockton Woman Sente..> | 2024-10-04 11:53 | 136K | |
![[ ]](/icons/layout.gif) | Roofing Company Prin..> | 2024-10-04 11:53 | 136K | |
![[ ]](/icons/layout.gif) | Oahu Woman Charged w..> | 2024-10-04 11:53 | 136K | |
![[ ]](/icons/layout.gif) | Manchester Man Sente..> | 2025-05-16 08:13 | 136K | |
![[ ]](/icons/layout.gif) | Manhattan U.S. Attor..> | 2024-10-04 11:53 | 136K | |
![[ ]](/icons/layout.gif) | Saratoga Man Sentenc..> | 2024-10-04 11:53 | 136K | |
![[ ]](/icons/layout.gif) | Morris County Woman ..> | 2024-10-04 11:53 | 137K | |
![[ ]](/icons/layout.gif) | Political Organizer ..> | 2024-10-04 11:53 | 137K | |
![[ ]](/icons/layout.gif) | Hampton Man Indicted..> | 2024-10-04 11:53 | 137K | |
![[ ]](/icons/layout.gif) | Michigan_Man_Pleads_..> | 2024-10-04 11:53 | 137K | |
![[ ]](/icons/layout.gif) | Knecht Change of Ple..> | 2024-10-04 11:53 | 137K | |
![[ ]](/icons/layout.gif) | Springfield_Health_C..> | 2024-10-04 11:53 | 137K | |
![[ ]](/icons/layout.gif) | Couple Indicted for ..> | 2024-10-04 11:53 | 138K | |
![[ ]](/icons/layout.gif) | US Attorneys Office ..> | 2024-10-04 11:53 | 138K | |
![[ ]](/icons/layout.gif) | Rensselaer Man Sente..> | 2024-10-04 11:53 | 138K | |
![[ ]](/icons/layout.gif) | Charlestown_Man_Plea..> | 2024-10-04 11:53 | 138K | |
![[ ]](/icons/layout.gif) | 14_Defendants_Senten..> | 2024-10-04 11:53 | 139K | |
![[ ]](/icons/layout.gif) | Suburban Chicago Phy..> | 2024-10-04 11:53 | 139K | |
![[ ]](/icons/layout.gif) | Passaic County Lawye..> | 2024-10-04 11:53 | 139K | |
![[ ]](/icons/layout.gif) | Lebanon County Man I..> | 2024-10-04 11:53 | 139K | |
![[ ]](/icons/layout.gif) | Former Sacramento Re..> | 2024-10-04 11:53 | 139K | |
![[ ]](/icons/layout.gif) | Dominican National S..> | 2024-10-04 11:53 | 139K | |
![[ ]](/icons/layout.gif) | Five Cleveland-Area ..> | 2024-10-04 11:53 | 139K | |
![[ ]](/icons/layout.gif) | Maryland Man Admits ..> | 2024-10-04 11:53 | 139K | |
![[ ]](/icons/layout.gif) | DOJ_Announces_Nation..> | 2024-10-04 11:53 | 139K | |
![[ ]](/icons/layout.gif) | Four Individuals Sen..> | 2025-03-21 08:46 | 139K | |
![[ ]](/icons/layout.gif) | Two Convicted of Rom..> | 2024-10-04 11:53 | 139K | |
![[ ]](/icons/layout.gif) | Member Of Violent Ga..> | 2024-10-04 11:53 | 139K | |
![[ ]](/icons/layout.gif) | Department Of Labor ..> | 2024-10-04 11:53 | 140K | |
![[ ]](/icons/layout.gif) | Former Baltimore May..> | 2024-10-04 11:53 | 140K | |
![[ ]](/icons/layout.gif) | Middlesex County Wom..> | 2024-10-04 11:53 | 140K | |
![[ ]](/icons/layout.gif) | Middlesex County Con..> | 2024-10-04 11:53 | 140K | |
![[ ]](/icons/layout.gif) | Troy_Man_Sentenced_f..> | 2024-10-04 11:53 | 141K | |
![[ ]](/icons/layout.gif) | Tewksbury Woman Plea..> | 2024-10-04 11:53 | 141K | |
![[ ]](/icons/layout.gif) | CDCA_UI_Scheme.pdf | 2024-10-04 11:53 | 141K | |
![[ ]](/icons/layout.gif) | Leader Of Yoga To Th..> | 2024-10-07 09:01 | 141K | |
![[ ]](/icons/layout.gif) | Former Pharmaceutica..> | 2024-10-04 11:53 | 141K | |
![[ ]](/icons/layout.gif) | Former_AR_State_Sena..> | 2024-10-04 11:53 | 141K | |
![[ ]](/icons/layout.gif) | Former Advanced Prac..> | 2024-10-04 11:53 | 141K | |
![[ ]](/icons/layout.gif) | Owner of Boston Pizz..> | 2024-10-04 11:53 | 141K | |
![[ ]](/icons/layout.gif) | Alleged Mastermind o..> | 2024-10-04 11:53 | 141K | |
![[ ]](/icons/layout.gif) | Former Atlantic City..> | 2024-10-04 11:53 | 142K | |
![[ ]](/icons/layout.gif) | AG_Miyares_Secures_T..> | 2024-10-04 11:53 | 142K | |
![[ ]](/icons/layout.gif) | Charlotte_Man_USAO_W..> | 2024-10-04 11:53 | 142K | |
![[ ]](/icons/layout.gif) | Foreign National Ext..> | 2024-10-04 11:53 | 142K | |
![[ ]](/icons/layout.gif) | Blytheville Man Sent..> | 2024-10-04 11:53 | 142K | |
![[ ]](/icons/layout.gif) | Houma Man Indicted f..> | 2024-10-04 11:53 | 142K | |
![[ ]](/icons/layout.gif) | Department of Justic..> | 2024-10-04 11:53 | 142K | |
![[ ]](/icons/layout.gif) | Joachim Plea EDLA FR..> | 2024-10-04 11:53 | 143K | |
![[ ]](/icons/layout.gif) | AG Nessel Announces ..> | 2025-07-02 08:03 | 143K | |
![[ ]](/icons/layout.gif) | Former Labor Union P..> | 2024-10-04 11:53 | 143K | |
![[ ]](/icons/layout.gif) | Orange County Man Pl..> | 2024-10-04 11:53 | 143K | |
![[ ]](/icons/layout.gif) | Two Capital Region M..> | 2024-10-04 11:53 | 143K | |
![[ ]](/icons/layout.gif) | Four Miami Residents..> | 2024-10-04 11:53 | 143K | |
![[ ]](/icons/layout.gif) | California Man Accus..> | 2024-10-04 11:53 | 143K | |
![[ ]](/icons/layout.gif) | Metro-Atlanta man pl..> | 2024-10-04 11:53 | 144K | |
![[ ]](/icons/layout.gif) | Miramar Resident Con..> | 2024-10-04 11:53 | 144K | |
![[ ]](/icons/layout.gif) | Melrose_Man_Pleads_G..> | 2024-10-04 11:53 | 144K | |
![[ ]](/icons/layout.gif) | Plainville Electrica..> | 2024-10-04 11:53 | 144K | |
![[ ]](/icons/layout.gif) | Johnston Trial_11_5_..> | 2024-10-04 11:53 | 145K | |
![[ ]](/icons/layout.gif) | Four Indicted in Com..> | 2024-10-04 11:53 | 145K | |
![[ ]](/icons/layout.gif) | MARYLAND_US_ATTORNEY..> | 2024-10-04 11:53 | 145K | |
![[ ]](/icons/layout.gif) | 23_Indicted_Fed_CARE..> | 2024-10-04 11:53 | 145K | |
![[ ]](/icons/layout.gif) | Southwest_Virginia_M..> | 2024-10-04 11:53 | 145K | |
![[ ]](/icons/layout.gif) | Former_Stockton_Man_..> | 2024-10-04 11:53 | 145K | |
![[ ]](/icons/layout.gif) | Eight_Individuals_Ch..> | 2024-10-04 11:53 | 146K | |
![[ ]](/icons/layout.gif) | Woman_Serving_Life_P..> | 2024-10-04 11:53 | 146K | |
![[ ]](/icons/layout.gif) | NJ_Company_Pleads_Gu..> | 2024-10-04 11:53 | 146K | |
![[ ]](/icons/layout.gif) | Company Owner and Bo..> | 2024-10-04 11:53 | 146K | |
![[ ]](/icons/layout.gif) | Mendoza_Covey COVID ..> | 2024-10-04 11:53 | 146K | |
![[ ]](/icons/layout.gif) | NORTH BRANFORD WOMAN..> | 2024-10-04 11:53 | 146K | |
![[ ]](/icons/layout.gif) | New Jersey Man Plead..> | 2024-10-04 11:53 | 147K | |
![[ ]](/icons/layout.gif) | Larsen and Toubro Te..> | 2024-10-04 11:53 | 147K | |
![[ ]](/icons/layout.gif) | Mercado COVID_11_21.pdf | 2024-10-04 11:53 | 147K | |
![[ ]](/icons/layout.gif) | U.S. Postal Service ..> | 2024-10-04 11:53 | 147K | |
![[ ]](/icons/layout.gif) | NEW JERSEY COMPANY F..> | 2024-10-04 11:53 | 147K | |
![[ ]](/icons/layout.gif) | Four Men Charged in ..> | 2024-10-04 11:53 | 147K | |
![[ ]](/icons/layout.gif) | Miami-Based Social M..> | 2024-10-04 11:53 | 147K | |
![[ ]](/icons/layout.gif) | Stockton Man Sentenc..> | 2024-10-04 11:53 | 147K | |
![[ ]](/icons/layout.gif) | Luzerne_County_Woman..> | 2024-10-04 11:53 | 148K | |
![[ ]](/icons/layout.gif) | President Of Queens-..> | 2024-10-04 11:53 | 148K | |
![[ ]](/icons/layout.gif) | Former Bureau Of Pri..> | 2024-10-04 11:53 | 149K | |
![[ ]](/icons/layout.gif) | Owner And Operator O..> | 2024-10-04 11:53 | 149K | |
![[ ]](/icons/layout.gif) | Man Charged with Def..> | 2024-10-04 11:53 | 149K | |
![[ ]](/icons/layout.gif) | AZ_AG_Attorney Gener..> | 2024-10-04 11:53 | 150K | |
![[ ]](/icons/layout.gif) | Delaware Man Pleads ..> | 2024-10-04 11:53 | 150K | |
![[ ]](/icons/layout.gif) | Two Nigerian citizen..> | 2024-10-04 11:53 | 150K | |
![[ ]](/icons/layout.gif) | Fifteen People Sente..> | 2024-10-04 11:53 | 150K | |
![[ ]](/icons/layout.gif) | Maryland Man Sentenc..> | 2024-10-04 11:53 | 151K | |
![[ ]](/icons/layout.gif) | LA Man Sentenced to ..> | 2024-10-04 11:53 | 151K | |
