Index of /public/Press Releases
![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|---|
|
|---|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[ ]](/icons/layout.gif) | Queens Couple Senten..> | 2024-09-23 10:21 | 70K | |
| 32 Individuals Indic..> | 2024-10-04 11:53 | 162K | |
| Eight_Individuals_In..> | 2024-10-04 11:53 | 92K | |
| Six Individuals Indi..> | 2024-10-04 11:53 | 184K | |
| Twelve_Individuals_I..> | 2024-10-04 11:53 | 93K | |
| 013020-Pair-Plea-in-..> | 2024-10-04 11:53 | 227K | |
| 10 District Men Arre..> | 2024-10-04 11:53 | 119K | |
| 11_Members_and_Assoc..> | 2024-10-04 11:53 | 276K | |
| 11_Romance_Scammers_..> | 2024-10-04 11:53 | 112K | |
| 14 Defendants, Inclu..> | 2024-10-04 11:53 | 174K | |
| 14_DEFENDANTS_INDICT..> | 2024-10-04 11:53 | 215K | |
| 14_Defendants_Senten..> | 2024-10-04 11:53 | 139K | |
| 2 Defendants Plead G..> | 2024-10-04 11:53 | 542K | |
| 2 Sentenced to Priso..> | 2024-10-04 11:53 | 42K | |
| 14_Individuals_Charg..> | 2024-10-04 11:53 | 111K | |
| 23_Indicted_Fed_CARE..> | 2024-10-04 11:53 | 145K | |
| 25 Charged in Federa..> | 2024-10-04 11:53 | 93K | |
| 2nd Former Newport P..> | 2024-10-04 11:53 | 30K | |
| 25 Southern Californ..> | 2024-10-04 11:53 | 165K | |
| 28 Charged in $9.5 M..> | 2024-10-04 11:53 | 90K | |
| 28 Gang Members_Asso..> | 2024-10-04 11:53 | 655K | |
| 3_FL_Residents_Sente..> | 2024-10-04 11:53 | 117K | |
| 3_Inland_Empire_Wome..> | 2024-10-04 11:53 | 301K | |
| 3_Inland_Empire_Wome..> | 2024-10-04 11:53 | 118K | |
| 3_MD_Men_Facing_Fed_..> | 2024-10-04 11:53 | 126K | |
| 4 Corners Pharmacy A..> | 2024-10-04 11:53 | 157K | |
| 4_Defendants_Charged..> | 2024-10-04 11:53 | 110K | |
| 6_Physical_Therapist..> | 2024-10-04 11:53 | 121K | |
| 6_Texas_Pharmacy_Own..> | 2024-10-04 11:53 | 131K | |
| 61 Defendants Charge..> | 2024-10-04 11:53 | 327K | |
| 68 Defendants Charge..> | 2024-10-04 11:53 | 106K | |
| 70 Current And Forme..> | 2024-10-04 11:53 | 315K | |
| 8 Members and Associ..> | 2024-10-04 11:53 | 83K | |
| 8_Civillian_Employee..> | 2024-10-04 11:53 | 108K | |
| 8_Defendants_Facing_..> | 2024-10-04 11:53 | 129K | |
| 9_San_Diego_Resident..> | 2024-10-04 11:53 | 123K | |
| 91-3939-0039PC 15092..> | 2024-10-04 11:53 | 37K | |
| 91-3962-0013PCJ.1510..> | 2024-10-04 11:53 | 36K | |
| A.G. Schneiderman An..> | 2024-10-04 11:53 | 75K | |
| A.G. Schneiderman An..> | 2024-10-04 11:53 | 37K | |
| AC Resident Sentence..> | 2024-10-04 11:53 | 493K | |
| AC_Firefighter_Convi..> | 2024-10-04 11:53 | 80K | |
| AFLAC scam - Sledge ..> | 2024-10-04 11:53 | 58K | |
| AG Initiative to Inv..> | 2024-10-04 11:53 | 332K | |
| AG_Miyares_Secures_T..> | 2024-10-04 11:53 | 142K | |
| AZ_AG_Attorney Gener..> | 2024-10-04 11:53 | 150K | |
| AZ_Man_Pleads_Guilty..> | 2024-10-04 11:53 | 95K | |
| Abel Nazario-Quinone..> | 2024-10-04 11:53 | 105K | |
| Abraham et al Compla..> | 2024-10-04 11:53 | 205K | |
| Accountant Charged w..> | 2024-10-04 11:53 | 50K | |
| Acosta Sergio and Ac..> | 2024-10-04 11:53 | 53K | |
| Acting Boss Of Bonan..> | 2024-10-04 11:53 | 37K | |
| Acting_AUSA_Leary_Wa..> | 2024-10-04 11:53 | 272K | |
| Acting_US_Atty_Willi..> | 2024-10-04 11:53 | 272K | |
| Acton Man Sentenced ..> | 2024-10-04 11:53 | 165K | |
| Acton_and_Manchester..> | 2024-10-04 11:53 | 100K | |
| Additional_Charges_C..> | 2024-10-04 11:53 | 257K | |
| Additional_Charges_C..> | 2024-10-04 11:53 | 99K | |
| AkalaDiameterPleaPR ..> | 2024-10-04 11:53 | 62K | |
| AkalaDiameterSentenc..> | 2024-10-04 11:53 | 62K | |
| Alabama Woman Senten..> | 2024-10-04 11:53 | 111K | |
| Albany Man Pleads Gu..> | 2024-10-04 11:53 | 503K | |
| Albany Man Sentenced..> | 2024-10-04 11:53 | 497K | |
| Albany Resident Sent..> | 2024-10-04 11:53 | 495K | |
| Albany_Man_Arraigned..> | 2024-10-04 11:53 | 122K | |
| Albany_Man_Pleads_Gu..> | 2024-10-04 11:53 | 160K | |
| Albany_Man_Pleads_Gu..> | 2024-10-04 11:53 | 123K | |
| Albany_Woman_Pleads_..> | 2024-10-04 11:53 | 272K | |
| Albuquerque man indi..> | 2024-10-04 11:53 | 82K | |
| Alexander Plea PR 06..> | 2024-10-04 11:53 | 241K | |
| Alexandria Man Plead..> | 2024-10-04 11:53 | 132K | |
| Alleged Mastermind o..> | 2024-10-04 11:53 | 141K | |
| AllenDoreenPleaPR 6...> | 2024-10-04 11:53 | 37K | |
| Allen Park Man Sente..> | 2024-10-04 11:53 | 107K | |
| Allen_Park_Tax_Prepa..> | 2024-10-04 11:53 | 100K | |
| Ambulance Company Ow..> | 2024-10-04 11:53 | 16K | |
| Amherst Man Sentence..> | 2024-10-04 11:53 | 189K | |
| Amsterdam Woman and ..> | 2024-10-04 11:53 | 82K | |
| Amtrak_Employee_Char..> | 2024-10-04 11:53 | 273K | |
| Andover Construction..> | 2024-10-04 11:53 | 48K | |
| Andover Man Pleads G..> | 2024-10-04 11:53 | 24K | |
| Annual Awards Ceremo..> | 2024-10-04 11:53 | 498K | |
| Architects_48_Millio..> | 2024-10-04 11:53 | 131K | |
| Arizona_Man_Sentence..> | 2024-10-04 11:53 | 263K | |
| Arkansas_Woman_Plead..> | 2024-10-04 11:53 | 79K | |
| Arkansas_Woman_Sente..> | 2024-10-04 11:53 | 80K | |
| Army_Servicemember_F..> | 2024-10-04 11:53 | 163K | |
| Atlanta man sentence..> | 2024-10-04 11:53 | 494K | |
| Atlantic City Counci..> | 2024-10-04 11:53 | 163K | |
| Atlantic City Man Se..> | 2024-10-04 11:53 | 73K | |
| Atlantic County Man ..> | 2024-10-04 11:53 | 32K | |
| Atlantic County Man ..> | 2024-10-04 11:53 | 161K | |
| Atlantic County Man ..> | 2024-10-04 11:53 | 83K | |
| Atlantic County Man ..> | 2024-10-04 11:53 | 492K | |
| Atlantic County New ..> | 2024-10-04 11:53 | 87K | |
| Atlantic County New ..> | 2024-10-04 11:53 | 31K | |
| Atlantic County Resi..> | 2024-10-04 11:53 | 161K | |
| Atlantic_County_Dr_A..> | 2024-10-04 11:53 | 160K | |
| Attorney Consultant ..> | 2024-10-04 11:53 | 108K | |
| Attorney Convicted o..> | 2024-10-04 11:53 | 53K | |
| Attorney General Jam..> | 2024-10-04 11:53 | 391K | |
| Attorney General Lax..> | 2024-10-04 11:53 | 204K | |
| Attorney General Miy..> | 2024-10-04 11:53 | 93K | |
| Attorney General Rao..> | 2024-10-04 11:53 | 527K | |
| Augusta_Man_sentence..> | 2024-10-04 11:53 | 164K | |
| Augusta man admits t..> | 2024-10-04 11:53 | 167K | |
| Aurora_Residents_Chi..> | 2024-10-04 11:53 | 357K | |
| Austin Area Chiropra..> | 2024-10-04 11:53 | 81K | |
| BEDWELL Sentencing P..> | 2024-10-04 11:53 | 56K | |
| BUILDING CONTRACTOR ..> | 2024-10-04 11:53 | 57K | |
| Baker complaint pr.pdf | 2024-10-04 11:53 | 351K | |
| Baldwinsville Man Se..> | 2024-10-04 11:53 | 100K | |
| Baltimore_Man_Facing..> | 2024-10-04 11:53 | 290K | |
| Baltimore_Man_Senten..> | 2024-10-04 11:53 | 117K | |
| Bank Manager Admits ..> | 2024-10-04 11:53 | 107K | |
| Bart Verdict.pdf | 2024-10-04 11:53 | 52K | |
| Batavia_Woman_And_Bu..> | 2024-10-04 11:53 | 268K | |
| Batavia_Woman_Arrest..> | 2024-10-04 11:53 | 103K | |
| Batavia_Woman_Pleads..> | 2024-10-04 11:53 | 102K | |
| Baton Rouge Doctor S..> | 2024-10-04 11:53 | 105K | |
| Battle Creek Hotel O..> | 2024-10-04 11:53 | 772K | |
| Battle Creek Hotel O..> | 2024-10-04 11:53 | 20K | |
| Beam Bros. Trucking ..> | 2024-10-04 11:53 | 25K | |
| Bedwell Guilty Plea ..> | 2024-10-04 11:53 | 57K | |
| Bello George Plea PR..> | 2024-10-04 11:53 | 58K | |
| BempaBoateng-Benitez..> | 2024-10-04 11:53 | 67K | |
| Bergen County, New J..> | 2024-10-04 11:53 | 102K | |
| Bergen County, New J..> | 2024-10-04 11:53 | 101K | |
| Bergen County Man Ad..> | 2024-10-04 11:53 | 104K | |
| Beverly Farms Man Pl..> | 2024-10-04 11:53 | 166K | |
| Beverly Farms Man Se..> | 2024-10-04 11:53 | 493K | |
| Beverly_Farms_Man_In..> | 2024-10-04 11:53 | 87K | |
| Big_Stone_Gap_Man_Pl..> | 2024-10-04 11:53 | 83K | |
| Big_Stone_Gap_Man_Se..> | 2024-10-04 11:53 | 77K | |
| Blankenship Sentence..> | 2024-10-04 11:53 | 110K | |
| Bloomington Woman Se..> | 2024-10-04 11:53 | 159K | |
| Blytheville Man Sent..> | 2024-10-04 11:53 | 142K | |
![[ ]](/icons/unknown.gif) | BoltonLarosaPleaPR.PDF | 2024-10-04 11:53 | 33K | |
| Boston City Official..> | 2024-10-04 11:53 | 67K | |
| Boston Man Pleads Gu..> | 2024-10-04 11:53 | 79K | |
| Boston Man Pleads Gu..> | 2024-10-04 11:53 | 501K | |
| Boston Man Sentenced..> | 2024-10-04 11:53 | 119K | |
| Boston Woman Pleads ..> | 2024-10-04 11:53 | 88K | |
| Boston_Man_Charged_F..> | 2024-10-04 11:53 | 80K | |
| Boston_Man_Charged_w..> | 2024-10-04 11:53 | 267K | |
| Boston_Man_Pleads_Gu..> | 2024-10-04 11:53 | 106K | |
| Boston_Man_Pleads_Gu..> | 2024-10-04 11:53 | 107K | |
| Boston_Man_Sentenced..> | 2024-10-04 11:53 | 107K | |
| Boston_Man_Sentenced..> | 2024-10-04 11:53 | 163K | |
| Bristol_Man_Sentence..> | 2024-10-04 11:53 | 104K | |
| Bristol_TN_Man_Sente..> | 2024-10-04 11:53 | 58K | |
| Bristol_Tennessee_Wo..> | 2024-10-04 11:53 | 82K | |
| Bristol_Tennessee_Wo..> | 2024-10-04 11:53 | 84K | |
| Brockton Man Sentenc..> | 2024-10-04 11:53 | 159K | |
| Brockton_Man_Charged..> | 2024-10-04 11:53 | 100K | |
| Bronx Man Sentenced ..> | 2024-10-04 11:53 | 90K | |
| Brooklyn Woman Plead..> | 2024-10-04 11:53 | 298K | |
| Brooklyn Woman Plead..> | 2024-10-04 11:53 | 295K | |