![[ ]](/icons/layout.gif) | Justice Department A..> | 2024-10-04 11:53 | 151K | |
![[ ]](/icons/layout.gif) | Delaware Man Sentenc..> | 2024-10-04 11:53 | 152K | |
![[ ]](/icons/layout.gif) | Press Release - VonF..> | 2024-10-04 11:53 | 152K | |
![[ ]](/icons/layout.gif) | US_Atty_Presents_Law..> | 2024-10-04 11:53 | 152K | |
![[ ]](/icons/layout.gif) | Klaustermeier convic..> | 2024-10-04 11:53 | 153K | |
![[ ]](/icons/layout.gif) | Couple charged with ..> | 2024-10-04 11:53 | 153K | |
![[ ]](/icons/layout.gif) | NJ_Man_Pleads_Guilty..> | 2024-10-04 11:53 | 154K | |
![[ ]](/icons/layout.gif) | Michigan Man Pleads ..> | 2024-10-04 11:53 | 154K | |
![[ ]](/icons/layout.gif) | Ten People Charged w..> | 2025-04-10 08:44 | 154K | |
![[ ]](/icons/layout.gif) | Justice Department A..> | 2024-10-04 11:53 | 155K | |
![[ ]](/icons/layout.gif) | Manhattan U.S. Attor..> | 2024-10-04 11:53 | 156K | |
![[ ]](/icons/layout.gif) | FL_Power_Company_Sen..> | 2024-10-04 11:53 | 156K | |
![[ ]](/icons/layout.gif) | Pittsburgh Resident ..> | 2024-10-04 11:53 | 156K | |
![[ ]](/icons/layout.gif) | Captain_Phips_Seafoo..> | 2024-10-04 11:53 | 156K | |
![[ ]](/icons/layout.gif) | Three Labor Union.pdf | 2024-10-04 11:53 | 156K | |
![[ ]](/icons/layout.gif) | Individual Pleads Gu..> | 2024-10-04 11:53 | 157K | |
![[ ]](/icons/layout.gif) | Two_Postal_Employees..> | 2024-10-04 11:53 | 157K | |
![[ ]](/icons/layout.gif) | Former_MO_HealthCare..> | 2024-10-04 11:53 | 157K | |
![[ ]](/icons/layout.gif) | 4 Corners Pharmacy A..> | 2024-10-04 11:53 | 157K | |
![[ ]](/icons/layout.gif) | Clermont County woma..> | 2024-10-04 11:53 | 157K | |
![[ ]](/icons/layout.gif) | McComb_Woman_Found_G..> | 2024-10-04 11:53 | 158K | |
![[ ]](/icons/layout.gif) | Physician and pharma..> | 2024-10-04 11:53 | 158K | |
![[ ]](/icons/layout.gif) | MO_Man_Admits_UI_Hom..> | 2024-10-04 11:53 | 158K | |
![[ ]](/icons/layout.gif) | Missouri Man Sentenc..> | 2024-10-04 11:53 | 158K | |
![[ ]](/icons/layout.gif) | Former Newark Restau..> | 2024-10-04 11:53 | 158K | |
![[ ]](/icons/layout.gif) | Citizen Of Dominican..> | 2024-10-04 11:53 | 158K | |
![[ ]](/icons/layout.gif) | University_City_Man_..> | 2024-10-04 11:53 | 158K | |
![[ ]](/icons/layout.gif) | Rush_City_Woman_Plea..> | 2024-10-04 11:53 | 159K | |
![[ ]](/icons/layout.gif) | Inmate_Sentenced_to_..> | 2024-10-04 11:53 | 159K | |
![[ ]](/icons/layout.gif) | Former Employee of T..> | 2024-10-04 11:53 | 159K | |
![[ ]](/icons/layout.gif) | Watervliet Woman Cha..> | 2024-10-04 11:53 | 159K | |
![[ ]](/icons/layout.gif) | Detroit_Resident_Ple..> | 2024-10-04 11:53 | 159K | |
![[ ]](/icons/layout.gif) | Property company own..> | 2024-10-04 11:53 | 159K | |
![[ ]](/icons/layout.gif) | Foreign National Cha..> | 2024-10-04 11:53 | 159K | |
![[ ]](/icons/layout.gif) | Medford Contractor C..> | 2024-10-04 11:53 | 159K | |
![[ ]](/icons/layout.gif) | Suburban_Chicago_Dr_..> | 2024-10-04 11:53 | 159K | |
![[ ]](/icons/layout.gif) | Bloomington Woman Se..> | 2024-10-04 11:53 | 159K | |
![[ ]](/icons/layout.gif) | West Boylston Man Pl..> | 2024-10-04 11:53 | 159K | |
![[ ]](/icons/layout.gif) | United States Attorn..> | 2024-10-04 11:53 | 159K | |
![[ ]](/icons/layout.gif) | Five Defendants Sent..> | 2024-10-04 11:53 | 159K | |
![[ ]](/icons/layout.gif) | Brockton Man Sentenc..> | 2024-10-04 11:53 | 159K | |
![[ ]](/icons/layout.gif) | Eleven Charged in Do..> | 2024-10-04 11:53 | 159K | |
![[ ]](/icons/layout.gif) | Former_AR_State_Sena..> | 2024-10-04 11:53 | 159K | |
![[ ]](/icons/layout.gif) | Fresno_Woman_Sentenc..> | 2024-10-04 11:53 | 159K | |
![[ ]](/icons/layout.gif) | Former Labor Union P..> | 2024-10-04 11:53 | 159K | |
![[ ]](/icons/layout.gif) | St_Joseph_Woman_Plea..> | 2024-10-04 11:53 | 160K | |
![[ ]](/icons/layout.gif) | EDVA Takes Action Ag..> | 2024-10-04 11:53 | 160K | |
![[ ]](/icons/layout.gif) | Siblings Convicted, ..> | 2024-10-04 11:53 | 160K | |
![[ ]](/icons/layout.gif) | Fed_Grand_Jury_Indic..> | 2024-10-04 11:53 | 160K | |
![[ ]](/icons/layout.gif) | Former Buffalo Man P..> | 2024-10-04 11:53 | 160K | |
![[ ]](/icons/layout.gif) | Atlantic_County_Dr_A..> | 2024-10-04 11:53 | 160K | |
![[ ]](/icons/layout.gif) | Brother_Sister_Two_O..> | 2024-10-04 11:53 | 160K | |
![[ ]](/icons/layout.gif) | GA_Inmate_Sentenced_..> | 2024-10-04 11:53 | 160K | |
![[ ]](/icons/layout.gif) | Two Defendants Charg..> | 2024-10-04 11:53 | 160K | |
![[ ]](/icons/layout.gif) | Waterbury Man Admits..> | 2024-10-04 11:53 | 160K | |
![[ ]](/icons/layout.gif) | Santa Ana Man Charge..> | 2024-10-04 11:53 | 160K | |
![[ ]](/icons/layout.gif) | Albany_Man_Pleads_Gu..> | 2024-10-04 11:53 | 160K | |
![[ ]](/icons/layout.gif) | Suburban Chicago Doc..> | 2024-10-04 11:53 | 160K | |
![[ ]](/icons/layout.gif) | Clinton Man Pleads G..> | 2024-10-04 11:53 | 160K | |
![[ ]](/icons/layout.gif) | Essex County Man Cha..> | 2024-10-04 11:53 | 160K | |
![[ ]](/icons/layout.gif) | CA_Resident_Sentence..> | 2024-10-04 11:53 | 160K | |
![[ ]](/icons/layout.gif) | Suburban Chicago Chi..> | 2024-10-04 11:53 | 160K | |
![[ ]](/icons/layout.gif) | Yonkers Man Pleads G..> | 2024-10-04 11:53 | 160K | |
![[ ]](/icons/layout.gif) | California Man Plead..> | 2024-10-04 11:53 | 160K | |
![[ ]](/icons/layout.gif) | Two_Firefighters_Sen..> | 2024-10-04 11:53 | 160K | |
![[ ]](/icons/layout.gif) | Construction_Company..> | 2024-10-04 11:53 | 160K | |
![[ ]](/icons/layout.gif) | Long_Island_Woman_Se..> | 2024-10-04 11:53 | 161K | |
![[ ]](/icons/layout.gif) | Former Department Of..> | 2024-10-04 11:53 | 161K | |
![[ ]](/icons/layout.gif) | Atlantic County Resi..> | 2024-10-04 11:53 | 161K | |
![[ ]](/icons/layout.gif) | Christina Marie Weig..> | 2024-10-04 11:53 | 161K | |
![[ ]](/icons/layout.gif) | Two_Allentown_Reside..> | 2024-10-04 11:53 | 161K | |
![[ ]](/icons/layout.gif) | Pennsylvania Man Ple..> | 2024-10-04 11:53 | 161K | |
![[ ]](/icons/layout.gif) | Former_State_Contrac..> | 2024-10-04 11:53 | 161K | |
![[ ]](/icons/layout.gif) | Eight Arrested in Mu..> | 2024-10-04 11:53 | 161K | |
![[ ]](/icons/layout.gif) | Atlantic County Man ..> | 2024-10-04 11:53 | 161K | |
![[ ]](/icons/layout.gif) | Wayne County Man Cha..> | 2024-10-04 11:53 | 161K | |
![[ ]](/icons/layout.gif) | Philadelphia Man Sen..> | 2024-10-04 11:53 | 161K | |
![[ ]](/icons/layout.gif) | Disputanta Tax Retur..> | 2024-10-04 11:53 | 161K | |
![[ ]](/icons/layout.gif) | Miller J Sentencing ..> | 2024-10-04 11:53 | 162K | |
![[ ]](/icons/layout.gif) | Donaldsonville_Woman..> | 2024-10-04 11:53 | 162K | |
![[ ]](/icons/layout.gif) | Pharmacy_Owner_Convi..> | 2024-10-04 11:53 | 162K | |
![[ ]](/icons/layout.gif) | Dallas_Woman_Pleads_..> | 2024-10-04 11:53 | 162K | |
![[ ]](/icons/layout.gif) | Fugitive_defendant_w..> | 2024-10-04 11:53 | 162K | |
![[ ]](/icons/layout.gif) | 32 Individuals Indic..> | 2024-10-04 11:53 | 162K | |
![[ ]](/icons/layout.gif) | Frank Giovinco Convi..> | 2024-10-04 11:53 | 162K | |
![[ ]](/icons/layout.gif) | International_Firear..> | 2024-10-04 11:53 | 162K | |
![[ ]](/icons/layout.gif) | USAO_SD_FL_South_Flo..> | 2024-10-04 11:53 | 162K | |
![[ ]](/icons/layout.gif) | Rhode Island Man Sen..> | 2024-10-04 11:53 | 163K | |
![[ ]](/icons/layout.gif) | Former Edd Employee ..> | 2024-10-04 11:53 | 163K | |