| Brooklyn Woman Sente..> | 2024-10-04 11:53 | 361K | |
| Brooklyn Woman Sente..> | 2024-10-04 11:53 | 592K | |
| Brother_Sister_Two_O..> | 2024-10-04 11:53 | 160K | |
| Brothers_Chicago_Cha..> | 2024-10-04 11:53 | 102K | |
| Broward County Resid..> | 2024-10-04 11:53 | 22K | |
| BrownGarySentencePR.pdf | 2024-10-04 11:53 | 42K | |
| Brunswick couple cha..> | 2024-10-04 11:53 | 23K | |
| Bucks_County_Drug_Ma..> | 2024-10-04 11:53 | 123K | |
| Buffalo Man Indicted..> | 2024-10-04 11:53 | 19K | |
| Buffalo_Woman_Arrest..> | 2024-10-04 11:53 | 262K | |
| Buffalo_Woman_Pleads..> | 2024-10-04 11:53 | 84K | |
| Building Contractor ..> | 2024-10-04 11:53 | 53K | |
| Burgettstown_Man_Sen..> | 2024-10-04 11:53 | 80K | |
| Business Manager Sen..> | 2024-10-04 11:53 | 51K | |
| Business Manager and..> | 2024-10-04 11:53 | 102K | |
| Business_Owner_Sente..> | 2024-10-04 11:53 | 114K | |
| Businesswoman Pleads..> | 2024-10-04 11:53 | 75K | |
| Businesswoman Senten..> | 2024-10-04 11:53 | 493K | |
| Businness Owners Cha..> | 2024-10-04 11:53 | 37K | |
| Byrns Plea MDFL WDMO..> | 2024-10-04 11:53 | 112K | |
| CA Man Admits to Wir..> | 2024-10-04 11:53 | 501K | |
| CARES_Act_Fraud_Inve..> | 2024-10-04 11:53 | 309K | |
| CA_Man_Pleads_Guilty..> | 2024-10-04 11:53 | 103K | |
| CA_Marketer_Sentence..> | 2024-10-04 11:53 | 105K | |
| CA_Resident_Sentence..> | 2024-10-04 11:53 | 160K | |
| CA_Woman_Pleads_guil..> | 2024-10-04 11:53 | 104K | |
| CDCA_Mail_Fraud.pdf | 2024-10-04 11:53 | 112K | |
| CDCA_UI_Scheme.pdf | 2024-10-04 11:53 | 141K | |
| CD_CA_Rapper_UI.pdf | 2024-10-04 11:53 | 119K | |
| CEO Gets More Than 1..> | 2024-10-04 11:53 | 61K | |
| CEO Of Denver Techno..> | 2024-10-04 11:53 | 112K | |
| CEO of Non-Profit th..> | 2024-10-04 11:53 | 505K | |
| CFO Of Multinational..> | 2024-10-04 11:53 | 591K | |
| CFO_CT_Insurance_Fir..> | 2024-10-04 11:53 | 91K | |
| CFO and VP Sentenced..> | 2024-10-04 11:53 | 71K | |
| CFO of Local Drywall..> | 2024-10-04 11:53 | 19K | |
| COLUMBUS DOCTOR TO P..> | 2024-10-04 11:53 | 118K | |
| COVID-19 Fraud Enfor..> | 2024-10-04 11:53 | 502K | |
| COVID-19 Testing Fra..> | 2024-10-04 11:53 | 105K | |
| COVID-19_Unemploymen..> | 2024-10-04 11:53 | 261K | |
| CT_Nursing_Home_Oper..> | 2024-10-04 11:53 | 104K | |
| California Man Accus..> | 2024-10-04 11:53 | 143K | |
| California Man Charg..> | 2024-10-04 11:53 | 104K | |
| California Man Plead..> | 2024-10-04 11:53 | 160K | |
| California Man Plead..> | 2024-10-04 11:53 | 83K | |
| California Man Sente..> | 2024-10-04 11:53 | 165K | |
| California_Employmen..> | 2024-10-04 11:53 | 112K | |
| California_Man_Charg..> | 2024-10-04 11:53 | 86K | |
| California_Man_Sente..> | 2024-10-04 11:53 | 265K | |
| Californian Sentence..> | 2024-10-04 11:53 | 505K | |
| Camarillo Man Senten..> | 2024-10-04 11:53 | 113K | |
| Camden County Man Ad..> | 2024-10-04 11:53 | 90K | |
| Camden County Reside..> | 2024-10-04 11:53 | 267K | |
| Camden_County_Man_Ad..> | 2024-10-04 11:53 | 269K | |
| Camden_County_Man_Ad..> | 2024-10-04 11:53 | 105K | |
| Camden_County_Man_Ch..> | 2024-10-04 11:53 | 261K | |
| Camden_County_Woman_..> | 2024-10-04 11:53 | 271K | |
| Cameroonian National..> | 2024-10-04 11:53 | 184K | |
| Camp_Hill_Attorney_S..> | 2024-10-04 11:53 | 263K | |
| Canadian resident se..> | 2024-10-04 11:53 | 454K | |
| Cape Girardeau Count..> | 2024-10-04 11:53 | 34K | |
| Capitol Heights Man ..> | 2024-10-04 11:53 | 80K | |
| Capitol Heights Post..> | 2024-10-04 11:53 | 27K | |
| Capt_Phips_Seafood_S..> | 2024-10-04 11:53 | 196K | |
| Captain_Phips_Seafoo..> | 2024-10-04 11:53 | 156K | |
| Cardinal Lawn and La..> | 2024-10-04 11:53 | 125K | |
| Career_Coach_Pleads_..> | 2024-10-04 11:53 | 93K | |
| Castellano Press Rel..> | 2024-10-04 11:53 | 58K | |
| Castlewood_man_Sente..> | 2024-10-04 11:53 | 104K | |
| Castro Valley Reside..> | 2024-10-04 11:53 | 167K | |
| Castro_Valley_Reside..> | 2024-10-04 11:53 | 109K | |
| Center Line Resident..> | 2024-10-04 11:53 | 82K | |
| Chambersburg Man Ind..> | 2024-10-04 11:53 | 52K | |
| Champaign Roofer Cha..> | 2024-10-04 11:53 | 47K | |
| Charges Allege Two I..> | 2024-10-04 11:53 | 49K | |
| Charleston Doctor Pl..> | 2024-10-04 11:53 | 108K | |
| Charleston Restauran..> | 2024-10-04 11:53 | 76K | |
| Charlestown_Man_Plea..> | 2024-10-04 11:53 | 138K | |
| Charlestown_Man_Sent..> | 2024-10-04 11:53 | 268K | |
| Charlotte_Man_Convic..> | 2024-10-04 11:53 | 89K | |
| Charlotte_Man_Is_Cha..> | 2024-10-04 11:53 | 93K | |
| Charlotte_Man_USAO_W..> | 2024-10-04 11:53 | 142K | |
| Chester_County_Man_S..> | 2024-10-04 11:53 | 108K | |
| Chester_County_Man_S..> | 2024-10-04 11:53 | 267K | |
| Chester_County_Woman..> | 2024-10-04 11:53 | 268K | |
| Chicago Dermatologis..> | 2024-10-04 11:53 | 45K | |
| Chicago Man Indicted..> | 2024-10-04 11:53 | 78K | |
| Chicago Man Sentence..> | 2024-10-04 11:53 | 487K | |
| Chicago_Man_Convicte..> | 2024-10-04 11:53 | 127K | |
| Chiropractor Pleads ..> | 2024-10-04 11:53 | 18K | |
| Chiropractor Pleads ..> | 2024-10-04 11:53 | 51K | |
| Chiropractor_CD_CA_R..> | 2024-10-04 11:53 | 115K | |
| Christina Marie Weig..> | 2024-10-04 11:53 | 161K | |
| Cicero_Woman_Pleads_..> | 2024-10-04 11:53 | 253K | |
| Cincinnati healthcar..> | 2024-10-04 11:53 | 507K | |
| Cincinnati man sente..> | 2024-10-04 11:53 | 487K | |
| Cinelli Craig and Ci..> | 2024-10-04 11:53 | 43K | |
| Citizen Of Dominican..> | 2024-10-04 11:53 | 158K | |
| Citrus Heights Coupl..> | 2024-10-04 11:53 | 122K | |
| City of Miami Reside..> | 2024-10-04 11:53 | 88K | |
| Cleaning Company Own..> | 2024-10-04 11:53 | 33K | |
| Clermont County woma..> | 2024-10-04 11:53 | 157K | |
| Cleveland Heights ma..> | 2024-10-04 11:53 | 42K | |
| Clinic owner and UPS..> | 2024-10-04 11:53 | 21K | |
| Clinic_owner_sentenc..> | 2024-10-04 11:53 | 82K | |
| Clinton Man Pleads G..> | 2024-10-04 11:53 | 160K | |
| Clinton_Fitchburg_Ma..> | 2024-10-04 11:53 | 254K | |
| Coleman news release..> | 2024-10-04 11:53 | 79K | |
| College_Football_Pla..> | 2024-10-04 11:53 | 105K | |
| Collin County Man Co..> | 2024-10-04 11:53 | 18K | |
| Collin_County_Man_In..> | 2024-10-04 11:53 | 260K | |
| Colonie Man Pleads G..> | 2024-10-04 11:53 | 493K | |
| ColumbiaHeights_Rest..> | 2024-10-04 11:53 | 278K | |
| Columbus_man_charged..> | 2024-10-04 11:53 | 122K | |
| Commercial Construct..> | 2024-10-04 11:53 | 26K | |
| Company Owner Pleads..> | 2024-10-04 11:53 | 111K | |
| Company Owner and Bo..> | 2024-10-04 11:53 | 146K | |
| Company_Owner_Pleads..> | 2024-10-04 11:53 | 79K | |
| Company_Owner_Pleads..> | 2024-10-04 11:53 | 79K | |
| Company_owners_admit..> | 2024-10-04 11:53 | 83K | |
| Compound King and Tw..> | 2024-10-04 11:53 | 47K | |
| Congressman George S..> | 2024-10-04 11:53 | 199K | |
| Connecticut Man Foun..> | 2024-10-04 11:53 | 66K | |
| Conspirators Sentenc..> | 2024-10-04 11:53 | 92K | |
| Construction Company..> | 2024-10-04 11:53 | 54K | |
| Construction_Company..> | 2024-10-04 11:53 | 160K | |
| Contractor Charged w..> | 2024-10-04 11:53 | 122K | |
| Contractor_Pleads_Gu..> | 2024-10-04 11:53 | 257K | |
| Contractor_Sentenced..> | 2024-10-04 11:53 | 78K | |
| Contractor_Who_Lied_..> | 2024-10-04 11:53 | 260K | |
| Contruction_Company_..> | 2024-10-04 11:53 | 211K | |
| Convicted Felon Plea..> | 2024-10-04 11:53 | 80K | |
| Convicted Felon Sent..> | 2024-10-04 11:53 | 491K | |
| Convicted Murderer W..> | 2024-10-04 11:53 | 166K | |
| Cook County Man Sent..> | 2024-10-04 11:53 | 97K | |
| Corapeake Woman Plea..> | 2024-10-04 11:53 | 71K | |
| Corona Man Sentenced..> | 2024-10-04 11:53 | 502K | |
| Coronavirus Fraud Ta..> | 2024-10-04 11:53 | 301K | |
| Corporation and Thre..> | 2024-10-04 11:53 | 43K | |
| Couple Indicted For ..> | 2024-10-04 11:53 | 101K | |
| Couple Indicted for ..> | 2024-10-04 11:53 | 138K | |
| Couple Pleads Guilty..> | 2024-10-04 11:53 | 19K | |
| Couple_Indicted_PUA_..> | 2024-10-04 11:53 | 119K | |
| Couple charged with ..> | 2024-10-04 11:53 | 153K | |
| Court Enjoins Fraudu..> | 2024-10-04 11:53 | 89K | |
| Coventry Woman Admit..> | 2024-10-04 11:53 | 88K | |
| Cullerton news relea..> | 2024-10-04 11:53 | 80K | |
| D.A. Bragg Announces..> | 2024-10-04 11:53 | 206K | |
| D.C. Corrections Off..> | 2024-10-04 11:53 | 96K | |
| DA Charges Manslaugh..> | 2024-10-04 11:53 | 51K | |
| DNJ_OSHA.pdf | 2024-10-04 11:53 | 104K | |
| DOCTORS CONVICTED IN..> | 2024-10-04 11:53 | 39K | |
| DOJ_Announces_COVID-..> | 2024-10-04 11:53 | 117K | |
| DOJ_Announces_Direct..> | 2024-10-04 11:53 | 184K | |
| DOJ_Announces_Nation..> | 2024-10-04 11:53 | 139K | |
| DOJ_Combatting_Pande..> | 2024-10-04 11:53 | 294K | |
| DOJ_Warns_Fake_Unemp..> | 2024-10-04 11:53 | 261K | |
| DOL-OIG Pandemic Wor..> | 2024-10-04 11:53 | 176K | |
| DOL OIG Investigativ..> | 2024-10-04 11:53 | 1.8M | |
| D_MA_Lawrence.pdf | 2024-10-04 11:53 | 99K | |
| D_MA_Release.pdf | 2024-10-04 11:53 | 97K | |
| D_MA_UI.pdf | 2024-10-04 11:53 | 111K | |
| D_MD_Indictment_Rele..> | 2024-10-04 11:53 | 92K | |
| D_NJ_Release.pdf | 2024-10-04 11:53 | 100K | |
| D_NJ_Release_2.pdf | 2024-10-04 11:53 | 99K | |
| D_NV_Guilty_Plea_UI.pdf | 2024-10-04 11:53 | 79K | |
| D_RI_CARES.pdf | 2024-10-04 11:53 | 115K | |
| D_WV_UI_Scheme.pdf | 2024-10-04 11:53 | 103K | |
| Dallas Attorney Sent..> | 2024-10-04 11:53 | 47K | |
| Dallas Attorney and ..> | 2024-10-04 11:53 | 46K | |
| Dallas_Woman_Pleads_..> | 2024-10-04 11:53 | 162K | |
| Dana Adkins Sentence..> | 2024-10-04 11:53 | 128K | |
| Dayton Technology St..> | 2024-10-04 11:53 | 229K | |
| DeAlmeida Lino Plea ..> | 2024-10-04 11:53 | 33K | |
| DePiro Stephen Sente..> | 2024-10-04 11:53 | 33K | |
| Debt Collection Outf..> | 2024-10-04 11:53 | 87K | |
| Decatur_Woman_Senten..> | 2024-10-04 11:53 | 255K | |
| Defendant Originally..> | 2024-10-04 11:53 | 85K | |
| Defendant Sentenced ..> | 2024-10-04 11:53 | 99K | |
| Defendant_Charged_1...> | 2024-10-04 11:53 | 273K | |
| Defendant_Charged_In..> | 2024-10-04 11:53 | 97K | |
| Defendants Charged.pdf | 2024-10-04 11:53 | 294K | |
| Defendants Sentenced..> | 2024-10-04 11:53 | 497K | |
| Defendants Sentenced..> | 2024-10-04 11:53 | 49K | |
| Defendants_Charged_M..> | 2024-10-04 11:53 | 122K | |
| Defendants_Charged_M..> | 2024-10-04 11:53 | 115K | |
| Delaware Man Pleads ..> | 2024-10-04 11:53 | 150K | |
| Delaware Man Sentenc..> | 2024-10-04 11:53 | 152K | |
| Dental Practice Owne..> | 2024-10-04 11:53 | 315K | |
| Department Of Labor ..> | 2024-10-04 11:53 | 140K | |
| Department of Justic..> | 2024-10-04 11:53 | 142K | |
| Department of Labor ..> | 2024-10-04 11:53 | 85K | |
| Detroit Man Sentence..> | 2024-10-04 11:53 | 101K | |
| Detroit Man_Pleads_G..> | 2024-10-04 11:53 | 166K | |
| Detroit_Man_Convicte..> | 2024-10-04 11:53 | 80K | |
| Detroit_Man_Pleads_G..> | 2024-10-04 11:53 | 70K | |
| Detroit_Man_Sentence..> | 2024-10-04 11:53 | 103K | |
| Detroit_Resident_Ple..> | 2024-10-04 11:53 | 159K | |
| Diagnostic Company O..> | 2024-10-04 11:53 | 20K | |
| Disputanta Tax Retur..> | 2024-10-04 11:53 | 161K | |
| District_Judge_Enter..> | 2024-10-04 11:53 | 109K | |
| Doctor And Three Oth..> | 2024-10-04 11:53 | 122K | |
| Doctor Sentenced for..> | 2024-10-04 11:53 | 93K | |
| Doctor Sentenced to ..> | 2024-10-04 11:53 | 35K | |
| Doctor_Admits_Crimin..> | 2024-10-04 11:53 | 105K | |
| Doctor and Office Ma..> | 2024-10-04 11:53 | 114K | |
| Doctor_Admits_Health..> | 2024-10-04 11:53 | 107K | |
| Doctor_Pleads_Guilty..> | 2024-10-04 11:53 | 287K | |
| Dodge_County_Strip_C..> | 2024-10-04 11:53 | 104K | |
| Dominican National S..> | 2024-10-04 11:53 | 139K | |
| Dominican National S..> | 2024-10-04 11:53 | 97K | |
| Dominican_National_A..> | 2024-10-04 11:53 | 265K | |
| Dominican_National_P..> | 2024-10-04 11:53 | 102K | |
| Dominican_National_P..> | 2024-10-04 11:53 | 79K | |
| Dominican_National_S..> | 2024-10-04 11:53 | 279K | |
| Dominican_National_S..> | 2024-10-04 11:53 | 79K | |
| Dominican_National_S..> | 2024-10-04 11:53 | 85K | |
| Donaldsonville_Woman..> | 2024-10-04 11:53 | 162K | |
| Dont_be_a_Mule_DOL_O..> | 2024-10-04 11:53 | 333K | |
| Dothan Woman Sentenc..> | 2024-10-04 11:53 | 83K | |
| Dover Businessman Se..> | 2024-10-04 11:53 | 169K | |
| Dozens sentenced for..> | 2024-10-04 11:53 | 209K | |
| Drug Trafficker Sent..> | 2024-10-04 11:53 | 316K | |
| Drug_Trafficker_Plea..> | 2024-10-04 11:53 | 167K | |
| Dudley Man Sentenced..> | 2024-10-04 11:53 | 495K | |
| Dudley_Man_Arrested_..> | 2024-10-04 11:53 | 99K | |
| Dudley_Man_Pleads_Gu..> | 2024-10-04 11:53 | 86K | |
| EDD_Crackdown_072020..> | 2024-10-04 11:53 | 204K | |
| EDMI_Williams.pdf | 2024-10-04 11:53 | 113K | |
| EDPA_Prison_PUA.pdf | 2024-10-04 11:53 | 130K | |
| EDVA Takes Action Ag..> | 2024-10-04 11:53 | 160K | |
| EDVA_Takes_Action_Ag..> | 2024-10-04 11:53 | 175K | |
| ED_CA_UI_Inmates.pdf | 2024-10-04 11:53 | 205K | |
| ED_MI_UAW.pdf | 2024-10-04 11:53 | 248K | |
| ED_MI_UI_Indicted.pdf | 2024-10-04 11:53 | 104K | |
| ED_MI_UI_Scam-082520..> | 2024-10-04 11:53 | 258K | |
| ED_NY_Ho_Nguyen.pdf | 2024-10-04 11:53 | 76K | |
| ED_PA_PUA_Arrests.pdf | 2024-10-04 11:53 | 221K | |
| East Windsor Woman C..> | 2024-10-04 11:53 | 34K | |
| East_Chicago_Woman_C..> | 2024-10-04 11:53 | 101K | |
| East_St_Louis_Woman_..> | 2024-10-04 11:53 | 164K | |
| Eight Arrested in Mu..> | 2024-10-04 11:53 | 161K | |
| Eight Dallas-Area Ph..> | 2024-10-04 11:53 | 682K | |
| Eight Former State E..> | 2024-10-04 11:53 | 111K | |
| Eight_Crips_Gang_Mem..> | 2024-10-04 11:53 | 179K | |
| Eight_Individuals_Ch..> | 2024-10-04 11:53 | 146K | |
| Eight charged locall..> | 2024-10-04 11:53 | 613K | |
| ElHadik_plea_AUS.pdf | 2024-10-04 11:53 | 101K | |
| Electrical Contracto..> | 2024-10-04 11:53 | 98K | |
| Electrostim Medical ..> | 2024-10-04 11:53 | 109K | |
| Eleven Charged in Do..> | 2024-10-04 11:53 | 159K | |
| Eleven_Defendants_Fa..> | 2024-10-04 11:53 | 106K | |
| Elizabeth Honig Plea..> | 2024-10-04 11:53 | 35K | |
| Erron Strachan Arres..> | 2024-10-04 11:53 | 42K | |
| Essex County Man Cha..> | 2024-10-04 11:53 | 160K | |
| Essex_County_Man_Adm..> | 2024-10-04 11:53 | 87K | |
| Essex_County_Man_Sen..> | 2024-10-04 11:53 | 105K | |
| Evelyn Blevins Sente..> | 2024-10-04 11:53 | 89K | |
| Everett Man Pleads G..> | 2024-10-04 11:53 | 100K | |
| Everett Man Sentence..> | 2024-10-04 11:53 | 99K | |
| Ex-Husband Of ‘Rea..> | 2024-10-04 11:53 | 495K | |
| Ex-Labor_Leader_Char..> | 2024-10-04 11:53 | 116K | |
| Ex Siu-E Employee Pl..> | 2024-10-04 11:53 | 19K | |
| Executives Surgeons ..> | 2024-10-04 11:53 | 73K | |
| FCA_Pleads_Guilty_To..> | 2024-10-04 11:53 | 96K | |
| FCA_US_LLC_Charged_f..> | 2024-10-04 11:53 | 102K | |
| FCA_US_LLC_Sentenced..> | 2024-10-04 11:53 | 360K | |
| FDLE arrests man in ..> | 2024-10-04 11:53 | 41K | |
| FIRST DEFENDANT SENT..> | 2024-10-04 11:53 | 78K | |
| FL_Business_Exec_Cha..> | 2024-10-04 11:53 | 81K | |
| FL_Man_Sentenced_COV..> | 2024-10-04 11:53 | 105K | |
| FL_Power_Company_Ple..> | 2024-10-04 11:53 | 83K | |
| FL_Power_Company_Sen..> | 2024-10-04 11:53 | 156K | |
| FL_Woman_Pleads_Guil..> | 2024-10-04 11:53 | 127K | |
| FORMER BUSINESS MANA..> | 2024-10-04 11:53 | 33K | |
| FORMER EDD EMPLOYEE ..> | 2024-10-04 11:53 | 94K | |
| FOUR_DEFENDANTS_CHAR..> | 2024-10-04 11:53 | 218K | |
| Fairfield County Hed..> | 2024-10-04 11:53 | 103K | |
| Fairhope_Man_Pleads_..> | 2024-10-04 11:53 | 258K | |
| Farmington_Hills_Res..> | 2024-10-04 11:53 | 261K | |
| Father And Son Owner..> | 2024-10-04 11:53 | 86K | |
| Father_and_Son_Owner..> | 2024-10-04 11:53 | 82K | |
| Father and Son Brook..> | 2024-10-04 11:53 | 108K | |
| Fayette County Auto ..> | 2024-10-04 11:53 | 488K | |
| Fayette County Auto ..> | 2024-10-04 11:53 | 489K | |
| Fed_Grand_Jury_Indic..> | 2024-10-04 11:53 | 160K | |
| Federal Grand Jury I..> | 2024-10-04 11:53 | 514K | |
| Federal Grand Jury I..> | 2024-10-04 11:53 | 54K | |
| Federal Grand Jury I..> | 2024-10-04 11:53 | 20K | |
| Federal Grand Jury I..> | 2024-10-04 11:53 | 22K | |
| Federal Grant Fraud ..> | 2024-10-04 11:53 | 32K | |
| Federal Indictment C..> | 2024-10-04 11:53 | 107K | |
| Federal Jury Convict..> | 2024-10-04 11:53 | 331K | |
| Federal Jury Convict..> | 2024-10-04 11:53 | 48K | |
| Federal Jury Convict..> | 2024-10-04 11:53 | 28K | |
| Federal_Criminal_Civ..> | 2024-10-04 11:53 | 126K | |
| Federal_Health_Care_..> | 2024-10-04 11:53 | 263K | |
| Federal_Inmate_Plead..> | 2024-10-04 11:53 | 263K | |
| Federal_Safety_and_H..> | 2024-10-04 11:53 | 89K | |
| Federal grand jury i..> | 2024-10-04 11:53 | 488K | |
| Feds_Charge_19_Defen..> | 2024-10-04 11:53 | 297K | |
| Fiat Chryslers Forme..> | 2024-10-04 11:53 | 29K | |
| Fifteen People Sente..> | 2024-10-04 11:53 | 150K | |
| Final Co-Conspirator..> | 2024-10-04 11:53 | 163K | |
| Final_Two_Defendants..> | 2024-10-04 11:53 | 168K | |
| Financial Management..> | 2024-10-04 11:53 | 41K | |
| Financial_Secretary-..> | 2024-10-04 11:53 | 102K | |
| Fink_Nagle 12.1.16.pdf | 2024-10-04 11:53 | 35K | |
| First_Defendant_in_2..> | 2024-10-04 11:53 | 257K | |
| Five Cleveland-Area ..> | 2024-10-04 11:53 | 139K | |
| Five Defendants Arre..> | 2024-10-04 11:53 | 601K | |
| Five Defendants Sent..> | 2024-10-04 11:53 | 159K | |
| Five Indiana Kentuck..> | 2024-10-04 11:53 | 23K | |
| Five Individuals, In..> | 2024-10-04 11:53 | 63K | |
| Five Individuals Cha..> | 2024-10-04 11:53 | 171K | |
| Five People Charged ..> | 2024-10-04 11:53 | 104K | |
| Five_Plead_Guilty_to..> | 2024-10-04 11:53 | 87K | |
| Floral Company Pays ..> | 2024-10-04 11:53 | 96K | |
| Florida Business Own..> | 2024-10-04 11:53 | 55K | |
| Florida Man Admits t..> | 2024-10-04 11:53 | 163K | |
| Florida Man Facing F..> | 2024-10-04 11:53 | 541K | |
| Florida Man Pleads G..> | 2024-10-04 11:53 | 107K | |
| Florida Man Sentence..> | 2024-10-04 11:53 | 84K | |
| Florida Man Sentence..> | 2024-10-04 11:53 | 106K | |