![[ ]](/icons/layout.gif) | Florida Man Admits t..> | 2024-10-04 11:53 | 163K | |
![[ ]](/icons/layout.gif) | Army_Servicemember_F..> | 2024-10-04 11:53 | 163K | |
![[ ]](/icons/layout.gif) | Boston_Man_Sentenced..> | 2024-10-04 11:53 | 163K | |
![[ ]](/icons/layout.gif) | Former_Jersey_City_B..> | 2024-10-04 11:53 | 163K | |
![[ ]](/icons/layout.gif) | Final Co-Conspirator..> | 2024-10-04 11:53 | 163K | |
![[ ]](/icons/layout.gif) | Previously Deported ..> | 2024-10-04 11:53 | 163K | |
![[ ]](/icons/layout.gif) | Fourth Defendant Ple..> | 2024-10-04 11:53 | 163K | |
![[ ]](/icons/layout.gif) | Three_Plead_Guilty_H..> | 2024-10-04 11:53 | 163K | |
![[ ]](/icons/layout.gif) | Former Union Treasur..> | 2024-10-04 11:53 | 163K | |
![[ ]](/icons/layout.gif) | Atlantic City Counci..> | 2024-10-04 11:53 | 163K | |
![[ ]](/icons/layout.gif) | Former Executive Dir..> | 2024-10-04 11:53 | 164K | |
![[ ]](/icons/layout.gif) | RI_Man_Pleads_Guilty..> | 2024-10-04 11:53 | 164K | |
![[ ]](/icons/layout.gif) | Augusta_Man_sentence..> | 2024-10-04 11:53 | 164K | |
![[ ]](/icons/layout.gif) | Fourteen Defendants ..> | 2024-10-04 11:53 | 164K | |
![[ ]](/icons/layout.gif) | Preliminary Injuncti..> | 2024-10-04 11:53 | 164K | |
![[ ]](/icons/layout.gif) | Orange_County_Man_Se..> | 2024-10-04 11:53 | 164K | |
![[ ]](/icons/layout.gif) | Mexican_Nationals_Ch..> | 2024-10-04 11:53 | 164K | |
![[ ]](/icons/layout.gif) | MO_Couple_Sentenced_..> | 2024-10-04 11:53 | 164K | |
![[ ]](/icons/layout.gif) | Victorville Woman Ar..> | 2024-10-04 11:53 | 164K | |
![[ ]](/icons/layout.gif) | Former Union Preside..> | 2024-10-04 11:53 | 164K | |
![[ ]](/icons/layout.gif) | Nomura Securities In..> | 2024-10-04 11:53 | 164K | |
![[ ]](/icons/layout.gif) | Former Contractor fo..> | 2024-10-04 11:53 | 164K | |
![[ ]](/icons/layout.gif) | Houston Woman Charge..> | 2024-10-04 11:53 | 164K | |
![[ ]](/icons/layout.gif) | Married Couple Sente..> | 2024-10-04 11:53 | 164K | |
![[ ]](/icons/layout.gif) | Sherwin-Williams_to_..> | 2024-10-04 11:53 | 164K | |
![[ ]](/icons/layout.gif) | East_St_Louis_Woman_..> | 2024-10-04 11:53 | 164K | |
![[ ]](/icons/layout.gif) | Nigerian_National_Ba..> | 2024-10-04 11:53 | 165K | |
![[ ]](/icons/layout.gif) | Two Georgians indict..> | 2024-10-04 11:53 | 165K | |
![[ ]](/icons/layout.gif) | MA_Contractor_Pleads..> | 2024-10-04 11:53 | 165K | |
![[ ]](/icons/layout.gif) | Four Capital Region ..> | 2024-10-04 11:53 | 165K | |
![[ ]](/icons/layout.gif) | Metro Atlanta man se..> | 2024-10-04 11:53 | 165K | |
![[ ]](/icons/layout.gif) | California Man Sente..> | 2024-10-04 11:53 | 165K | |
![[ ]](/icons/layout.gif) | Hyde Park Man Pleads..> | 2024-10-04 11:53 | 165K | |
![[ ]](/icons/layout.gif) | Suburban_CHI_Couple_..> | 2024-10-04 11:53 | 165K | |
![[ ]](/icons/layout.gif) | Smyrna_resident_sent..> | 2024-10-04 11:53 | 165K | |
![[ ]](/icons/layout.gif) | 25 Southern Californ..> | 2024-10-04 11:53 | 165K | |
![[ ]](/icons/layout.gif) | Former_HR_Manager_Se..> | 2024-10-04 11:53 | 165K | |
![[ ]](/icons/layout.gif) | Inland Empire Woman ..> | 2024-10-04 11:53 | 165K | |
![[ ]](/icons/layout.gif) | Acton Man Sentenced ..> | 2024-10-04 11:53 | 165K | |
![[ ]](/icons/layout.gif) | Metro_ATL Man_charge..> | 2024-10-04 11:53 | 165K | |
![[ ]](/icons/layout.gif) | Former_Union_Officia..> | 2024-10-04 11:53 | 165K | |
![[ ]](/icons/layout.gif) | Former Arizona Man P..> | 2024-10-04 11:53 | 166K | |
![[ ]](/icons/layout.gif) | Virginia Beach Woman..> | 2024-10-04 11:53 | 166K | |
![[ ]](/icons/layout.gif) | Detroit Man_Pleads_G..> | 2024-10-04 11:53 | 166K | |
![[ ]](/icons/layout.gif) | Convicted Murderer W..> | 2024-10-04 11:53 | 166K | |
![[ ]](/icons/layout.gif) | Owner of Boston Pizz..> | 2024-10-04 11:53 | 166K | |
![[ ]](/icons/layout.gif) | Leicester_Man_Pleads..> | 2024-10-04 11:53 | 166K | |
![[ ]](/icons/layout.gif) | Beverly Farms Man Pl..> | 2024-10-04 11:53 | 166K | |
![[ ]](/icons/layout.gif) | Seattle man who defr..> | 2024-10-04 11:53 | 166K | |
![[ ]](/icons/layout.gif) | Victorville_Woman_Se..> | 2024-10-04 11:53 | 166K | |
![[ ]](/icons/layout.gif) | Leicester_Man_Pleads..> | 2024-10-04 11:53 | 166K | |
![[ ]](/icons/layout.gif) | Kunia Woman Arraigne..> | 2024-10-04 11:53 | 166K | |
![[ ]](/icons/layout.gif) | Milwaukee Women Sent..> | 2024-10-04 11:53 | 166K | |
![[ ]](/icons/layout.gif) | Maryland U.S. Attorn..> | 2024-10-04 11:53 | 167K | |
![[ ]](/icons/layout.gif) | Castro Valley Reside..> | 2024-10-04 11:53 | 167K | |
![[ ]](/icons/layout.gif) | Drug_Trafficker_Plea..> | 2024-10-04 11:53 | 167K | |
![[ ]](/icons/layout.gif) | NY_Man_Arrested_COVI..> | 2024-10-04 11:53 | 167K | |
![[ ]](/icons/layout.gif) | Supersiding_Indictme..> | 2024-10-04 11:53 | 167K | |
![[ ]](/icons/layout.gif) | Augusta man admits t..> | 2024-10-04 11:53 | 167K | |
![[ ]](/icons/layout.gif) | MALDEN_MAN_SENTENCED..> | 2024-10-04 11:53 | 167K | |
![[ ]](/icons/layout.gif) | Former_Louisiana_Wom..> | 2024-10-04 11:53 | 167K | |
![[ ]](/icons/layout.gif) | MD-FL_Task Force_Con..> | 2024-10-04 11:53 | 167K | |
![[ ]](/icons/layout.gif) | Reading_Man_Sentence..> | 2024-10-04 11:53 | 168K | |
![[ ]](/icons/layout.gif) | Final_Two_Defendants..> | 2024-10-04 11:53 | 168K | |
![[ ]](/icons/layout.gif) | Nigerian citizen ext..> | 2024-10-04 11:53 | 168K | |
![[ ]](/icons/layout.gif) | Three Albuquerque Re..> | 2024-10-04 11:53 | 169K | |
![[ ]](/icons/layout.gif) | Spokane Resident Ple..> | 2024-10-04 11:53 | 169K | |
![[ ]](/icons/layout.gif) | Two_Former_Directors..> | 2024-10-04 11:53 | 169K | |
![[ ]](/icons/layout.gif) | Social Media Influen..> | 2024-10-04 11:53 | 169K | |
![[ ]](/icons/layout.gif) | Dover Businessman Se..> | 2024-10-04 11:53 | 169K | |
![[ ]](/icons/layout.gif) | Injured Workers Phar..> | 2024-10-04 11:53 | 169K | |
![[ ]](/icons/layout.gif) | NIGERIAN_NATIONAL_PL..> | 2024-10-04 11:53 | 170K | |
![[ ]](/icons/layout.gif) | Five Individuals Cha..> | 2024-10-04 11:53 | 171K | |
![[ ]](/icons/layout.gif) | USAO_Georgia_Man_Ind..> | 2024-10-04 11:53 | 172K | |
![[ ]](/icons/layout.gif) | Laredo woman arreste..> | 2024-10-04 11:53 | 172K | |
![[ ]](/icons/layout.gif) | Maryland_Man_Admits_..> | 2024-10-04 11:53 | 173K | |
![[ ]](/icons/layout.gif) | 14 Defendants, Inclu..> | 2024-10-04 11:53 | 174K | |
![[ ]](/icons/layout.gif) | Seven Sentenced to F..> | 2024-10-04 11:53 | 174K | |
![[ ]](/icons/layout.gif) | EDVA_Takes_Action_Ag..> | 2024-10-04 11:53 | 175K | |
![[ ]](/icons/layout.gif) | Former Federal Emplo..> | 2024-10-04 11:53 | 175K | |
![[ ]](/icons/layout.gif) | Operators of physica..> | 2024-10-04 11:53 | 176K | |
![[ ]](/icons/layout.gif) | DOL-OIG Pandemic Wor..> | 2024-10-04 11:53 | 176K | |
![[ ]](/icons/layout.gif) | Georgia_Man_Pleads_G..> | 2024-10-04 11:53 | 178K | |
![[ ]](/icons/layout.gif) | US_Secret_Service_He..> | 2024-10-04 11:53 | 178K | |
![[ ]](/icons/layout.gif) | Eight_Crips_Gang_Mem..> | 2024-10-04 11:53 | 179K | |
![[ ]](/icons/layout.gif) | NYSDOL_Prevents_Cybe..> | 2024-10-04 11:53 | 179K | |
![[ ]](/icons/layout.gif) | Romanian Citizens Ar..> | 2024-10-04 11:53 | 181K | |
![[ ]](/icons/layout.gif) | former.pdf | 2024-10-04 11:53 | 181K | |
![[ ]](/icons/layout.gif) | Justice Department A..> | 2024-10-04 11:53 | 182K | |