| Florida Man Sentence..> | 2024-10-04 11:53 | 577K | |
| Florida Man Sentence..> | 2024-10-04 11:53 | 97K | |
| FloridaWomanSentence..> | 2024-10-04 11:53 | 21K | |
| Florida_Man_Charged_..> | 2024-10-04 11:53 | 267K | |
| Florida_Man_Pleads_G..> | 2024-10-04 11:53 | 84K | |
| Florida_Man_Pleads_G..> | 2024-10-04 11:53 | 298K | |
| Florida_Man_Who_Stol..> | 2024-10-04 11:53 | 318K | |
| Fomer_LA_Woman_Indic..> | 2024-10-04 11:53 | 93K | |
| Foreign National Cha..> | 2024-10-04 11:53 | 159K | |
| Foreign National Ext..> | 2024-10-04 11:53 | 142K | |
| Foreign National Ple..> | 2024-10-04 11:53 | 133K | |
| Foreign National Sen..> | 2024-10-04 11:53 | 490K | |
| Foreign National Sen..> | 2024-10-04 11:53 | 187K | |
| Foreign_National_Sen..> | 2024-10-04 11:53 | 125K | |
| Former 6-10 Construc..> | 2024-10-04 11:53 | 88K | |
| Former AFLAC Employe..> | 2024-10-04 11:53 | 20K | |
| Former Acting Execut..> | 2024-10-04 11:53 | 76K | |
| Former Advanced Prac..> | 2024-10-04 11:53 | 141K | |
| Former Amtrak Employ..> | 2024-10-04 11:53 | 294K | |
| Former Arizona Man P..> | 2024-10-04 11:53 | 166K | |
| Former Arizona Man S..> | 2024-10-04 11:53 | 134K | |
| Former Arizona Offic..> | 2024-10-04 11:53 | 86K | |
| Former Arkansas Lawm..> | 2024-10-04 11:53 | 56K | |
| Former Atlanta Regio..> | 2024-10-04 11:53 | 104K | |
| Former Atlantic City..> | 2024-10-04 11:53 | 142K | |
| Former Baltimore May..> | 2024-10-04 11:53 | 140K | |
| Former Boss of Opera..> | 2024-10-04 11:53 | 50K | |
| Former Buffalo Man P..> | 2024-10-04 11:53 | 160K | |
| Former Bureau Of Pri..> | 2024-10-04 11:53 | 195K | |
| Former Bureau Of Pri..> | 2024-10-04 11:53 | 110K | |
| Former Bureau Of Pri..> | 2024-10-04 11:53 | 149K | |
| Former Business Mana..> | 2024-10-04 11:53 | 18K | |
| Former Business Mana..> | 2024-10-04 11:53 | 37K | |
| Former CEO of Los An..> | 2024-10-04 11:53 | 97K | |
| Former CEO of Tennes..> | 2024-10-04 11:53 | 48K | |
| Former Carpenters’..> | 2024-10-04 11:53 | 85K | |
| Former Carpenters Be..> | 2024-10-04 11:53 | 102K | |
| Former Cashier at VA..> | 2024-10-04 11:53 | 491K | |
| Former Charity Execu..> | 2024-10-04 11:53 | 47K | |
| Former Charity Execu..> | 2024-10-04 11:53 | 48K | |
| Former Charleston Jo..> | 2024-10-04 11:53 | 18K | |
| Former Charleston Jo..> | 2024-10-04 11:53 | 18K | |
| Former Cheyenne Wyom..> | 2024-10-04 11:53 | 85K | |
| Former Claims Examin..> | 2024-10-04 11:53 | 90K | |
| Former College Footb..> | 2024-10-04 11:53 | 506K | |
| Former Congressman G..> | 2024-10-04 11:53 | 117K | |
| Former Contractor fo..> | 2024-10-04 11:53 | 164K | |
| Former Copley man se..> | 2024-10-04 11:53 | 38K | |
| Former Department Of..> | 2024-10-04 11:53 | 161K | |
| Former Detroit City ..> | 2024-10-04 11:53 | 47K | |
| Former EDD Employee ..> | 2024-10-04 11:53 | 124K | |
| Former Edd Employee ..> | 2024-10-04 11:53 | 163K | |
| Former Employee Of T..> | 2024-10-04 11:53 | 58K | |
| Former Employee of T..> | 2024-10-04 11:53 | 159K | |
| Former Employee of T..> | 2024-10-04 11:53 | 136K | |
| Former Employees Of ..> | 2024-10-04 11:53 | 65K | |
| Former Executive Dir..> | 2024-10-04 11:53 | 164K | |
| Former Executive Dir..> | 2024-10-04 11:53 | 107K | |
| Former Executive wit..> | 2024-10-04 11:53 | 36K | |
| Former FCA Executive..> | 2024-10-04 11:53 | 243K | |
| Former FCA Executive..> | 2024-10-04 11:53 | 30K | |
| Former Facilities Ma..> | 2024-10-04 11:53 | 23K | |
| Former Facilities Ma..> | 2024-10-04 11:53 | 45K | |
| Former Farm Foreman ..> | 2024-10-04 11:53 | 108K | |
| Former Federal Emplo..> | 2024-10-04 11:53 | 175K | |
| Former Felon Sentenc..> | 2024-10-04 11:53 | 18K | |
| Former Gary Firefigh..> | 2024-10-04 11:53 | 17K | |
| Former Hollywood-Bas..> | 2024-10-04 11:53 | 499K | |
| Former Inland Empire..> | 2024-10-04 11:53 | 499K | |
| Former International..> | 2024-10-04 11:53 | 116K | |
| Former Ironworkers B..> | 2024-10-04 11:53 | 133K | |
| Former Labor Departm..> | 2024-10-04 11:53 | 65K | |
| Former Labor Union P..> | 2024-10-04 11:53 | 143K | |
| Former Labor Union P..> | 2024-10-04 11:53 | 85K | |
| Former Labor Union P..> | 2024-10-04 11:53 | 159K | |
| Former Letter Carrie..> | 2024-10-04 11:53 | 70K | |
| Former Lexington Res..> | 2024-10-04 11:53 | 41K | |
| Former Local 17.pdf | 2024-10-04 11:53 | 38K | |
| Former Local 98 Busi..> | 2024-10-04 11:53 | 92K | |
| Former Local 98 Pres..> | 2024-10-04 11:53 | 501K | |
| Former Mail Carrier ..> | 2024-10-04 11:53 | 100K | |
| Former Manager Of In..> | 2024-10-04 11:53 | 95K | |
| Former Manager of Lo..> | 2024-10-04 11:53 | 89K | |
| Former Massachusetts..> | 2024-10-04 11:53 | 581K | |
| Former Massachusetts..> | 2024-10-04 11:53 | 118K | |
| Former Medical Assis..> | 2024-10-04 11:53 | 131K | |
| Former Medical Pract..> | 2024-10-04 11:53 | 82K | |
| Former Meriden Resid..> | 2024-10-04 11:53 | 42K | |
| Former Missouri Stat..> | 2024-10-04 11:53 | 134K | |
| Former Newark Restau..> | 2024-10-04 11:53 | 158K | |
| Former Owner Of Spri..> | 2024-10-04 11:53 | 43K | |
| Former Owner and Man..> | 2024-10-04 11:53 | 58K | |
| Former Owner of Long..> | 2024-10-04 11:53 | 43K | |
| Former Pharmaceutica..> | 2024-10-04 11:53 | 141K | |
| Former Pharmacy Empl..> | 2024-10-04 11:53 | 107K | |
| Former Postal Employ..> | 2024-10-04 11:53 | 26K | |
| Former Postal Employ..> | 2024-10-04 11:53 | 263K | |
| Former Postal Employ..> | 2024-10-04 11:53 | 102K | |
| Former Postal Worker..> | 2024-10-04 11:53 | 56K | |
| Former President Of ..> | 2024-10-04 11:53 | 108K | |
| Former President Of ..> | 2024-10-04 11:53 | 105K | |
| Former President Of ..> | 2024-10-04 11:53 | 108K | |
| Former President of ..> | 2024-10-04 11:53 | 45K | |
| Former President of ..> | 2024-10-04 11:53 | 102K | |
| Former President of ..> | 2024-10-04 11:53 | 42K | |
| Former President of ..> | 2024-10-04 11:53 | 62K | |
| Former President of ..> | 2024-10-04 11:53 | 60K | |
| Former SBA Employee ..> | 2024-10-04 11:53 | 101K | |
| Former Sacramento Re..> | 2024-10-04 11:53 | 139K | |
| Former Senior UAW Of..> | 2024-10-04 11:53 | 48K | |
| Former Senior UAW Of..> | 2024-10-04 11:53 | 46K | |
| Former Senior UAW Of..> | 2024-10-04 11:53 | 248K | |
| Former Senior UAW Of..> | 2024-10-04 11:53 | 114K | |
| Former Senior VP Of ..> | 2024-10-04 11:53 | 43K | |
| Former Social Securi..> | 2024-10-04 11:53 | 490K | |
| Former State Contrac..> | 2024-10-04 11:53 | 127K | |
| Former State Employe..> | 2024-10-04 11:53 | 66K | |
| Former State Employe..> | 2024-10-04 11:53 | 135K | |
| Former State Employe..> | 2024-10-04 11:53 | 59K | |
| Former State Senator..> | 2024-10-04 11:53 | 115K | |
| Former Stockton Woma..> | 2024-10-04 11:53 | 22K | |
| Former Tax Preparer ..> | 2024-10-04 11:53 | 490K | |
| Former Tax Preparer ..> | 2024-10-04 11:53 | 56K | |
| Former Teamster Conv..> | 2024-10-04 11:53 | 184K | |
| Former Teamster Lead..> | 2024-10-04 11:53 | 135K | |
| Former Thornton Woma..> | 2024-10-04 11:53 | 23K | |
| Former Treasurer of ..> | 2024-10-04 11:53 | 52K | |
| Former UAW Midwest C..> | 2024-10-04 11:53 | 117K | |
| Former UAW Official ..> | 2024-10-04 11:53 | 25K | |
| Former UAW Official ..> | 2024-10-04 11:53 | 46K | |
| Former UAW Official ..> | 2024-10-04 11:53 | 47K | |
| Former UAW Vice Pres..> | 2024-10-04 11:53 | 114K | |
| Former UAW Vice Pres..> | 2024-10-04 11:53 | 112K | |
| Former Union Officer..> | 2024-10-04 11:53 | 43K | |
| Former Union Officer..> | 2024-10-04 11:53 | 86K | |
| Former Union Officia..> | 2024-10-04 11:53 | 100K | |
| Former Union Officia..> | 2024-10-04 11:53 | 30K | |
| Former Union Officia..> | 2024-10-04 11:53 | 42K | |
| Former Union Preside..> | 2024-10-04 11:53 | 164K | |
| Former Union Preside..> | 2024-10-04 11:53 | 503K | |
| Former Union Treasur..> | 2024-10-04 11:53 | 163K | |
| Former Vice Presiden..> | 2024-10-04 11:53 | 105K | |
| Former Worksource De..> | 2024-10-04 11:53 | 23K | |
| Former director of C..> | 2024-10-04 11:53 | 22K | |
| Former political can..> | 2024-10-04 11:53 | 24K | |
| Former-Union_Officer..> | 2024-10-04 11:53 | 85K | |
| Former_AR_State_Sena..> | 2024-10-04 11:53 | 159K | |
| Former_AR_State_Sena..> | 2024-10-04 11:53 | 141K | |
| Former_Air_Force_Emp..> | 2024-10-04 11:53 | 100K | |
| Former_Amtrak_Employ..> | 2024-10-04 11:53 | 272K | |
| Former_Bath_Iron_Wor..> | 2024-10-04 11:53 | 99K | |
| Former_Branch_Manage..> | 2024-10-04 11:53 | 101K | |
| Former_Buffalo_Man_P..> | 2024-10-04 11:53 | 263K | |
| Former_COO_Global_Pr..> | 2024-10-04 11:53 | 258K | |
| Former_COO_Global_Pr..> | 2024-10-04 11:53 | 84K | |
| Former_Carpenters’..> | 2024-10-04 11:53 | 265K | |
| Former_Chiropractor_..> | 2024-10-04 11:53 | 115K | |
| Former_Chiropractor_..> | 2024-10-04 11:53 | 116K | |
| Former_Claims_Manage..> | 2024-10-04 11:53 | 86K | |
| Former_Claims_Manage..> | 2024-10-04 11:53 | 265K | |
| Former_Department_of..> | 2024-10-04 11:53 | 278K | |
| Former_Department_of..> | 2024-10-04 11:53 | 260K | |
| Former_Dept_of_Unemp..> | 2024-10-04 11:53 | 107K | |
| Former_Detroit_Polic..> | 2024-10-04 11:53 | 84K | |
| Former_ESD_Employee_..> | 2024-10-04 11:53 | 111K | |
| Former_Employee_Yout..> | 2024-10-04 11:53 | 100K | |
| Former_Executive_Dir..> | 2024-10-04 11:53 | 292K | |
| Former_Federal_Emplo..> | 2024-10-04 11:53 | 266K | |
| Former_Federal_Inmat..> | 2024-10-04 11:53 | 269K | |
| Former_Fin_Sec-Treas..> | 2024-10-04 11:53 | 115K | |
| Former_HR_Manager_Se..> | 2024-10-04 11:53 | 165K | |
| Former_IL_State_Sen_..> | 2024-10-04 11:53 | 103K | |
| Former_Illinois_Stat..> | 2024-10-04 11:53 | 101K | |
| Former_Jersey_City_B..> | 2024-10-04 11:53 | 163K | |
| Former_Local_Union_V..> | 2024-10-04 11:53 | 107K | |
| Former_Local_Union_V..> | 2024-10-04 11:53 | 266K | |
| Former_Louisiana_Wom..> | 2024-10-04 11:53 | 167K | |
| Former_MO_HealthCare..> | 2024-10-04 11:53 | 157K | |
| Former_NYC_Dept_of_B..> | 2024-10-04 11:53 | 104K | |
| Former_NYPD_Sergeant..> | 2024-10-04 11:53 | 107K | |
| Former_New_Bedford_M..> | 2024-10-04 11:53 | 107K | |
| Former_New_Bedford_M..> | 2024-10-04 11:53 | 91K | |
| Former_Nomura_RMBS_T..> | 2024-10-04 11:53 | 255K | |
| Former_PR_Sen_Former..> | 2024-10-04 11:53 | 104K | |
| Former_Philadelphia_..> | 2024-10-04 11:53 | 86K | |
| Former_Postal_Employ..> | 2024-10-04 11:53 | 80K | |
| Former_Postal_Employ..> | 2024-10-04 11:53 | 100K | |
| Former_Postal_Servic..> | 2024-10-04 11:53 | 293K | |
| Former_Rogers_Compan..> | 2024-10-04 11:53 | 92K | |
| Former_Rogers_Compan..> | 2024-10-04 11:53 | 107K | |
| Former_SUNY_Delhi_St..> | 2024-10-04 11:53 | 82K | |
| Former_SUNY_Student_..> | 2024-10-04 11:53 | 102K | |
| Former_Sacramento_Re..> | 2024-10-04 11:53 | 200K | |
| Former_State_Contrac..> | 2024-10-04 11:53 | 161K | |
| Former_State_Employe..> | 2024-10-04 11:53 | 256K | |
| Former_State_Employe..> | 2024-10-04 11:53 | 269K | |
| Former_State_Employe..> | 2024-10-04 11:53 | 110K | |
| Former_State_Employe..> | 2024-10-04 11:53 | 267K | |
| Former_State_Employe..> | 2024-10-04 11:53 | 112K | |
| Former_State_Unemplo..> | 2024-10-04 11:53 | 265K | |
| Former_Stockton_Man_..> | 2024-10-04 11:53 | 145K | |
| Former_Stockton_Man_..> | 2024-10-04 11:53 | 81K | |
| Former_Treasurer_of_..> | 2024-10-04 11:53 | 105K | |
| Former_Treasurer_of_..> | 2024-10-04 11:53 | 266K | |
| Former_UAW_Official_..> | 2024-10-04 11:53 | 276K | |
| Former_UAW_Official_..> | 2024-10-04 11:53 | 269K | |
| Former_UAW_President..> | 2024-10-04 11:53 | 119K | |
| Former_UAW_Regional_..> | 2024-10-04 11:53 | 98K | |
| Former_US_Postal_Ser..> | 2024-10-04 11:53 | 35K | |
| Former_US_Postal_Ser..> | 2024-10-04 11:53 | 185K | |
| Former_Union_Officia..> | 2024-10-04 11:53 | 257K | |
| Former_Union_Officia..> | 2024-10-04 11:53 | 165K | |
| Former_Union_Officia..> | 2024-10-04 11:53 | 98K | |
| Former_Union_Preside..> | 2024-10-04 11:53 | 258K | |
| Former_Union_VP_Indi..> | 2024-10-04 11:53 | 269K | |
| Former_Uniontown_Man..> | 2024-10-04 11:53 | 101K | |
| Former_WA_State_ESD_..> | 2024-10-04 11:53 | 113K | |
| Former_Washington_St..> | 2024-10-04 11:53 | 271K | |
| Former_Waterloo_Medi..> | 2024-10-04 11:53 | 110K | |
| Former_insurance_age..> | 2024-10-04 11:53 | 86K | |
| Former_insurance_age..> | 2024-10-04 11:53 | 134K | |
| Fort Smith Arms Deal..> | 2024-10-04 11:53 | 105K | |
| Fort_Smith_Arms_Deal..> | 2024-10-04 11:53 | 113K | |
| Founders_Boston_Nonp..> | 2024-10-04 11:53 | 112K | |
| Four Capital Region ..> | 2024-10-04 11:53 | 165K | |
| Four Defendants Sent..> | 2024-10-04 11:53 | 112K | |
| Four Defendants Sent..> | 2024-10-04 11:53 | 37K | |
| Four Health Care Pro..> | 2024-10-04 11:53 | 80K | |
| Four Honduran Nation..> | 2024-10-04 11:53 | 487K | |
| Four Indicted in Com..> | 2024-10-04 11:53 | 145K | |
| Four Indicted on Fed..> | 2024-10-04 11:53 | 76K | |
| Four Individuals Con..> | 2024-10-04 11:53 | 527K | |
| Four Men Charged in ..> | 2024-10-04 11:53 | 147K | |
| Four Men Convicted o..> | 2024-10-04 11:53 | 499K | |
| Four Miami Residents..> | 2024-10-04 11:53 | 143K | |
| Four South Florida R..> | 2024-10-04 11:53 | 111K | |
| Four_Charged_Labor_T..> | 2024-10-04 11:53 | 119K | |
| Four defendants plea..> | 2024-10-04 11:53 | 87K | |
| Four_Charlotte_Men_S..> | 2024-10-04 11:53 | 109K | |
| Four_Individuals_Cha..> | 2024-10-04 11:53 | 85K | |
| Four_Indv_Indicted_F..> | 2024-10-04 11:53 | 298K | |
| Four_MD_Residents_Fa..> | 2024-10-04 11:53 | 119K | |
| Four_People_Indicted..> | 2024-10-04 11:53 | 264K | |
| Four_People_Sentence..> | 2024-10-04 11:53 | 131K | |
| Four_Sentenced_Role_..> | 2024-10-04 11:53 | 108K | |
| Fourteen Defendants ..> | 2024-10-04 11:53 | 164K | |
| Fourteen Gang Member..> | 2024-10-04 11:53 | 295K | |
| Fourteen Gang Member..> | 2024-10-04 11:53 | 304K | |
| Fourteen Individuals..> | 2024-10-04 11:53 | 106K | |
| Fourth Defendant Ple..> | 2024-10-04 11:53 | 163K | |
| Fourth Defendant in ..> | 2024-10-04 11:53 | 113K | |
| Frank Giovinco Convi..> | 2024-10-04 11:53 | 162K | |
| Frankfort_Man_Senten..> | 2024-10-04 11:53 | 258K | |
| Fraudster Sentenced ..> | 2024-10-04 11:53 | 503K | |
| Fredericksburg Man P..> | 2024-10-04 11:53 | 296K | |
| Fresno_Woman_Sentenc..> | 2024-10-04 11:53 | 159K | |
| Fresno_Women_Charged..> | 2024-10-04 11:53 | 80K | |
| Fugitive_defendant_w..> | 2024-10-04 11:53 | 162K | |
| GA_Inmate_Sentenced_..> | 2024-10-04 11:53 | 160K | |
| GA_Man_Pleads_Guilty..> | 2024-10-04 11:53 | 107K | |
| GEORGIA MAN SENTENCE..> | 2024-10-04 11:53 | 49K | |
| Gainesville man plea..> | 2024-10-04 11:53 | 498K | |
| Gary_Jones_Guilty_Pl..> | 2024-10-04 11:53 | 118K | |
| Gayl Joshua Plea PR ..> | 2024-10-04 11:53 | 36K | |
| Gayl Joshua Sentenci..> | 2024-10-04 11:53 | 39K | |
| General Foreman At P..> | 2024-10-04 11:53 | 29K | |
| General Foreman At P..> | 2024-10-04 11:53 | 47K | |
| General_Contracting_..> | 2024-10-04 11:53 | 104K | |
| General_Contractor_A..> | 2024-10-04 11:53 | 273K | |
| General_Contractor_P..> | 2024-10-04 11:53 | 110K | |
| Georgia Man Admits U..> | 2024-10-04 11:53 | 45K | |
| Georgia Man Pleads G..> | 2024-10-04 11:53 | 89K | |
| Georgia Woman Admits..> | 2024-10-04 11:53 | 49K | |
| Georgia Woman Senten..> | 2024-10-04 11:53 | 118K | |
| Georgia Woman Senten..> | 2024-10-04 11:53 | 125K | |
| Georgia siblings sen..> | 2024-10-04 11:53 | 330K | |
| Georgia_Business_Own..> | 2024-10-04 11:53 | 266K | |
| Georgia_Man_Pleads_G..> | 2024-10-04 11:53 | 178K | |
| Georgia_Man_Sentence..> | 2024-10-04 11:53 | 302K | |
| Gloucester County Ma..> | 2024-10-04 11:53 | 262K | |
| Gloucester County Ma..> | 2024-10-04 11:53 | 130K | |
| Gordin news release ..> | 2024-10-04 11:53 | 78K | |
| Granada Hills Man Se..> | 2024-10-04 11:53 | 502K | |
| Grand Jury Returns I..> | 2024-10-04 11:53 | 275K | |
| Granite City Chiropr..> | 2024-10-04 11:53 | 86K | |
| Granite Press Releas..> | 2024-10-04 11:53 | 60K | |
| Gregerson Indictment..> | 2024-10-04 11:53 | 50K | |
| Gregorson sentencing..> | 2024-10-04 11:53 | 50K | |
| Grove City man sente..> | 2024-10-04 11:53 | 486K | |
| Guilty Plea in Schem..> | 2024-10-04 11:53 | 19K | |
| H-1B Tech Staffing C..> | 2024-10-04 11:53 | 20K | |
| HCFU news release on..> | 2024-10-04 11:53 | 83K | |
| HCF_Buchanan Sent_2_..> | 2024-10-04 11:53 | 35K | |
| HOT_SPRINGS_MAN_SENT..> | 2024-10-04 11:53 | 289K | |
| HSI Norfolk investig..> | 2024-10-04 11:53 | 242K | |
| HUSBAND AND WIFE IND..> | 2024-10-04 11:53 | 27K | |
| Hall Earl Trial_3_10..> | 2024-10-04 11:53 | 36K | |
| Hall Earl Trial_11_2..> | 2024-10-04 11:53 | 39K | |
| Hall_retrial_sent_6_..> | 2024-10-04 11:53 | 37K | |
| Hampton Man Indicted..> | 2024-10-04 11:53 | 137K | |
| Hampton Man Pleads G..> | 2024-10-04 11:53 | 497K | |
| Hampton_Gang_Member_..> | 2024-10-04 11:53 | 102K | |
| Hampton_Iowa_Woman_P..> | 2024-10-04 11:53 | 87K | |
| Hampton_Man_Pleads_G..> | 2024-10-04 11:53 | 103K | |
| Haney_Gray_sen_AUS_f..> | 2024-10-04 11:53 | 114K | |
| Haney_plea_AUS 12.14..> | 2024-10-04 11:53 | 102K | |
| Hartford Man Charged..> | 2024-10-04 11:53 | 488K | |
| Hartley Thomas Ind_1..> | 2024-10-04 11:53 | 34K | |
| HathawayWilliamKrist..> | 2024-10-04 11:53 | 36K | |
| HathawayWilliamKrist..> | 2024-10-04 11:53 | 36K | |
| Haverhill Man Arrest..> | 2024-10-04 11:53 | 85K | |
| Haverhill Man Indict..> | 2024-10-04 11:53 | 101K | |
| Hazleton_Man_Sentenc..> | 2024-10-04 11:53 | 91K | |
| Health Care Provider..> | 2024-10-04 11:53 | 68K | |
| Healthcare_Fraud_Set..> | 2024-10-04 11:53 | 475K | |
| Hearing Aid Dealer a..> | 2024-10-04 11:53 | 49K | |
| Heath Street Gang Me..> | 2024-10-04 11:53 | 511K | |
| Hedge Fund CFO Sente..> | 2024-10-04 11:53 | 47K | |
| Hedge Fund Executive..> | 2024-10-04 11:53 | 43K | |
| High Desert Woman Ch..> | 2024-10-04 11:53 | 27K | |
| Holland_Couple_Sente..> | 2024-10-04 11:53 | 83K | |
| Home_healthcare_comp..> | 2024-10-04 11:53 | 113K | |