![[ ]](/icons/layout.gif) | Violent Detroit Stre..> | 2024-10-04 11:53 | 182K | |
![[ ]](/icons/layout.gif) | Maryland Defense Con..> | 2024-10-04 11:53 | 182K | |
![[ ]](/icons/layout.gif) | Seven People Charged..> | 2024-10-04 11:53 | 183K | |
![[ ]](/icons/layout.gif) | DOJ_Announces_Direct..> | 2024-10-04 11:53 | 184K | |
![[ ]](/icons/layout.gif) | Six Individuals Indi..> | 2024-10-04 11:53 | 184K | |
![[ ]](/icons/layout.gif) | Cameroonian National..> | 2024-10-04 11:53 | 184K | |
![[ ]](/icons/layout.gif) | Former Teamster Conv..> | 2024-10-04 11:53 | 184K | |
![[ ]](/icons/layout.gif) | Hunter NP Press Rele..> | 2024-10-04 11:53 | 185K | |
![[ ]](/icons/layout.gif) | Former_US_Postal_Ser..> | 2024-10-04 11:53 | 185K | |
![[ ]](/icons/layout.gif) | US_Law_Enforcement_D..> | 2024-10-04 11:53 | 185K | |
![[ ]](/icons/layout.gif) | Rio Arriba County Ma..> | 2024-10-04 11:53 | 185K | |
![[ ]](/icons/layout.gif) | Maryland and Virgini..> | 2024-10-04 11:53 | 186K | |
![[ ]](/icons/layout.gif) | Foreign National Sen..> | 2024-10-04 11:53 | 187K | |
![[ ]](/icons/layout.gif) | IL_AG_UI_TaskForce.pdf | 2024-10-04 11:53 | 187K | |
![[ ]](/icons/layout.gif) | Leaders_of_Brooklyn_..> | 2024-10-04 11:53 | 188K | |
![[ ]](/icons/layout.gif) | Individuals_Charged_..> | 2024-10-04 11:53 | 188K | |
![[ ]](/icons/layout.gif) | Southern District pr..> | 2024-10-04 11:53 | 188K | |
![[ ]](/icons/layout.gif) | U.S. Attorney Announ..> | 2024-10-04 11:53 | 188K | |
![[ ]](/icons/layout.gif) | Amherst Man Sentence..> | 2024-10-04 11:53 | 189K | |
![[ ]](/icons/layout.gif) | PG_County_Man_Senten..> | 2024-10-04 11:53 | 189K | |
![[ ]](/icons/layout.gif) | South Florida US Att..> | 2024-10-04 11:53 | 190K | |
![[ ]](/icons/layout.gif) | Maryland Man Sentenc..> | 2024-10-04 11:53 | 190K | |
![[ ]](/icons/layout.gif) | Thirty Individuals A..> | 2024-10-04 11:53 | 190K | |
![[ ]](/icons/layout.gif) | Middle District Of F..> | 2024-10-04 11:53 | 191K | |
![[ ]](/icons/layout.gif) | Taunton_Man_Charged_..> | 2024-10-04 11:53 | 192K | |
![[ ]](/icons/layout.gif) | Omaha_Railcar_Cleani..> | 2024-10-04 11:53 | 193K | |
![[ ]](/icons/layout.gif) | South Los Angeles Wo..> | 2024-10-04 11:53 | 193K | |
![[ ]](/icons/layout.gif) | Hospital Employee Se..> | 2024-10-04 11:53 | 194K | |
![[ ]](/icons/layout.gif) | Money_Mule_Release.pdf | 2024-10-04 11:53 | 195K | |
![[ ]](/icons/layout.gif) | Romanian_Citizen_Arr..> | 2024-10-04 11:53 | 195K | |
![[ ]](/icons/layout.gif) | Former Bureau Of Pri..> | 2024-10-04 11:53 | 195K | |
![[ ]](/icons/layout.gif) | Capt_Phips_Seafood_S..> | 2024-10-04 11:53 | 196K | |
![[ ]](/icons/layout.gif) | Roofing_Company_Prin..> | 2024-10-04 11:53 | 197K | |
![[ ]](/icons/layout.gif) | Savani_Group_Owners_..> | 2024-10-04 11:53 | 198K | |
![[ ]](/icons/layout.gif) | Congressman George S..> | 2024-10-04 11:53 | 199K | |
![[ ]](/icons/layout.gif) | Former_Sacramento_Re..> | 2024-10-04 11:53 | 200K | |
![[ ]](/icons/layout.gif) | LONG_ISLAND_CHIROPRA..> | 2024-10-04 11:53 | 200K | |
![[ ]](/icons/layout.gif) | U.S. Attorney Announ..> | 2024-10-04 11:53 | 201K | |
![[ ]](/icons/layout.gif) | DOL-OIG_Press_Releas..> | 2025-01-08 09:06 | 202K | |
![[ ]](/icons/layout.gif) | DOL-OIG_Press_Releas..> | 2025-01-08 09:06 | 202K | |
![[ ]](/icons/layout.gif) | MARYLAND_U.S._ATTORN..> | 2024-10-04 11:53 | 203K | |
![[ ]](/icons/layout.gif) | EDD_Crackdown_072020..> | 2024-10-04 11:53 | 204K | |
![[ ]](/icons/layout.gif) | Attorney General Lax..> | 2024-10-04 11:53 | 204K | |
![[ ]](/icons/layout.gif) | ED_CA_UI_Inmates.pdf | 2024-10-04 11:53 | 205K | |
![[ ]](/icons/layout.gif) | Abraham et al Compla..> | 2024-10-04 11:53 | 205K | |
![[ ]](/icons/layout.gif) | D.A. Bragg Announces..> | 2024-10-04 11:53 | 206K | |
![[ ]](/icons/layout.gif) | US_Law_Enforcement_T..> | 2024-10-04 11:53 | 207K | |
![[ ]](/icons/layout.gif) | Dozens sentenced for..> | 2024-10-04 11:53 | 209K | |
![[ ]](/icons/layout.gif) | Members of Brooklyn-..> | 2024-10-04 11:53 | 210K | |
![[ ]](/icons/layout.gif) | Contruction_Company_..> | 2024-10-04 11:53 | 211K | |
![[ ]](/icons/layout.gif) | Justice_Department_T..> | 2024-10-04 11:53 | 213K | |
![[ ]](/icons/layout.gif) | State_Contractor_Ple..> | 2024-10-04 11:53 | 213K | |
![[ ]](/icons/layout.gif) | 14_DEFENDANTS_INDICT..> | 2024-10-04 11:53 | 215K | |
![[ ]](/icons/layout.gif) | FOUR_DEFENDANTS_CHAR..> | 2024-10-04 11:53 | 218K | |
![[ ]](/icons/layout.gif) | Jonesboro man senten..> | 2024-10-04 11:53 | 219K | |
![[ ]](/icons/layout.gif) | ED_PA_PUA_Arrests.pdf | 2024-10-04 11:53 | 221K | |
![[ ]](/icons/layout.gif) | York County Judge In..> | 2024-10-08 15:23 | 223K | |
![[ ]](/icons/layout.gif) | Money_Mule_One_Pager..> | 2024-10-04 11:53 | 225K | |
![[ ]](/icons/layout.gif) | McKinny Sentencing P..> | 2024-10-04 11:53 | 225K | |
![[ ]](/icons/layout.gif) | NYS_Fraudsters_UI_Be..> | 2024-10-04 11:53 | 226K | |
![[ ]](/icons/layout.gif) | 013020-Pair-Plea-in-..> | 2024-10-04 11:53 | 227K | |
![[ ]](/icons/layout.gif) | Political Consultant..> | 2024-10-04 11:53 | 228K | |
![[ ]](/icons/layout.gif) | Dayton Technology St..> | 2024-10-04 11:53 | 229K | |
![[ ]](/icons/layout.gif) | Miami-Dade County Re..> | 2024-10-04 11:53 | 230K | |
![[ ]](/icons/layout.gif) | Two Dallas Area Clin..> | 2024-10-04 11:53 | 230K | |
![[ ]](/icons/layout.gif) | Three_Former_Executi..> | 2024-10-04 11:53 | 230K | |
![[ ]](/icons/layout.gif) | Wright State Univers..> | 2024-10-04 11:53 | 231K | |
![[ ]](/icons/layout.gif) | Middle District Of F..> | 2024-10-04 11:53 | 237K | |
![[ ]](/icons/layout.gif) | Nadeem Verdict Press..> | 2024-10-04 11:53 | 239K | |
![[ ]](/icons/layout.gif) | Alexander Plea PR 06..> | 2024-10-04 11:53 | 241K | |
![[ ]](/icons/layout.gif) | Middle District Of F..> | 2024-10-04 11:53 | 242K | |
![[ ]](/icons/layout.gif) | HSI Norfolk investig..> | 2024-10-04 11:53 | 242K | |
![[ ]](/icons/layout.gif) | Vertuccio Takedown P..> | 2024-10-04 11:53 | 243K | |
![[ ]](/icons/layout.gif) | Former FCA Executive..> | 2024-10-04 11:53 | 243K | |
![[ ]](/icons/layout.gif) | JOHNSON_Sentencing_P..> | 2024-10-04 11:53 | 246K | |
![[ ]](/icons/layout.gif) | PEARSON.Press.Releas..> | 2024-10-04 11:53 | 246K | |
![[ ]](/icons/layout.gif) | Johnson_Guilty_Plea_..> | 2024-10-04 11:53 | 247K | |
![[ ]](/icons/layout.gif) | Former Senior UAW Of..> | 2024-10-04 11:53 | 248K | |
![[ ]](/icons/layout.gif) | JEWELL.Sentencing.Pr..> | 2024-10-04 11:53 | 248K | |
![[ ]](/icons/layout.gif) | Chester Woman Charge..> | 2025-03-13 08:53 | 248K | |
![[ ]](/icons/layout.gif) | ED_MI_UAW.pdf | 2024-10-04 11:53 | 248K | |
![[ ]](/icons/layout.gif) | NR Jose Jose Rest 3-..> | 2024-10-04 11:53 | 249K | |
![[ ]](/icons/layout.gif) | Sacramento Dentist P..> | 2024-10-04 11:53 | 250K | |
![[ ]](/icons/layout.gif) | Labor union corrupti..> | 2024-10-04 11:53 | 252K | |
![[ ]](/icons/layout.gif) | PEARSON.Guilty.Plea...> | 2024-10-04 11:53 | 252K | |
![[ ]](/icons/layout.gif) | Cicero_Woman_Pleads_..> | 2024-10-04 11:53 | 253K | |
![[ ]](/icons/layout.gif) | Owner_Eire_Fish_Mark..> | 2024-10-04 11:53 | 254K | |
![[ ]](/icons/layout.gif) | Clinton_Fitchburg_Ma..> | 2024-10-04 11:53 | 254K | |
![[ ]](/icons/layout.gif) | Melvindale_Man_Sente..> | 2024-10-04 11:53 | 254K | |
![[ ]](/icons/layout.gif) | Former_Nomura_RMBS_T..> | 2024-10-04 11:53 | 255K | |