| Honduran Man Pleads ..> | 2024-10-04 11:53 | 482K | |
| Honduran National Pl..> | 2024-10-04 11:53 | 119K | |
| Honduran National Pl..> | 2024-10-04 11:53 | 485K | |
| Hospital Employee Se..> | 2024-10-04 11:53 | 194K | |
| Hot_Springs_Man_Plea..> | 2024-10-04 11:53 | 287K | |
| Hot_Springs_Man_Plea..> | 2024-10-04 11:53 | 112K | |
| Hot_Springs_Man_Plea..> | 2024-10-04 11:53 | 263K | |
| Houma Man Indicted f..> | 2024-10-04 11:53 | 142K | |
| Houma Man Pleads Gui..> | 2024-10-04 11:53 | 493K | |
| Houma Man Sentenced ..> | 2024-10-04 11:53 | 107K | |
| Houston Pharmacist S..> | 2024-10-04 11:53 | 111K | |
| Houston Woman Charge..> | 2024-10-04 11:53 | 164K | |
| Houston Woman Pleads..> | 2024-10-04 11:53 | 499K | |
| Houston Woman Pleads..> | 2024-10-04 11:53 | 484K | |
| Houston Woman Senten..> | 2024-10-04 11:53 | 500K | |
| Houston_Pharmacist_S..> | 2024-10-04 11:53 | 258K | |
| Houston_area_residen..> | 2024-10-04 11:53 | 112K | |
| Houston_woman_charge..> | 2024-10-04 11:53 | 107K | |
| Hudson_County_Woman_..> | 2024-10-04 11:53 | 256K | |
| Hudson_Man_USAO_D-NJ..> | 2024-10-04 11:53 | 259K | |
| Human_Smuggling_forc..> | 2024-10-04 11:53 | 300K | |
| Hunter NP Press Rele..> | 2024-10-04 11:53 | 185K | |
| Husband and Wife Adm..> | 2024-10-04 11:53 | 53K | |
| Husband_Wife_Sentenc..> | 2024-10-04 11:53 | 90K | |
| Husband_and_Wife_Tea..> | 2024-10-04 11:53 | 115K | |
| Husband and Wife Fro..> | 2024-10-04 11:53 | 25K | |
| Husband and Wife Own..> | 2024-10-04 11:53 | 77K | |
| Husband and Wife Ple..> | 2024-10-04 11:53 | 511K | |
| Hyattsville Man Plea..> | 2024-10-04 11:53 | 109K | |
| Hyattsville_Man_Plea..> | 2024-10-04 11:53 | 127K | |
| Hyde Park Man Pleads..> | 2024-10-04 11:53 | 165K | |
| Hyde_Park_Man_Indict..> | 2024-10-04 11:53 | 88K | |
| ILWU Chiro Scam - Am..> | 2024-10-04 11:53 | 38K | |
| ILWU chiro scam - Go..> | 2024-10-04 11:53 | 61K | |
| IL_AG_UI_TaskForce.pdf | 2024-10-04 11:53 | 187K | |
| IL_Man_Sentenced_55_..> | 2024-10-04 11:53 | 103K | |
| INDICTMENT CHARGES 3..> | 2024-10-04 11:53 | 43K | |
| IN_Woman_Sentenced_2..> | 2024-10-04 11:53 | 101K | |
| IT Software Services..> | 2024-10-04 11:53 | 50K | |
| Identity Theft Ring ..> | 2024-10-04 11:53 | 19K | |
| Identity Thieves Sen..> | 2024-10-04 11:53 | 42K | |
| Illinois Man Admits ..> | 2024-10-04 11:53 | 44K | |
| Illinois Man Sentenc..> | 2024-10-04 11:53 | 132K | |
| Illinois Man Sentenc..> | 2024-10-04 11:53 | 105K | |
| Illinois_Man_Admits_..> | 2024-10-04 11:53 | 262K | |
| Illinois_Man_Charged..> | 2024-10-04 11:53 | 84K | |
| Immigration Attorney..> | 2024-10-04 11:53 | 90K | |
| Improper Payments Au..> | 2024-10-04 11:53 | 113K | |
| Improper Payments Au..> | 2024-10-04 11:53 | 131K | |
| Indian_Trail_Man_Ple..> | 2024-10-04 11:53 | 262K | |
| Indian_Trail_Man_Sen..> | 2024-10-04 11:53 | 109K | |
| Indictment Charges P..> | 2024-10-04 11:53 | 40K | |
| Individual Pleads Gu..> | 2024-10-04 11:53 | 157K | |
| Individual_Indicted_..> | 2024-10-04 11:53 | 296K | |
| Individual_Sentenced..> | 2024-10-04 11:53 | 129K | |
| Individuals_Charged_..> | 2024-10-04 11:53 | 188K | |
| Injured Workers Phar..> | 2024-10-04 11:53 | 169K | |
| Inland Empire Woman ..> | 2024-10-04 11:53 | 165K | |
| Inmate_Sentenced_to_..> | 2024-10-04 11:53 | 159K | |
| Inmate and Three Co-..> | 2024-10-04 11:53 | 291K | |
| International_Firear..> | 2024-10-04 11:53 | 162K | |
| Iowa Custom Cattle F..> | 2024-10-04 11:53 | 507K | |
| Iowa_Man_Sentenced_F..> | 2024-10-04 11:53 | 107K | |
| Iowa_Woman_Sentenced..> | 2024-10-04 11:53 | 273K | |
| Ironworkers Business..> | 2024-10-04 11:53 | 53K | |
| Israeli Owner of Mal..> | 2024-10-04 11:53 | 18K | |
| JEWELL.Sentencing.Pr..> | 2024-10-04 11:53 | 248K | |
| JOHNSON_Sentencing_P..> | 2024-10-04 11:53 | 246K | |
| Jacksonville_Contrac..> | 2024-10-04 11:53 | 258K | |
| JeffersonCity_Woman_..> | 2024-10-04 11:53 | 259K | |
| Jefferson_City_Busin..> | 2024-10-04 11:53 | 107K | |
| Joachim Plea EDLA FR..> | 2024-10-04 11:53 | 143K | |
| John Doe Pleads Guil..> | 2024-10-04 11:53 | 495K | |
| John_Doe_Charged_Sup..> | 2024-10-04 11:53 | 103K | |
| Johnson Charles Ind_..> | 2024-10-04 11:53 | 35K | |
| Johnson_Guilty_Plea_..> | 2024-10-04 11:53 | 247K | |
| Johnston Trial_11_5_..> | 2024-10-04 11:53 | 145K | |
| Jonesboro man senten..> | 2024-10-04 11:53 | 219K | |
| Jury Convicts Lockpo..> | 2024-10-04 11:53 | 79K | |
| Jury Finds Tampa Man..> | 2024-10-04 11:53 | 99K | |
| Jury convicts operat..> | 2024-10-04 11:53 | 48K | |
| Jury_Convicts_Maryla..> | 2024-10-04 11:53 | 95K | |
| Jury_Convicts_Two_in..> | 2024-10-04 11:53 | 259K | |
| Justice Department A..> | 2024-10-04 11:53 | 151K | |
| Justice Department A..> | 2024-10-04 11:53 | 155K | |
| Justice Department A..> | 2024-10-04 11:53 | 182K | |
| Justice_Department_A..> | 2024-10-04 11:53 | 320K | |
| Justice_Department_F..> | 2024-10-04 11:53 | 103K | |
| Justice_Department_T..> | 2024-10-04 11:53 | 213K | |
| KC Woman Sentenced f..> | 2024-10-04 11:53 | 17K | |
| KUMAR guilty plea pr..> | 2024-10-04 11:53 | 53K | |
| Kansas City Area Bus..> | 2024-10-04 11:53 | 72K | |
| Kenneth Sun Plea DNJ..> | 2024-10-04 11:53 | 135K | |
| Kentucky Otolaryngol..> | 2024-10-04 11:53 | 22K | |
| Klaustermeier convic..> | 2024-10-04 11:53 | 153K | |
| Knecht Change of Ple..> | 2024-10-04 11:53 | 137K | |
| Kunia Woman Arraigne..> | 2024-10-04 11:53 | 166K | |
| Kurusu_ALP_plea.pdf | 2024-10-04 11:53 | 112K | |
| Kurusu_ALP_sen_final..> | 2024-10-04 11:53 | 113K | |
| Kutztown Steel Compa..> | 2024-10-04 11:53 | 38K | |
| LA Man Sentenced to ..> | 2024-10-04 11:53 | 151K | |
| LI_Chiropractor_OWCP..> | 2024-10-04 11:53 | 54K | |
| LOCAL BUSINESSMAN PL..> | 2024-10-04 11:53 | 44K | |
| LONG_ISLAND_CHIROPRA..> | 2024-10-04 11:53 | 200K | |
| Labor_Contractor_Ind..> | 2024-10-04 11:53 | 270K | |
| Labor union corrupti..> | 2024-10-04 11:53 | 252K | |
| Lackawanna County Ma..> | 2024-10-04 11:53 | 106K | |
| Lake County Woman Se..> | 2024-10-04 11:53 | 897K | |
| Lampignano Traversa ..> | 2024-10-04 11:53 | 45K | |
| Lancaster Resident C..> | 2024-10-04 11:53 | 60K | |
| Lancaster Resident S..> | 2024-10-04 11:53 | 76K | |
| Landscaping Executiv..> | 2024-10-04 11:53 | 65K | |
| Laredo resident admi..> | 2024-10-04 11:53 | 480K | |
| Laredo resident sent..> | 2024-10-04 11:53 | 482K | |
| Laredo woman arreste..> | 2024-10-04 11:53 | 172K | |
| Larsen and Toubro Te..> | 2024-10-04 11:53 | 147K | |
| Las Vegas Woman Indi..> | 2024-10-04 11:53 | 102K | |
| Las_Vegas_Man_Senten..> | 2024-10-04 11:53 | 85K | |
| Las_Vegas_UI_Prosecu..> | 2024-10-04 11:53 | 267K | |
| Las_Vegas_Woman_Plea..> | 2024-10-04 11:53 | 82K | |
| Las_Vegas_Woman_Plea..> | 2024-10-04 11:53 | 88K | |
| Las_Vegas_Woman_Sent..> | 2024-10-04 11:53 | 269K | |
| Las_Vegas_Woman_Sent..> | 2024-10-04 11:53 | 101K | |
| Last Defendant In $4..> | 2024-10-04 11:53 | 25K | |
| Laurel Man Pleads Gu..> | 2024-10-04 11:53 | 502K | |
| Laurel Man Sentenced..> | 2024-10-04 11:53 | 371K | |
| Lawrence_Woman_Arres..> | 2024-10-04 11:53 | 260K | |
| Lawrence_Woman_Plead..> | 2024-10-04 11:53 | 106K | |
| Lawrence_Woman_Sente..> | 2024-10-04 11:53 | 106K | |
| LeMars_Man_Sentenced..> | 2024-10-04 11:53 | 260K | |
| Leader of Baltimore ..> | 2024-10-04 11:53 | 127K | |
| Leader sent to priso..> | 2024-10-04 11:53 | 110K | |
| Leader_of_Pandemic_U..> | 2024-10-04 11:53 | 287K | |
| Leaders Of Brooklyn ..> | 2024-10-04 11:53 | 90K | |
| Leaders_of_Brooklyn_..> | 2024-10-04 11:53 | 188K | |
| Leadership Of Yoga T..> | 2024-10-04 11:53 | 112K | |
| Lebanon County Man I..> | 2024-10-04 11:53 | 139K | |
| Lebanon_County_Man_S..> | 2024-10-04 11:53 | 102K | |
| Lee Summit Business ..> | 2024-10-04 11:53 | 19K | |
| Lee_County_Woman_Ple..> | 2024-10-04 11:53 | 83K | |
| Leesburg_Woman_Charg..> | 2024-10-04 11:53 | 96K | |
| Leessa Augustine, Fo..> | 2024-10-04 11:53 | 85K | |
| Lehi Man Sentenced f..> | 2024-10-04 11:53 | 92K | |
| Lehigh Valley Man Ch..> | 2024-10-04 11:53 | 60K | |
| Leicester_Man_Arrest..> | 2024-10-04 11:53 | 100K | |
| Leicester_Man_Indict..> | 2024-10-04 11:53 | 262K | |
| Leicester_Man_Pleads..> | 2024-10-04 11:53 | 166K | |
| Leicester_Man_Pleads..> | 2024-10-04 11:53 | 166K | |
| Leicester_Man_Senten..> | 2024-10-04 11:53 | 266K | |
| Leicester_Woman_and_..> | 2024-10-04 11:53 | 105K | |
| Leshner, Cory Senten..> | 2024-10-04 11:53 | 33K | |
| Local 98 Leader John..> | 2024-10-04 11:53 | 118K | |
| Local Attorney Plead..> | 2024-10-04 11:53 | 31K | |
| Local Attorney Sente..> | 2024-10-04 11:53 | 86K | |
| Local Businessman Se..> | 2024-10-04 11:53 | 111K | |
| Local_98_Leader_Phil..> | 2024-10-04 11:53 | 113K | |
| Local_Alleged_Drug_D..> | 2024-10-04 11:53 | 278K | |
| Long Beach Man Sente..> | 2024-10-04 11:53 | 94K | |
| Long Island Woman In..> | 2024-10-04 11:53 | 112K | |
| Long_Island_Woman_Se..> | 2024-10-04 11:53 | 161K | |
| Long_Island_Woman_Se..> | 2024-10-04 11:53 | 106K | |