![[ ]](/icons/layout.gif) | Decatur_Woman_Senten..> | 2024-10-04 11:53 | 255K | |
![[ ]](/icons/layout.gif) | Westmoreland_County_..> | 2024-10-04 11:53 | 255K | |
![[ ]](/icons/layout.gif) | lutz roofing 11.03.1..> | 2024-10-04 11:53 | 256K | |
![[ ]](/icons/layout.gif) | WV_Woman_Admits_Fili..> | 2024-10-04 11:53 | 256K | |
![[ ]](/icons/layout.gif) | Hudson_County_Woman_..> | 2024-10-04 11:53 | 256K | |
![[ ]](/icons/layout.gif) | Former_State_Employe..> | 2024-10-04 11:53 | 256K | |
![[ ]](/icons/layout.gif) | Contractor_Pleads_Gu..> | 2024-10-04 11:53 | 257K | |
![[ ]](/icons/layout.gif) | Former_Union_Officia..> | 2024-10-04 11:53 | 257K | |
![[ ]](/icons/layout.gif) | Additional_Charges_C..> | 2024-10-04 11:53 | 257K | |
![[ ]](/icons/layout.gif) | First_Defendant_in_2..> | 2024-10-04 11:53 | 257K | |
![[ ]](/icons/layout.gif) | Philadelphia Woman S..> | 2024-10-04 11:53 | 257K | |
![[ ]](/icons/layout.gif) | Former_Union_Preside..> | 2024-10-04 11:53 | 258K | |
![[ ]](/icons/layout.gif) | Superseding_Indictme..> | 2024-10-04 11:53 | 258K | |
![[ ]](/icons/layout.gif) | Washington_County_Bu..> | 2024-10-04 11:53 | 258K | |
![[ ]](/icons/layout.gif) | Frankfort_Man_Senten..> | 2024-10-04 11:53 | 258K | |
![[ ]](/icons/layout.gif) | Owner_IT_Services_Co..> | 2024-10-04 11:53 | 258K | |
![[ ]](/icons/layout.gif) | ED_MI_UI_Scam-082520..> | 2024-10-04 11:53 | 258K | |
![[ ]](/icons/layout.gif) | NY_Man_Sentenced_Six..> | 2024-10-04 11:53 | 258K | |
![[ ]](/icons/layout.gif) | Houston_Pharmacist_S..> | 2024-10-04 11:53 | 258K | |
![[ ]](/icons/layout.gif) | Jacksonville_Contrac..> | 2024-10-04 11:53 | 258K | |
![[ ]](/icons/layout.gif) | Fairhope_Man_Pleads_..> | 2024-10-04 11:53 | 258K | |
![[ ]](/icons/layout.gif) | Former_COO_Global_Pr..> | 2024-10-04 11:53 | 258K | |
![[ ]](/icons/layout.gif) | Jury_Convicts_Two_in..> | 2024-10-04 11:53 | 259K | |
![[ ]](/icons/layout.gif) | Two_Defendants_Sente..> | 2024-10-04 11:53 | 259K | |
![[ ]](/icons/layout.gif) | JeffersonCity_Woman_..> | 2024-10-04 11:53 | 259K | |
![[ ]](/icons/layout.gif) | Hudson_Man_USAO_D-NJ..> | 2024-10-04 11:53 | 259K | |
![[ ]](/icons/layout.gif) | Lawrence_Woman_Arres..> | 2024-10-04 11:53 | 260K | |
![[ ]](/icons/layout.gif) | Contractor_Who_Lied_..> | 2024-10-04 11:53 | 260K | |
![[ ]](/icons/layout.gif) | LeMars_Man_Sentenced..> | 2024-10-04 11:53 | 260K | |
![[ ]](/icons/layout.gif) | Former_Department_of..> | 2024-10-04 11:53 | 260K | |
![[ ]](/icons/layout.gif) | Collin_County_Man_In..> | 2024-10-04 11:53 | 260K | |
![[ ]](/icons/layout.gif) | Wise_County_Man_Plea..> | 2024-10-04 11:53 | 260K | |
![[ ]](/icons/layout.gif) | Massachusetts_Contra..> | 2024-10-04 11:53 | 260K | |
![[ ]](/icons/layout.gif) | Saratoga_Springs_Man..> | 2024-10-04 11:53 | 260K | |
![[ ]](/icons/layout.gif) | Louise_Larivee_Impri..> | 2024-10-04 11:53 | 260K | |
![[ ]](/icons/layout.gif) | Salem Man Pleads Gui..> | 2024-10-04 11:53 | 261K | |
![[ ]](/icons/layout.gif) | United States Attorn..> | 2024-10-04 11:53 | 261K | |
![[ ]](/icons/layout.gif) | COVID-19_Unemploymen..> | 2024-10-04 11:53 | 261K | |
![[ ]](/icons/layout.gif) | Medical_Assistant_Ad..> | 2024-10-04 11:53 | 261K | |
![[ ]](/icons/layout.gif) | State_Employee_Charg..> | 2024-10-04 11:53 | 261K | |
![[ ]](/icons/layout.gif) | Farmington_Hills_Res..> | 2024-10-04 11:53 | 261K | |
![[ ]](/icons/layout.gif) | Camden_County_Man_Ch..> | 2024-10-04 11:53 | 261K | |
![[ ]](/icons/layout.gif) | DOJ_Warns_Fake_Unemp..> | 2024-10-04 11:53 | 261K | |
![[ ]](/icons/layout.gif) | St_Paul_Virginia_Wom..> | 2024-10-04 11:53 | 261K | |
![[ ]](/icons/layout.gif) | Leicester_Man_Indict..> | 2024-10-04 11:53 | 262K | |
![[ ]](/icons/layout.gif) | Illinois_Man_Admits_..> | 2024-10-04 11:53 | 262K | |
![[ ]](/icons/layout.gif) | Gloucester County Ma..> | 2024-10-04 11:53 | 262K | |
![[ ]](/icons/layout.gif) | Two_Hondurans_Senten..> | 2024-10-04 11:53 | 262K | |
![[ ]](/icons/layout.gif) | Indian_Trail_Man_Ple..> | 2024-10-04 11:53 | 262K | |
![[ ]](/icons/layout.gif) | Buffalo_Woman_Arrest..> | 2024-10-04 11:53 | 262K | |
![[ ]](/icons/layout.gif) | Man_Pleads_Guilty_to..> | 2024-10-04 11:53 | 262K | |
![[ ]](/icons/layout.gif) | Rochester_Man_Senten..> | 2024-10-04 11:53 | 262K | |
![[ ]](/icons/layout.gif) | Three_Defendants_Cha..> | 2024-10-04 11:53 | 262K | |
![[ ]](/icons/layout.gif) | Woman_Pleads_Guilty_..> | 2024-10-04 11:53 | 262K | |
![[ ]](/icons/layout.gif) | Federal_Health_Care_..> | 2024-10-04 11:53 | 263K | |
![[ ]](/icons/layout.gif) | Arizona_Man_Sentence..> | 2024-10-04 11:53 | 263K | |
![[ ]](/icons/layout.gif) | Former Postal Employ..> | 2024-10-04 11:53 | 263K | |
![[ ]](/icons/layout.gif) | Southfield_Man_Sente..> | 2024-10-04 11:53 | 263K | |
![[ ]](/icons/layout.gif) | Hot_Springs_Man_Plea..> | 2024-10-04 11:53 | 263K | |
![[ ]](/icons/layout.gif) | Camp_Hill_Attorney_S..> | 2024-10-04 11:53 | 263K | |
![[ ]](/icons/layout.gif) | Federal_Inmate_Plead..> | 2024-10-04 11:53 | 263K | |
![[ ]](/icons/layout.gif) | Nashua Woman Pleads ..> | 2024-10-04 11:53 | 263K | |
![[ ]](/icons/layout.gif) | Former_Buffalo_Man_P..> | 2024-10-04 11:53 | 263K | |
![[ ]](/icons/layout.gif) | Miller_Woman_Sentenc..> | 2024-10-04 11:53 | 264K | |
![[ ]](/icons/layout.gif) | NJ_Man_Charged_Fraud..> | 2024-10-04 11:53 | 264K | |
![[ ]](/icons/layout.gif) | Four_People_Indicted..> | 2024-10-04 11:53 | 264K | |
![[ ]](/icons/layout.gif) | Undocumented_Individ..> | 2024-10-04 11:53 | 265K | |
![[ ]](/icons/layout.gif) | NYC_Dept_of_Building..> | 2024-10-04 11:53 | 265K | |
![[ ]](/icons/layout.gif) | Three_Men_Indicted_i..> | 2024-10-04 11:53 | 265K | |
![[ ]](/icons/layout.gif) | Painting_Contractor_..> | 2024-10-04 11:53 | 265K | |
![[ ]](/icons/layout.gif) | Two_Felons_Admit_Gui..> | 2024-10-04 11:53 | 265K | |
![[ ]](/icons/layout.gif) | Former_Claims_Manage..> | 2024-10-04 11:53 | 265K | |
![[ ]](/icons/layout.gif) | Former_Carpenters’..> | 2024-10-04 11:53 | 265K | |
![[ ]](/icons/layout.gif) | Former_State_Unemplo..> | 2024-10-04 11:53 | 265K | |
![[ ]](/icons/layout.gif) | California_Man_Sente..> | 2024-10-04 11:53 | 265K | |
![[ ]](/icons/layout.gif) | Woonsocket_Businessm..> | 2024-10-04 11:53 | 265K | |
![[ ]](/icons/layout.gif) | Dominican_National_A..> | 2024-10-04 11:53 | 265K | |
![[ ]](/icons/layout.gif) | St_Paul_Woman_Senten..> | 2024-10-04 11:53 | 265K | |
![[ ]](/icons/layout.gif) | Former_Treasurer_of_..> | 2024-10-04 11:53 | 266K | |
![[ ]](/icons/layout.gif) | New_York_Man_Sentenc..> | 2024-10-04 11:53 | 266K | |
![[ ]](/icons/layout.gif) | Former_Federal_Emplo..> | 2024-10-04 11:53 | 266K | |
![[ ]](/icons/layout.gif) | Three_Men_Arrested_i..> | 2024-10-04 11:53 | 266K | |
![[ ]](/icons/layout.gif) | Two_Burlington_Count..> | 2024-10-04 11:53 | 266K | |
![[ ]](/icons/layout.gif) | Georgia_Business_Own..> | 2024-10-04 11:53 | 266K | |
![[ ]](/icons/layout.gif) | Leicester_Man_Senten..> | 2024-10-04 11:53 | 266K | |
![[ ]](/icons/layout.gif) | READING_MAN_PLEADS_G..> | 2024-10-04 11:53 | 266K | |
![[ ]](/icons/layout.gif) | Former_Local_Union_V..> | 2024-10-04 11:53 | 266K | |
![[ ]](/icons/layout.gif) | Six_Individuals_Iden..> | 2024-10-04 11:53 | 266K | |
![[ ]](/icons/layout.gif) | Scranton_Doctor_Sent..> | 2024-10-04 11:53 | 266K | |