| Los Angeles Man Plea..> | 2024-10-04 11:53 | 103K | |
| Louise_Larivee_Impri..> | 2024-10-04 11:53 | 260K | |
| Louisiana Doctor Sen..> | 2024-10-04 11:53 | 83K | |
| Louisiana_Doctor_Ple..> | 2024-10-04 11:53 | 56K | |
| Louisville_Pharmacis..> | 2024-10-04 11:53 | 100K | |
| Luzerne_County_Woman..> | 2024-10-04 11:53 | 148K | |
| MALDEN_MAN_SENTENCED..> | 2024-10-04 11:53 | 167K | |
| MARGATE, NEW JERSEY,..> | 2024-10-04 11:53 | 35K | |
| MARYLAND BUSINESSMAN..> | 2024-10-04 11:53 | 94K | |
| MARYLAND_U.S._ATTORN..> | 2024-10-04 11:53 | 203K | |
| MARYLAND_US_ATTORNEY..> | 2024-10-04 11:53 | 145K | |
| MA_Contractor_Pleads..> | 2024-10-04 11:53 | 165K | |
| MD-FL_Task Force_Con..> | 2024-10-04 11:53 | 167K | |
| MD Career Offender S..> | 2024-10-04 11:53 | 514K | |
| MD_Defense_Contracto..> | 2024-10-04 11:53 | 118K | |
| MD_Man_Charged_Fraud..> | 2024-10-04 11:53 | 86K | |
| MD_Man_Facing_Indict..> | 2024-10-04 11:53 | 119K | |
| MI_AG_News_Release.pdf | 2024-10-04 11:53 | 110K | |
| MI_Man_Arrested_UI_F..> | 2024-10-04 11:53 | 106K | |
| MI_Man_Sentenced_Sch..> | 2024-10-04 11:53 | 86K | |
| MO_Couple_Plead_Guil..> | 2024-10-04 11:53 | 109K | |
| MO_Couple_Sentenced_..> | 2024-10-04 11:53 | 164K | |
| MO_Man_Admits_UI_Hom..> | 2024-10-04 11:53 | 158K | |
| MO_State_Employee_Ac..> | 2024-10-04 11:53 | 99K | |
| Macon Resident Plead..> | 2024-10-04 11:53 | 492K | |
| Macon Resident Sente..> | 2024-10-04 11:53 | 82K | |
| Madison news release..> | 2024-10-04 11:53 | 78K | |
| Maimi Resident Unemp..> | 2024-10-04 11:53 | 18K | |
| Man Admits Role In I..> | 2024-10-04 11:53 | 43K | |
| Man Admits Role In I..> | 2024-10-04 11:53 | 43K | |
| Man Charged with Def..> | 2024-10-04 11:53 | 149K | |
| Man Convicted of 55M..> | 2024-10-04 11:53 | 490K | |
| Man Sentenced For Fr..> | 2024-10-04 11:53 | 61K | |
| Man Sentenced To 27 ..> | 2024-10-04 11:53 | 47K | |
| Man Sentenced for 87..> | 2024-10-04 11:53 | 490K | |
| Man Sentenced for Us..> | 2024-10-04 11:53 | 85K | |
| Man Sentenced to Eig..> | 2024-10-04 11:53 | 98K | |
| Man_Admits_Participa..> | 2024-10-04 11:53 | 125K | |
| Man_Pleads_Guilty_to..> | 2024-10-04 11:53 | 262K | |
| Man_Sentenced_3_Year..> | 2024-10-04 11:53 | 116K | |
| Man_Sentenced_Defrau..> | 2024-10-04 11:53 | 271K | |
| Manager of Clothing ..> | 2024-10-04 11:53 | 40K | |
| Manager of Clothing ..> | 2024-10-04 11:53 | 105K | |
| Manager of Clothing ..> | 2024-10-04 11:53 | 23K | |
| Manchester Man Arres..> | 2024-10-04 11:53 | 130K | |
| Manhattan U.S. Attor..> | 2024-10-04 11:53 | 156K | |
| Manhattan U.S. Attor..> | 2024-10-04 11:53 | 114K | |
| Manhattan U.S. Attor..> | 2024-10-04 11:53 | 136K | |
| Manning false stmt a..> | 2024-10-04 11:53 | 60K | |
| Manning indictment p..> | 2024-10-04 11:53 | 63K | |
| Marcotte Plea MDFL F..> | 2024-10-04 11:53 | 119K | |
| Margate New Jersey F..> | 2024-10-04 11:53 | 52K | |
| Marion_Man_Sentenced..> | 2024-10-04 11:53 | 84K | |
| Married Couple Sente..> | 2024-10-04 11:53 | 164K | |
| Maryland Defense Con..> | 2024-10-04 11:53 | 182K | |
| Maryland Department ..> | 2024-10-04 11:53 | 106K | |
| Maryland Man Admits ..> | 2024-10-04 11:53 | 139K | |
| Maryland Man Pleads ..> | 2024-10-04 11:53 | 492K | |
| Maryland Man Previou..> | 2024-10-04 11:53 | 114K | |
| Maryland Man Sentenc..> | 2024-10-04 11:53 | 151K | |
| Maryland Man Sentenc..> | 2024-10-04 11:53 | 492K | |
| Maryland Man Sentenc..> | 2024-10-04 11:53 | 89K | |
| Maryland Man Sentenc..> | 2024-10-04 11:53 | 190K | |
| Maryland Men Sentenc..> | 2024-10-04 11:53 | 93K | |
| Maryland U.S. Attorn..> | 2024-10-04 11:53 | 167K | |
| Maryland_Doctor_Faci..> | 2024-10-04 11:53 | 317K | |
| Maryland_Man_Admits_..> | 2024-10-04 11:53 | 173K | |
| Maryland_Man_Sentenc..> | 2024-10-04 11:53 | 321K | |
| Maryland and Virgini..> | 2024-10-04 11:53 | 186K | |
| Massachusetts Asbest..> | 2024-10-04 11:53 | 62K | |
| Massachusetts_Contra..> | 2024-10-04 11:53 | 260K | |
| McClain-Gonzalez-Tor..> | 2024-10-04 11:53 | 60K | |
| McComb_Woman_Found_G..> | 2024-10-04 11:53 | 158K | |
| McKinny Sentencing P..> | 2024-10-04 11:53 | 225K | |
| Medford Contractor C..> | 2024-10-04 11:53 | 159K | |
| Medford Contractor S..> | 2024-10-04 11:53 | 112K | |
| Medical_Assistant_Ad..> | 2024-10-04 11:53 | 261K | |
| Medical_Sales_Rep_Fo..> | 2024-10-04 11:53 | 109K | |
| Medical_Sales_Rep_Se..> | 2024-10-04 11:53 | 108K | |
| Melrose_Man_Pleads_G..> | 2024-10-04 11:53 | 144K | |
| Melrose_Man_Sentence..> | 2024-10-04 11:53 | 97K | |
| Melvindale_Man_Sente..> | 2024-10-04 11:53 | 254K | |
| Member Of Lucchese O..> | 2024-10-04 11:53 | 44K | |
| Member Of Violent Ga..> | 2024-10-04 11:53 | 139K | |
| Member of Dockworker..> | 2024-10-04 11:53 | 27K | |
| Member of Local 401 ..> | 2024-10-04 11:53 | 133K | |
| Members And Associat..> | 2024-10-04 11:53 | 50K | |
| Members_of_Brooklyn-..> | 2024-10-04 11:53 | 281K | |
| Members of Brooklyn-..> | 2024-10-04 11:53 | 210K | |
| Mendez-MorenoPuente-..> | 2024-10-04 11:53 | 61K | |
| Mendoza_Covey COVID ..> | 2024-10-04 11:53 | 146K | |
| Menifee_Woman_Pleads..> | 2024-10-04 11:53 | 290K | |
| Mercado COVID_11_21.pdf | 2024-10-04 11:53 | 147K | |
| Meridian Residents C..> | 2024-10-04 11:53 | 42K | |
| Meth Kingpin Sentenc..> | 2024-10-04 11:53 | 125K | |
| Metro-Atlanta Man Ch..> | 2024-10-04 11:53 | 108K | |
| Metro-Atlanta man pl..> | 2024-10-04 11:53 | 144K | |
| Metro Atlanta Man Se..> | 2024-10-04 11:53 | 501K | |
| Metro Atlanta man se..> | 2024-10-04 11:53 | 165K | |
| Metro_ATL Man_charge..> | 2024-10-04 11:53 | 165K | |
| Metro_ATL_man_charge..> | 2024-10-04 11:53 | 110K | |
| Mexican And Honduran..> | 2024-10-04 11:53 | 98K | |
| Mexican_Nationals_Ch..> | 2024-10-04 11:53 | 164K | |
| Miami-Based Social M..> | 2024-10-04 11:53 | 147K | |
| Miami-Dade County Br..> | 2024-10-04 11:53 | 36K | |
| Miami-Dade County Re..> | 2024-10-04 11:53 | 230K | |
| Miami Resident Sente..> | 2024-10-04 11:53 | 21K | |
| Michigan Man Pleads ..> | 2024-10-04 11:53 | 154K | |
| Michigan_Man_Pleads_..> | 2024-10-04 11:53 | 137K | |
| Michigan_Woman_Sente..> | 2024-10-04 11:53 | 78K | |
| MickleJonathanPleaPR..> | 2024-10-04 11:53 | 81K | |
| Middle District Of F..> | 2024-10-04 11:53 | 80K | |
| Middle District Of F..> | 2024-10-04 11:53 | 294K | |
| Middle District Of F..> | 2024-10-04 11:53 | 191K | |
| Middle District Of F..> | 2024-10-04 11:53 | 237K | |
| Middle District Of F..> | 2024-10-04 11:53 | 242K | |
| Middle Township Teac..> | 2024-10-04 11:53 | 49K | |
| Middlefield Man Sent..> | 2024-10-04 11:53 | 81K | |
| Middlefield_Man_Plea..> | 2024-10-04 11:53 | 99K | |
| Middlesex County Con..> | 2024-10-04 11:53 | 140K | |
| Middlesex County Man..> | 2024-10-04 11:53 | 496K | |
| Middlesex County Wom..> | 2024-10-04 11:53 | 496K | |
| Middlesex County Wom..> | 2024-10-04 11:53 | 140K | |
| Midlothian_Woman_Ple..> | 2024-10-04 11:53 | 106K | |
| Midlothian_Woman_Sen..> | 2024-10-04 11:53 | 107K | |
| Miller J Sentencing ..> | 2024-10-04 11:53 | 162K | |
| Miller_Woman_Sentenc..> | 2024-10-04 11:53 | 264K | |
| Milwaukee-Area Gas S..> | 2024-10-04 11:53 | 41K | |
| Milwaukee Women Sent..> | 2024-10-04 11:53 | 166K | |
| Miramar Resident Con..> | 2024-10-04 11:53 | 144K | |
| Missouri Man Sentenc..> | 2024-10-04 11:53 | 158K | |
| Missouri_Health_Care..> | 2024-10-04 11:53 | 316K | |
| Moe Paul Indictment ..> | 2024-10-04 11:53 | 34K | |
| Mohammad Wahid and M..> | 2024-10-04 11:53 | 34K | |
| Monessen_Woman_Sente..> | 2024-10-04 11:53 | 99K | |
| Money_Mule_One_Pager..> | 2024-10-04 11:53 | 225K | |
| Money_Mule_Release.pdf | 2024-10-04 11:53 | 195K | |
| Monmouth_County_Man_..> | 2024-10-04 11:53 | 103K | |
| Montgomery_County_Go..> | 2024-10-04 11:53 | 269K | |
| Moran_indictment_09_..> | 2024-10-04 11:53 | 40K | |
| More_charges_filed_i..> | 2024-10-04 11:53 | 351K | |
| Morris County Woman ..> | 2024-10-04 11:53 | 137K | |
| Morris County Woman ..> | 2024-10-04 11:53 | 131K | |
| Mullens Doctor Charg..> | 2024-10-04 11:53 | 48K | |
| NATIONAL HEALTHCARE ..> | 2024-10-04 11:53 | 93K | |
| NDGA_Atl_UI.pdf | 2024-10-04 11:53 | 105K | |
| NDOK_UI.pdf | 2024-10-04 11:53 | 108K | |
| ND_IL_Release.pdf | 2024-10-04 11:53 | 98K | |
| NEW JERSEY COMPANY F..> | 2024-10-04 11:53 | 147K | |
| NIGERIAN_NATIONAL_PL..> | 2024-10-04 11:53 | 170K | |
| NJ_Company_Pleads_Gu..> | 2024-10-04 11:53 | 146K | |
| NJ_Man_Admits_Steali..> | 2024-10-04 11:53 | 103K | |
| NJ_Man_Charged_Fraud..> | 2024-10-04 11:53 | 264K | |
| NJ_Man_Indicted_Frau..> | 2024-10-04 11:53 | 104K | |
| NJ_Man_Pleads_Guilty..> | 2024-10-04 11:53 | 154K | |
| NOLA_Company_Sentenc..> | 2024-10-04 11:53 | 102K | |
| NORTH BRANFORD WOMAN..> | 2024-10-04 11:53 | 146K | |
| NR Jose Jose Rest 3-..> | 2024-10-04 11:53 | 249K | |
| NR bribery federal p..> | 2024-10-04 11:53 | 334K | |
| NUIFTF - Alert, Text..> | 2024-10-04 11:53 | 838K | |
| NUIFTF Alert, Errone..> | 2024-10-04 11:53 | 827K | |