![[ ]](/icons/layout.gif) | Chester_County_Man_S..> | 2024-10-04 11:53 | 267K | |
![[ ]](/icons/layout.gif) | Seven_Guilty_Forest_..> | 2024-10-04 11:53 | 267K | |
![[ ]](/icons/layout.gif) | Las_Vegas_UI_Prosecu..> | 2024-10-04 11:53 | 267K | |
![[ ]](/icons/layout.gif) | Florida_Man_Charged_..> | 2024-10-04 11:53 | 267K | |
![[ ]](/icons/layout.gif) | Former_State_Employe..> | 2024-10-04 11:53 | 267K | |
![[ ]](/icons/layout.gif) | United_States_Files_..> | 2024-10-04 11:53 | 267K | |
![[ ]](/icons/layout.gif) | Camden County Reside..> | 2024-10-04 11:53 | 267K | |
![[ ]](/icons/layout.gif) | Stoneham_Woman_Sente..> | 2024-10-04 11:53 | 267K | |
![[ ]](/icons/layout.gif) | Boston_Man_Charged_w..> | 2024-10-04 11:53 | 267K | |
![[ ]](/icons/layout.gif) | Springfield_Woman_Se..> | 2024-10-04 11:53 | 267K | |
![[ ]](/icons/layout.gif) | North_Providence_Man..> | 2024-10-04 11:53 | 268K | |
![[ ]](/icons/layout.gif) | Philadelphia_Man_Sen..> | 2024-10-04 11:53 | 268K | |
![[ ]](/icons/layout.gif) | Charlestown_Man_Sent..> | 2024-10-04 11:53 | 268K | |
![[ ]](/icons/layout.gif) | North_Providence_Man..> | 2024-10-04 11:53 | 268K | |
![[ ]](/icons/layout.gif) | New Jersey Man Sente..> | 2024-10-04 11:53 | 268K | |
![[ ]](/icons/layout.gif) | Batavia_Woman_And_Bu..> | 2024-10-04 11:53 | 268K | |
![[ ]](/icons/layout.gif) | Owner Of Farm Labor ..> | 2024-10-04 11:53 | 268K | |
![[ ]](/icons/layout.gif) | UAW_Kickbacks_Senten..> | 2024-10-04 11:53 | 268K | |
![[ ]](/icons/layout.gif) | Providence Man Sente..> | 2024-10-04 11:53 | 268K | |
![[ ]](/icons/layout.gif) | State_Prisoners_Sent..> | 2024-10-04 11:53 | 268K | |
![[ ]](/icons/layout.gif) | Chester_County_Woman..> | 2024-10-04 11:53 | 268K | |
![[ ]](/icons/layout.gif) | Montgomery_County_Go..> | 2024-10-04 11:53 | 269K | |
![[ ]](/icons/layout.gif) | Former_Federal_Inmat..> | 2024-10-04 11:53 | 269K | |
![[ ]](/icons/layout.gif) | Former_Union_VP_Indi..> | 2024-10-04 11:53 | 269K | |
![[ ]](/icons/layout.gif) | New_York_Man_Pleads_..> | 2024-10-04 11:53 | 269K | |
![[ ]](/icons/layout.gif) | Former_State_Employe..> | 2024-10-04 11:53 | 269K | |
![[ ]](/icons/layout.gif) | Camden_County_Man_Ad..> | 2024-10-04 11:53 | 269K | |
![[ ]](/icons/layout.gif) | Former_UAW_Official_..> | 2024-10-04 11:53 | 269K | |
![[ ]](/icons/layout.gif) | Rhode_Island_Man_Adm..> | 2024-10-04 11:53 | 269K | |
![[ ]](/icons/layout.gif) | Two_arraigned_in_3_m..> | 2024-10-04 11:53 | 269K | |
![[ ]](/icons/layout.gif) | Las_Vegas_Woman_Sent..> | 2024-10-04 11:53 | 269K | |
![[ ]](/icons/layout.gif) | Providence_Man_Await..> | 2024-10-04 11:53 | 269K | |
![[ ]](/icons/layout.gif) | Labor_Contractor_Ind..> | 2024-10-04 11:53 | 270K | |
![[ ]](/icons/layout.gif) | Man_Sentenced_Defrau..> | 2024-10-04 11:53 | 271K | |
![[ ]](/icons/layout.gif) | Camden_County_Woman_..> | 2024-10-04 11:53 | 271K | |
![[ ]](/icons/layout.gif) | Former_Washington_St..> | 2024-10-04 11:53 | 271K | |
![[ ]](/icons/layout.gif) | US_Reaches_Settlemen..> | 2024-10-04 11:53 | 272K | |
![[ ]](/icons/layout.gif) | Former_Amtrak_Employ..> | 2024-10-04 11:53 | 272K | |
![[ ]](/icons/layout.gif) | Albany_Woman_Pleads_..> | 2024-10-04 11:53 | 272K | |
![[ ]](/icons/layout.gif) | Acting_AUSA_Leary_Wa..> | 2024-10-04 11:53 | 272K | |
![[ ]](/icons/layout.gif) | Acting_US_Atty_Willi..> | 2024-10-04 11:53 | 272K | |
![[ ]](/icons/layout.gif) | New_York_Man_Sentenc..> | 2024-10-04 11:53 | 273K | |
![[ ]](/icons/layout.gif) | Nigerian_citizen_ple..> | 2024-10-04 11:53 | 273K | |
![[ ]](/icons/layout.gif) | Amtrak_Employee_Char..> | 2024-10-04 11:53 | 273K | |
![[ ]](/icons/layout.gif) | Iowa_Woman_Sentenced..> | 2024-10-04 11:53 | 273K | |
![[ ]](/icons/layout.gif) | General_Contractor_A..> | 2024-10-04 11:53 | 273K | |
![[ ]](/icons/layout.gif) | Defendant_Charged_1...> | 2024-10-04 11:53 | 273K | |
![[ ]](/icons/layout.gif) | Texas Man Sentenced ..> | 2024-10-04 11:53 | 275K | |
![[ ]](/icons/layout.gif) | Grand Jury Returns I..> | 2024-10-04 11:53 | 275K | |
![[ ]](/icons/layout.gif) | Former_UAW_Official_..> | 2024-10-04 11:53 | 276K | |
![[ ]](/icons/layout.gif) | 11_Members_and_Assoc..> | 2024-10-04 11:53 | 276K | |
![[ ]](/icons/layout.gif) | Parkville Man Senten..> | 2024-10-04 11:53 | 276K | |
![[ ]](/icons/layout.gif) | ColumbiaHeights_Rest..> | 2024-10-04 11:53 | 278K | |
![[ ]](/icons/layout.gif) | Queens_Postal_Worker..> | 2024-10-04 11:53 | 278K | |
![[ ]](/icons/layout.gif) | Three_Defendants_Cha..> | 2024-10-04 11:53 | 278K | |
![[ ]](/icons/layout.gif) | Local_Alleged_Drug_D..> | 2024-10-04 11:53 | 278K | |
![[ ]](/icons/layout.gif) | Over 100 Defendants ..> | 2024-10-04 11:53 | 278K | |
![[ ]](/icons/layout.gif) | Former_Department_of..> | 2024-10-04 11:53 | 278K | |
![[ ]](/icons/layout.gif) | Nationwide_Drug_Traf..> | 2024-10-04 11:53 | 279K | |
![[ ]](/icons/layout.gif) | Dominican_National_S..> | 2024-10-04 11:53 | 279K | |
![[ ]](/icons/layout.gif) | Three_Charged_in_All..> | 2024-10-04 11:53 | 280K | |
![[ ]](/icons/layout.gif) | Over 100 Defendants ..> | 2024-10-04 11:53 | 281K | |
![[ ]](/icons/layout.gif) | U.S. Attorney Wagner..> | 2024-10-04 11:53 | 281K | |
![[ ]](/icons/layout.gif) | Members_of_Brooklyn-..> | 2024-10-04 11:53 | 281K | |
![[ ]](/icons/layout.gif) | Owner_of_Medford_Con..> | 2024-10-04 11:53 | 284K | |
![[ ]](/icons/layout.gif) | Woman_Pleads_Guilty_..> | 2024-10-04 11:53 | 285K | |
![[ ]](/icons/layout.gif) | Leader_of_Pandemic_U..> | 2024-10-04 11:53 | 287K | |
![[ ]](/icons/layout.gif) | Doctor_Pleads_Guilty..> | 2024-10-04 11:53 | 287K | |
![[ ]](/icons/layout.gif) | Hot_Springs_Man_Plea..> | 2024-10-04 11:53 | 287K | |
![[ ]](/icons/layout.gif) | NY_Physcial_Therapy_..> | 2024-10-04 11:53 | 289K | |
![[ ]](/icons/layout.gif) | HOT_SPRINGS_MAN_SENT..> | 2024-10-04 11:53 | 289K | |
![[ ]](/icons/layout.gif) | Baltimore_Man_Facing..> | 2024-10-04 11:53 | 290K | |
![[ ]](/icons/layout.gif) | Menifee_Woman_Pleads..> | 2024-10-04 11:53 | 290K | |
![[ ]](/icons/layout.gif) | Inmate and Three Co-..> | 2024-10-04 11:53 | 291K | |
![[ ]](/icons/layout.gif) | Sherman_Oaks_Woman_P..> | 2024-10-04 11:53 | 292K | |
![[ ]](/icons/layout.gif) | Former_Executive_Dir..> | 2024-10-04 11:53 | 292K | |
![[ ]](/icons/layout.gif) | Nine_Members_and_Ass..> | 2024-10-04 11:53 | 293K | |
![[ ]](/icons/layout.gif) | Former_Postal_Servic..> | 2024-10-04 11:53 | 293K | |
![[ ]](/icons/layout.gif) | DOJ_Combatting_Pande..> | 2024-10-04 11:53 | 294K | |
![[ ]](/icons/layout.gif) | Defendants Charged.pdf | 2024-10-04 11:53 | 294K | |
![[ ]](/icons/layout.gif) | Middle District Of F..> | 2024-10-04 11:53 | 294K | |
![[ ]](/icons/layout.gif) | Former Amtrak Employ..> | 2024-10-04 11:53 | 294K | |
![[ ]](/icons/layout.gif) | Subcontractor_Agrees..> | 2024-10-04 11:53 | 294K | |
![[ ]](/icons/layout.gif) | Fourteen Gang Member..> | 2024-10-04 11:53 | 295K | |
![[ ]](/icons/layout.gif) | Brooklyn Woman Plead..> | 2024-10-04 11:53 | 295K | |
![[ ]](/icons/layout.gif) | U.S._Attorney_Announ..> | 2024-10-04 11:53 | 296K | |
![[ ]](/icons/layout.gif) | Individual_Indicted_..> | 2024-10-04 11:53 | 296K | |
![[ ]](/icons/layout.gif) | Fredericksburg Man P..> | 2024-10-04 11:53 | 296K | |
![[ ]](/icons/layout.gif) | Postal_Service_Mail_..> | 2024-10-04 11:53 | 296K | |
![[ ]](/icons/layout.gif) | Twin_Brothers_Facing..> | 2024-10-04 11:53 | 296K | |
![[ ]](/icons/layout.gif) | Reference_Lab_Pain_C..> | 2024-10-04 11:53 | 296K | |
![[ ]](/icons/layout.gif) | Feds_Charge_19_Defen..> | 2024-10-04 11:53 | 297K | |
![[ ]](/icons/layout.gif) | Four_Indv_Indicted_F..> | 2024-10-04 11:53 | 298K | |
![[ ]](/icons/layout.gif) | Florida_Man_Pleads_G..> | 2024-10-04 11:53 | 298K | |
![[ ]](/icons/layout.gif) | Brooklyn Woman Plead..> | 2024-10-04 11:53 | 298K | |
![[ ]](/icons/layout.gif) | Human_Smuggling_forc..> | 2024-10-04 11:53 | 300K | |
![[ ]](/icons/layout.gif) | One-Time_EDD_Employe..> | 2024-10-04 11:53 | 300K | |
![[ ]](/icons/layout.gif) | Coronavirus Fraud Ta..> | 2024-10-04 11:53 | 301K | |
![[ ]](/icons/layout.gif) | 3_Inland_Empire_Wome..> | 2024-10-04 11:53 | 301K | |
![[ ]](/icons/layout.gif) | Prince Georges Count..> | 2024-10-04 11:53 | 302K | |
![[ ]](/icons/layout.gif) | Georgia_Man_Sentence..> | 2024-10-04 11:53 | 302K | |
![[ ]](/icons/layout.gif) | Fourteen Gang Member..> | 2024-10-04 11:53 | 304K | |
![[ ]](/icons/layout.gif) | CARES_Act_Fraud_Inve..> | 2024-10-04 11:53 | 309K | |
![[ ]](/icons/layout.gif) | Nigerian_National_Se..> | 2024-10-04 11:53 | 310K | |
![[ ]](/icons/layout.gif) | Richmond Man Sentenc..> | 2024-10-04 11:53 | 313K | |
![[ ]](/icons/layout.gif) | 70 Current And Forme..> | 2024-10-04 11:53 | 315K | |
![[ ]](/icons/layout.gif) | Dental Practice Owne..> | 2024-10-04 11:53 | 315K | |
![[ ]](/icons/layout.gif) | Drug Trafficker Sent..> | 2024-10-04 11:53 | 316K | |
![[ ]](/icons/layout.gif) | Missouri_Health_Care..> | 2024-10-04 11:53 | 316K | |
![[ ]](/icons/layout.gif) | Maryland_Doctor_Faci..> | 2024-10-04 11:53 | 317K | |
![[ ]](/icons/layout.gif) | Florida_Man_Who_Stol..> | 2024-10-04 11:53 | 318K | |
![[ ]](/icons/layout.gif) | Two Men Sentenced fo..> | 2024-10-04 11:53 | 319K | |
![[ ]](/icons/layout.gif) | Justice_Department_A..> | 2024-10-04 11:53 | 320K | |
![[ ]](/icons/layout.gif) | New_Jersey_Man_Sente..> | 2024-10-04 11:53 | 321K | |
![[ ]](/icons/layout.gif) | Maryland_Man_Sentenc..> | 2024-10-04 11:53 | 321K | |
![[ ]](/icons/layout.gif) | Two_New_Jersey_Men_A..> | 2024-10-04 11:53 | 322K | |
![[ ]](/icons/layout.gif) | New York Man Sentenc..> | 2024-10-04 11:53 | 325K | |
![[ ]](/icons/layout.gif) | Southern_District_Fl..> | 2024-10-04 11:53 | 326K | |
![[ ]](/icons/layout.gif) | 61 Defendants Charge..> | 2024-10-04 11:53 | 327K | |
![[ ]](/icons/layout.gif) | Roshell Beaty Senten..> | 2024-10-04 11:53 | 330K | |
![[ ]](/icons/layout.gif) | Georgia siblings sen..> | 2024-10-04 11:53 | 330K | |
![[ ]](/icons/layout.gif) | Federal Jury Convict..> | 2024-10-04 11:53 | 331K | |
![[ ]](/icons/layout.gif) | AG Initiative to Inv..> | 2024-10-04 11:53 | 332K | |
![[ ]](/icons/layout.gif) | Dont_be_a_Mule_DOL_O..> | 2024-10-04 11:53 | 333K | |
![[ ]](/icons/layout.gif) | NR bribery federal p..> | 2024-10-04 11:53 | 334K | |
![[ ]](/icons/layout.gif) | Five Charged with Fa..> | 2025-05-30 07:56 | 345K | |
![[ ]](/icons/layout.gif) | Baker complaint pr.pdf | 2024-10-04 11:53 | 351K | |
![[ ]](/icons/layout.gif) | More_charges_filed_i..> | 2024-10-04 11:53 | 351K | |
![[ ]](/icons/layout.gif) | Aurora_Residents_Chi..> | 2024-10-04 11:53 | 357K | |
![[ ]](/icons/layout.gif) | FCA_US_LLC_Sentenced..> | 2024-10-04 11:53 | 360K | |
![[ ]](/icons/layout.gif) | Brooklyn Woman Sente..> | 2024-10-04 11:53 | 361K | |
![[ ]](/icons/layout.gif) | Laurel Man Sentenced..> | 2024-10-04 11:53 | 371K | |
![[ ]](/icons/layout.gif) | South_Florida_U.S._A..> | 2024-10-04 11:53 | 383K | |
![[ ]](/icons/layout.gif) | Attorney General Jam..> | 2024-10-04 11:53 | 391K | |
![[ ]](/icons/layout.gif) | Two Nigerian Nationa..> | 2024-10-04 11:53 | 392K | |
![[ ]](/icons/layout.gif) | US_Attorney_Announce..> | 2024-10-04 11:53 | 449K | |
![[ ]](/icons/layout.gif) | Canadian resident se..> | 2024-10-04 11:53 | 454K | |
![[ ]](/icons/layout.gif) | Healthcare_Fraud_Set..> | 2024-10-04 11:53 | 475K | |
![[ ]](/icons/layout.gif) | Laredo resident admi..> | 2024-10-04 11:53 | 480K | |
![[ ]](/icons/layout.gif) | Honduran Man Pleads ..> | 2024-10-04 11:53 | 482K | |
![[ ]](/icons/layout.gif) | Laredo resident sent..> | 2024-10-04 11:53 | 482K | |
![[ ]](/icons/layout.gif) | Houston Woman Pleads..> | 2024-10-04 11:53 | 484K | |
![[ ]](/icons/layout.gif) | Texas Man Arraigned ..> | 2024-10-04 11:53 | 484K | |
![[ ]](/icons/layout.gif) | Honduran National Pl..> | 2024-10-04 11:53 | 485K | |
![[ ]](/icons/layout.gif) | Two Charged With 12M..> | 2024-10-04 11:53 | 486K | |
![[ ]](/icons/layout.gif) | Grove City man sente..> | 2024-10-04 11:53 | 486K | |
![[ ]](/icons/layout.gif) | Sentenced for Role i..> | 2024-10-04 11:53 | 486K | |
![[ ]](/icons/layout.gif) | Pain Doctors Plead G..> | 2024-10-04 11:53 | 486K | |
![[ ]](/icons/layout.gif) | Cincinnati man sente..> | 2024-10-04 11:53 | 487K | |
![[ ]](/icons/layout.gif) | Romance Scammer Sent..> | 2024-10-04 11:53 | 487K | |
![[ ]](/icons/layout.gif) | Winter Garden Man Se..> | 2024-10-04 11:53 | 487K | |
![[ ]](/icons/layout.gif) | Four Honduran Nation..> | 2024-10-04 11:53 | 487K | |
![[ ]](/icons/layout.gif) | Chicago Man Sentence..> | 2024-10-04 11:53 | 487K | |
![[ ]](/icons/layout.gif) | Fayette County Auto ..> | 2024-10-04 11:53 | 488K | |
![[ ]](/icons/layout.gif) | Federal grand jury i..> | 2024-10-04 11:53 | 488K | |
![[ ]](/icons/layout.gif) | Hartford Man Charged..> | 2024-10-04 11:53 | 488K | |
![[ ]](/icons/layout.gif) | Rush City Woman Sent..> | 2024-10-04 11:53 | 488K | |
![[ ]](/icons/layout.gif) | Fayette County Auto ..> | 2024-10-04 11:53 | 489K | |
![[ ]](/icons/layout.gif) | Rochester woman plea..> | 2024-10-04 11:53 | 489K | |
![[ ]](/icons/layout.gif) | Queens Man Charged w..> | 2024-10-04 11:53 | 489K | |
![[ ]](/icons/layout.gif) | Man Convicted of 55M..> | 2024-10-04 11:53 | 490K | |
![[ ]](/icons/layout.gif) | Man Sentenced for 87..> | 2024-10-04 11:53 | 490K | |
![[ ]](/icons/layout.gif) | Former Social Securi..> | 2024-10-04 11:53 | 490K | |
![[ ]](/icons/layout.gif) | Two Suburban Chicago..> | 2024-10-04 11:53 | 490K | |
![[ ]](/icons/layout.gif) | Former Tax Preparer ..> | 2024-10-04 11:53 | 490K | |
![[ ]](/icons/layout.gif) | Foreign National Sen..> | 2024-10-04 11:53 | 490K | |
![[ ]](/icons/layout.gif) | PA Man Sentenced To ..> | 2024-10-04 11:53 | 491K | |
![[ ]](/icons/layout.gif) | Convicted Felon Sent..> | 2024-10-04 11:53 | 491K | |
![[ ]](/icons/layout.gif) | Troy Man Indicted fo..> | 2024-10-04 11:53 | 491K | |
![[ ]](/icons/layout.gif) | Springfield Man Sent..> | 2024-10-04 11:53 | 491K | |
![[ ]](/icons/layout.gif) | Former Cashier at VA..> | 2024-10-04 11:53 | 491K | |
![[ ]](/icons/layout.gif) | Worcester Man Senten..> | 2024-10-04 11:53 | 492K | |
![[ ]](/icons/layout.gif) | Macon Resident Plead..> | 2024-10-04 11:53 | 492K | |
![[ ]](/icons/layout.gif) | Southfield Man First..> | 2024-10-04 11:53 | 492K | |
![[ ]](/icons/layout.gif) | Atlantic County Man ..> | 2024-10-04 11:53 | 492K | |
![[ ]](/icons/layout.gif) | Maryland Man Sentenc..> | 2024-10-04 11:53 | 492K | |
![[ ]](/icons/layout.gif) | Maryland Man Pleads ..> | 2024-10-04 11:53 | 492K | |
![[ ]](/icons/layout.gif) | Southfield Woman Ple..> | 2024-10-04 11:53 | 492K | |
![[ ]](/icons/layout.gif) | Businesswoman Senten..> | 2024-10-04 11:53 | 493K | |
![[ ]](/icons/layout.gif) | Troy Man Pleads Guil..> | 2024-10-04 11:53 | 493K | |
![[ ]](/icons/layout.gif) | Colonie Man Pleads G..> | 2024-10-04 11:53 | 493K | |
![[ ]](/icons/layout.gif) | Houma Man Pleads Gui..> | 2024-10-04 11:53 | 493K | |
![[ ]](/icons/layout.gif) | Beverly Farms Man Se..> | 2024-10-04 11:53 | 493K | |
![[ ]](/icons/layout.gif) | Parker Man Indicted ..> | 2024-10-04 11:53 | 493K | |
![[ ]](/icons/layout.gif) | AC Resident Sentence..> | 2024-10-04 11:53 | 493K | |
![[ ]](/icons/layout.gif) | Plymouth Man Sentenc..> | 2024-10-04 11:53 | 493K | |
![[ ]](/icons/layout.gif) | Tracy Woman Pleads G..> | 2024-10-04 11:53 | 493K | |
![[ ]](/icons/layout.gif) | Pittsburgh Resident ..> | 2024-10-04 11:53 | 494K | |
![[ ]](/icons/layout.gif) | Atlanta man sentence..> | 2024-10-04 11:53 | 494K | |
![[ ]](/icons/layout.gif) | Romance Scammer Conv..> | 2024-10-04 11:53 | 495K | |
![[ ]](/icons/layout.gif) | Woman and Her Two Da..> | 2024-10-04 11:53 | 495K | |
![[ ]](/icons/layout.gif) | Owner of Medford Con..> | 2024-10-04 11:53 | 495K | |
![[ ]](/icons/layout.gif) | Pharmacy Owner Sente..> | 2024-10-04 11:53 | 495K | |
![[ ]](/icons/layout.gif) | Dudley Man Sentenced..> | 2024-10-04 11:53 | 495K | |
![[ ]](/icons/layout.gif) | Ex-Husband Of ‘Rea..> | 2024-10-04 11:53 | 495K | |
![[ ]](/icons/layout.gif) | Albany Resident Sent..> | 2024-10-04 11:53 | 495K | |
![[ ]](/icons/layout.gif) | John Doe Pleads Guil..> | 2024-10-04 11:53 | 495K | |
![[ ]](/icons/layout.gif) | Yonkers Man Sentence..> | 2024-10-04 11:53 | 496K | |
![[ ]](/icons/layout.gif) | Tulsa_OK_Man Sentenc..> | 2024-10-04 11:53 | 496K | |
![[ ]](/icons/layout.gif) | New York Man Indicte..> | 2024-10-04 11:53 | 496K | |
![[ ]](/icons/layout.gif) | Middlesex County Man..> | 2024-10-04 11:53 | 496K | |
![[ ]](/icons/layout.gif) | Middlesex County Wom..> | 2024-10-04 11:53 | 496K | |
![[ ]](/icons/layout.gif) | Albany Man Sentenced..> | 2024-10-04 11:53 | 497K | |
![[ ]](/icons/layout.gif) | Defendants Sentenced..> | 2024-10-04 11:53 | 497K | |
![[ ]](/icons/layout.gif) | Hampton Man Pleads G..> | 2024-10-04 11:53 | 497K | |
![[ ]](/icons/layout.gif) | West Roxbury Man Ple..> | 2024-10-04 11:53 | 497K | |
![[ ]](/icons/layout.gif) | Three Individuals In..> | 2024-10-04 11:53 | 498K | |
![[ ]](/icons/layout.gif) | Annual Awards Ceremo..> | 2024-10-04 11:53 | 498K | |
![[ ]](/icons/layout.gif) | Gainesville man plea..> | 2024-10-04 11:53 | 498K | |
![[ ]](/icons/layout.gif) | Serial Fraudster Sen..> | 2024-10-04 11:53 | 498K | |
![[ ]](/icons/layout.gif) | Former Inland Empire..> | 2024-10-04 11:53 | 499K | |
![[ ]](/icons/layout.gif) | Houston Woman Pleads..> | 2024-10-04 11:53 | 499K | |
![[ ]](/icons/layout.gif) | Four Men Convicted o..> | 2024-10-04 11:53 | 499K | |
![[ ]](/icons/layout.gif) | Former Hollywood-Bas..> | 2024-10-04 11:53 | 499K | |
![[ ]](/icons/layout.gif) | Houston Woman Senten..> | 2024-10-04 11:53 | 500K | |
![[ ]](/icons/layout.gif) | Pharmacy Owners and ..> | 2024-10-04 11:53 | 500K | |
![[ ]](/icons/layout.gif) | CA Man Admits to Wir..> | 2024-10-04 11:53 | 501K | |
![[ ]](/icons/layout.gif) | Owner of Boston Pizz..> | 2024-10-04 11:53 | 501K | |
![[ ]](/icons/layout.gif) | Former Local 98 Pres..> | 2024-10-04 11:53 | 501K | |
![[ ]](/icons/layout.gif) | Boston Man Pleads Gu..> | 2024-10-04 11:53 | 501K | |
![[ ]](/icons/layout.gif) | Metro Atlanta Man Se..> | 2024-10-04 11:53 | 501K | |
![[ ]](/icons/layout.gif) | Granada Hills Man Se..> | 2024-10-04 11:53 | 502K | |
![[ ]](/icons/layout.gif) | COVID-19 Fraud Enfor..> | 2024-10-04 11:53 | 502K | |
![[ ]](/icons/layout.gif) | Laurel Man Pleads Gu..> | 2024-10-04 11:53 | 502K | |
![[ ]](/icons/layout.gif) | Corona Man Sentenced..> | 2024-10-04 11:53 | 502K | |
![[ ]](/icons/layout.gif) | Albany Man Pleads Gu..> | 2024-10-04 11:53 | 503K | |
![[ ]](/icons/layout.gif) | USPS Employee Senten..> | 2024-10-04 11:53 | 503K | |
![[ ]](/icons/layout.gif) | Fraudster Sentenced ..> | 2024-10-04 11:53 | 503K | |
![[ ]](/icons/layout.gif) | Former Union Preside..> | 2024-10-04 11:53 | 503K | |
![[ ]](/icons/layout.gif) | One of two Nigerian ..> | 2024-10-04 11:53 | 504K | |
![[ ]](/icons/layout.gif) | CEO of Non-Profit th..> | 2024-10-04 11:53 | 505K | |
![[ ]](/icons/layout.gif) | Californian Sentence..> | 2024-10-04 11:53 | 505K | |
![[ ]](/icons/layout.gif) | Former College Footb..> | 2024-10-04 11:53 | 506K | |
![[ ]](/icons/layout.gif) | Cincinnati healthcar..> | 2024-10-04 11:53 | 507K | |
![[ ]](/icons/layout.gif) | Iowa Custom Cattle F..> | 2024-10-04 11:53 | 507K | |
![[ ]](/icons/layout.gif) | Utah County Business..> | 2024-10-04 11:53 | 508K | |
![[ ]](/icons/layout.gif) | Saratoga County Man ..> | 2024-10-04 11:53 | 509K | |
![[ ]](/icons/layout.gif) | Heath Street Gang Me..> | 2024-10-04 11:53 | 511K | |
![[ ]](/icons/layout.gif) | Husband and Wife Ple..> | 2024-10-04 11:53 | 511K | |
![[ ]](/icons/layout.gif) | Federal Grand Jury I..> | 2024-10-04 11:53 | 514K | |
![[ ]](/icons/layout.gif) | MD Career Offender S..> | 2024-10-04 11:53 | 514K | |
![[ ]](/icons/layout.gif) | Ten Members and Asso..> | 2024-10-04 11:53 | 515K | |
![[ ]](/icons/layout.gif) | Scam Alert - Law Enf..> | 2024-10-04 11:53 | 517K | |
![[ ]](/icons/layout.gif) | Two Former Missouri ..> | 2024-10-04 11:53 | 523K | |
![[ ]](/icons/layout.gif) | Attorney General Rao..> | 2024-10-04 11:53 | 527K | |
![[ ]](/icons/layout.gif) | Traveling carnival b..> | 2024-10-04 11:53 | 527K | |
![[ ]](/icons/layout.gif) | Four Individuals Con..> | 2024-10-04 11:53 | 527K | |
![[ ]](/icons/layout.gif) | Physician and two ph..> | 2024-10-04 11:53 | 534K | |
![[ ]](/icons/layout.gif) | Florida Man Facing F..> | 2024-10-04 11:53 | 541K | |
![[ ]](/icons/layout.gif) | 2 Defendants Plead G..> | 2024-10-04 11:53 | 542K | |
![[ ]](/icons/layout.gif) | West NY Financial Ad..> | 2024-10-04 11:53 | 572K | |
![[ ]](/icons/layout.gif) | NUIFTF Alert Fraudul..> | 2024-10-04 11:53 | 574K | |
![[ ]](/icons/layout.gif) | Florida Man Sentence..> | 2024-10-04 11:53 | 577K | |
![[ ]](/icons/layout.gif) | Former Massachusetts..> | 2024-10-04 11:53 | 581K | |
![[ ]](/icons/layout.gif) | President Of Queens-..> | 2024-10-04 11:53 | 581K | |
![[ ]](/icons/layout.gif) | CFO Of Multinational..> | 2024-10-04 11:53 | 591K | |
![[ ]](/icons/layout.gif) | Brooklyn Woman Sente..> | 2024-10-04 11:53 | 592K | |
![[ ]](/icons/layout.gif) | Five Defendants Arre..> | 2024-10-04 11:53 | 601K | |
![[ ]](/icons/layout.gif) | Eight charged locall..> | 2024-10-04 11:53 | 613K | |
![[ ]](/icons/layout.gif) | 28 Gang Members_Asso..> | 2024-10-04 11:53 | 655K | |
![[ ]](/icons/layout.gif) | Eight Dallas-Area Ph..> | 2024-10-04 11:53 | 682K | |
![[ ]](/icons/layout.gif) | USAO EDLA Press Rele..> | 2024-10-04 11:53 | 702K | |
![[ ]](/icons/layout.gif) | Battle Creek Hotel O..> | 2024-10-04 11:53 | 772K | |
![[ ]](/icons/layout.gif) | NUIFTF Alert, Errone..> | 2024-10-04 11:53 | 827K | |
![[ ]](/icons/layout.gif) | NUIFTF - Alert, Text..> | 2024-10-04 11:53 | 838K | |
![[ ]](/icons/layout.gif) | Lake County Woman Se..> | 2024-10-04 11:53 | 897K | |
![[ ]](/icons/layout.gif) | UI Program Letter 50..> | 2024-10-04 11:53 | 1.0M | |
![[ ]](/icons/layout.gif) | DOL OIG Investigativ..> | 2024-10-04 11:53 | 1.8M | |
|