| NUIFTF Alert Fraudul..> | 2024-10-04 11:53 | 574K | |
| NYC_Dept_of_Building..> | 2024-10-04 11:53 | 265K | |
| NYSDOL_Prevents_Cybe..> | 2024-10-04 11:53 | 179K | |
| NYS_Fraudsters_UI_Be..> | 2024-10-04 11:53 | 226K | |
| NY_Man_Arrested_COVI..> | 2024-10-04 11:53 | 167K | |
| NY_Man_Sentenced_Six..> | 2024-10-04 11:53 | 258K | |
| NY_Physcial_Therapy_..> | 2024-10-04 11:53 | 289K | |
| Nadeem Sentence Pres..> | 2024-10-04 11:53 | 54K | |
| Nadeem Verdict Press..> | 2024-10-04 11:53 | 239K | |
| Nashua Woman Pleads ..> | 2024-10-04 11:53 | 263K | |
| National Health Care..> | 2024-10-04 11:53 | 81K | |
| Nationwide_Drug_Traf..> | 2024-10-04 11:53 | 279K | |
| Navillus Indictment ..> | 2024-10-04 11:53 | 59K | |
| Navillus_Constructio..> | 2024-10-04 11:53 | 108K | |
| Nebraska_Railcar_Cle..> | 2024-10-04 11:53 | 130K | |
| New Berlin Contracto..> | 2024-10-04 11:53 | 58K | |
| New Jersey Man Plead..> | 2024-10-04 11:53 | 147K | |
| New Jersey Man Sente..> | 2024-10-04 11:53 | 268K | |
| New Jersey Woman Adm..> | 2024-10-04 11:53 | 33K | |
| New Madrid County Ma..> | 2024-10-04 11:53 | 20K | |
| New York Couple Sent..> | 2024-10-04 11:53 | 83K | |
| New York Man Indicte..> | 2024-10-04 11:53 | 496K | |
| New York Man Sentenc..> | 2024-10-04 11:53 | 325K | |
| New York Woman Sente..> | 2024-10-04 11:53 | 17K | |
| New_Cumberland_Man_S..> | 2024-10-04 11:53 | 97K | |
| New_Jersey_Man_Arres..> | 2024-10-04 11:53 | 86K | |
| New_Jersey_Man_Sente..> | 2024-10-04 11:53 | 321K | |
| New_Orleans_Company_..> | 2024-10-04 11:53 | 107K | |
| New_York_Man_Pleads_..> | 2024-10-04 11:53 | 269K | |
| New_York_Man_Sentenc..> | 2024-10-04 11:53 | 273K | |
| New_York_Man_Sentenc..> | 2024-10-04 11:53 | 266K | |
| Nicolette Gizzi Sent..> | 2024-10-04 11:53 | 76K | |
| Nigerian Man Arreste..> | 2024-10-04 11:53 | 86K | |
| Nigerian Man Sentenc..> | 2024-10-04 11:53 | 107K | |
| Nigerian National Pl..> | 2024-10-04 11:53 | 83K | |
| Nigerian_National_Ba..> | 2024-10-04 11:53 | 165K | |
| Nigerian_National_Ch..> | 2024-10-04 11:53 | 99K | |
| Nigerian citizen ext..> | 2024-10-04 11:53 | 168K | |
| Nigerian_National_Se..> | 2024-10-04 11:53 | 310K | |
| Nigerian_National_in..> | 2024-10-04 11:53 | 108K | |
| Nigerian_citizen_cha..> | 2024-10-04 11:53 | 108K | |
| Nigerian_citizen_ple..> | 2024-10-04 11:53 | 273K | |
| Nigerian_hacker_and_..> | 2024-10-04 11:53 | 114K | |
| Nigerian_national_in..> | 2024-10-04 11:53 | 106K | |
| Nigerian_state_offic..> | 2024-10-04 11:53 | 119K | |
| Nine_Defendants_Sent..> | 2024-10-04 11:53 | 132K | |
| Nine_Members_and_Ass..> | 2024-10-04 11:53 | 293K | |
| Nomura Securities In..> | 2024-10-04 11:53 | 164K | |
| North Miami Beach Re..> | 2024-10-04 11:53 | 23K | |
| North Miami Beach Re..> | 2024-10-04 11:53 | 18K | |
| North Miami Beach Re..> | 2024-10-04 11:53 | 78K | |
| North Miami Beach Re..> | 2024-10-04 11:53 | 90K | |
| North Miami Resident..> | 2024-10-04 11:53 | 20K | |
| North Miami Resident..> | 2024-10-04 11:53 | 37K | |
| North Miami Resident..> | 2024-10-04 11:53 | 125K | |
| North Providence Wom..> | 2024-10-04 11:53 | 92K | |
| North Suburban Chiro..> | 2024-10-04 11:53 | 58K | |
| North_Providence_Man..> | 2024-10-04 11:53 | 268K | |
| North_Providence_Man..> | 2024-10-04 11:53 | 268K | |
| Norton_Man_Sentenced..> | 2024-10-04 11:53 | 103K | |
| Novi_Man_Charged_UI_..> | 2024-10-04 11:53 | 99K | |
| Nursing Home Operato..> | 2024-10-04 11:53 | 102K | |
| O.C. Man Faces Feder..> | 2024-10-04 11:53 | 110K | |
| OK_Otheropedic_Surge..> | 2024-10-04 11:53 | 118K | |
| Oahu Woman Charged w..> | 2024-10-04 11:53 | 136K | |
| Ocean_County_Insuran..> | 2024-10-04 11:53 | 104K | |
| Office_Manager_and_S..> | 2024-10-04 11:53 | 105K | |
| Ohio Woman Sentenced..> | 2024-10-04 11:53 | 25K | |
| Olathe Woman Sentenc..> | 2024-10-04 11:53 | 25K | |
| Olathe Women Schemes..> | 2024-10-04 11:53 | 97K | |
| Old_Town_Man_Pleads_..> | 2024-10-04 11:53 | 97K | |
| Omaha Company Senten..> | 2024-10-04 11:53 | 100K | |
| Omaha Railcar Cleani..> | 2024-10-04 11:53 | 51K | |
| Omaha_Railcar_Cleani..> | 2024-10-04 11:53 | 193K | |
| One of two Nigerian ..> | 2024-10-04 11:53 | 504K | |
| One-Time_EDD_Employe..> | 2024-10-04 11:53 | 121K | |
| One-Time_EDD_Employe..> | 2024-10-04 11:53 | 300K | |
| Operators of physica..> | 2024-10-04 11:53 | 176K | |
| Orange County Man Pl..> | 2024-10-04 11:53 | 143K | |
| Orange County Woman ..> | 2024-10-04 11:53 | 108K | |
| Orange_County_Man_Se..> | 2024-10-04 11:53 | 164K | |
| Organized_Crime_Drug..> | 2024-10-04 11:53 | 110K | |
| Organizer_of_Conspir..> | 2024-10-04 11:53 | 109K | |
| Osteopathic Doctor P..> | 2024-10-04 11:53 | 28K | |
| Over 100 Defendants ..> | 2024-10-04 11:53 | 278K | |
| Over 100 Defendants ..> | 2024-10-04 11:53 | 281K | |
| Owner And Operator O..> | 2024-10-04 11:53 | 149K | |
| Owner Of Farm Labor ..> | 2024-10-04 11:53 | 268K | |
| Owner Of Hudson Coun..> | 2024-10-04 11:53 | 104K | |
| Owner Of Information..> | 2024-10-04 11:53 | 24K | |
| Owner Of Insurance F..> | 2024-10-04 11:53 | 102K | |
| Owner of Axis Benefi..> | 2024-10-04 11:53 | 40K | |
| Owner of Boston Pizz..> | 2024-10-04 11:53 | 166K | |
| Owner of Boston Pizz..> | 2024-10-04 11:53 | 501K | |
| Owner of Boston Pizz..> | 2024-10-04 11:53 | 116K | |
| Owner of Boston Pizz..> | 2024-10-04 11:53 | 141K | |
| Owner of Farm Labor ..> | 2024-10-04 11:53 | 94K | |
| Owner of Gire Roofin..> | 2024-10-04 11:53 | 101K | |
| Owner_Eire_Fish_Mark..> | 2024-10-04 11:53 | 254K | |
| Owner of Information..> | 2024-10-04 11:53 | 50K | |
| Owner of Mall Kiosk ..> | 2024-10-04 11:53 | 60K | |
| Owner of Mall Kiosk ..> | 2024-10-04 11:53 | 21K | |
| Owner of Medford Con..> | 2024-10-04 11:53 | 495K | |
| Owner_IT_Services_Co..> | 2024-10-04 11:53 | 258K | |
| Owner_Insurance_Firm..> | 2024-10-04 11:53 | 97K | |
| Owner_Insurance_Firm..> | 2024-10-04 11:53 | 54K | |
| Owner_RC_AutoSales_I..> | 2024-10-04 11:53 | 86K | |
| Owner_Tanker_Truck_R..> | 2024-10-04 11:53 | 132K | |
| Owner_of_Medford_Con..> | 2024-10-04 11:53 | 284K | |
| Owner_of_a_Tanker_Co..> | 2024-10-04 11:53 | 111K | |
| Owners and Chiroprac..> | 2024-10-04 11:53 | 48K | |
| PA Man Sentenced To ..> | 2024-10-04 11:53 | 491K | |
| PA Office of Attorne..> | 2024-10-04 11:53 | 79K | |
| PA_Inmate_Sentenced_..> | 2024-10-04 11:53 | 105K | |
| PEARSON.Guilty.Plea...> | 2024-10-04 11:53 | 252K | |
| PEARSON.Press.Releas..> | 2024-10-04 11:53 | 246K | |
| PG_County_Man_Senten..> | 2024-10-04 11:53 | 189K | |
| PUA Arrests-02152022..> | 2024-10-04 11:53 | 92K | |
| Pagesfrom12.01.15.pdf | 2024-10-04 11:53 | 75K | |
| Pagesfrom12.03.15.pdf | 2024-10-04 11:53 | 11K | |
| PaigeSettlementValle..> | 2024-10-04 11:53 | 25K | |
| Pain Doctors Plead G..> | 2024-10-04 11:53 | 486K | |
| Pain Doctors Sentenc..> | 2024-10-04 11:53 | 105K | |
| Painting Contractor ..> | 2024-10-04 11:53 | 25K | |
| Painting_Contractor_..> | 2024-10-04 11:53 | 265K | |
| Parker Man Indicted ..> | 2024-10-04 11:53 | 493K | |
| Parkville Man Senten..> | 2024-10-04 11:53 | 276K | |
| Parkville_Man_Pleads..> | 2024-10-04 11:53 | 111K | |
| Passaic County Lawye..> | 2024-10-04 11:53 | 139K | |
| Passaic_County_Lawye..> | 2024-10-04 11:53 | 102K | |
| Pennsylvania Contrac..> | 2024-10-04 11:53 | 46K | |
| Pennsylvania Man Ple..> | 2024-10-04 11:53 | 161K | |
| Pharmaceutical Emplo..> | 2024-10-04 11:53 | 32K | |
| Pharmaceutical Emplo..> | 2024-10-04 11:53 | 25K | |
| Pharmaceutical Emplo..> | 2024-10-04 11:53 | 26K | |
| Pharmaceutical Marke..> | 2024-10-04 11:53 | 83K | |
| Pharmaceutical Sales..> | 2024-10-04 11:53 | 89K | |
| Pharmaceutical_Sales..> | 2024-10-04 11:53 | 91K | |
| Pharmacist_sent_to_p..> | 2024-10-04 11:53 | 101K | |
| Pharmacy Owner Sente..> | 2024-10-04 11:53 | 495K | |
| Pharmacy Owners and ..> | 2024-10-04 11:53 | 500K | |
| Pharmacy_Owner_Convi..> | 2024-10-04 11:53 | 162K | |
| Philadelphia, Lehigh..> | 2024-10-04 11:53 | 101K | |
| Philadelphia Man Sen..> | 2024-10-04 11:53 | 161K | |
| Philadelphia Woman S..> | 2024-10-04 11:53 | 257K | |
| Philadelphia_Contrac..> | 2024-10-04 11:53 | 85K | |
| Philadelphia_Man_Sen..> | 2024-10-04 11:53 | 268K | |
| Philadelphia_Woman_C..> | 2024-10-04 11:53 | 87K | |
| Philly_Contractor_Co..> | 2024-10-04 11:53 | 102K | |
| Philly_Pyschiatrist_..> | 2024-10-04 11:53 | 108K | |
| Physician_Partners_o..> | 2024-10-04 11:53 | 59K | |
| Physician and pharma..> | 2024-10-04 11:53 | 158K | |
| Physician and two ph..> | 2024-10-04 11:53 | 534K | |
| Pierre_Woman_Charged..> | 2024-10-04 11:53 | 102K | |
| Pittsburgh Resident ..> | 2024-10-04 11:53 | 156K | |
| Pittsburgh Resident ..> | 2024-10-04 11:53 | 494K | |
| Pitts et al news rel..> | 2024-10-04 11:53 | 86K | |
| Plainville Electrica..> | 2024-10-04 11:53 | 144K | |
| Plantation Resident ..> | 2024-10-04 11:53 | 43K | |
| Plantation Resident ..> | 2024-10-04 11:53 | 120K | |
| Plaza Construction C..> | 2024-10-04 11:53 | 36K | |
| Pleasantville, new j..> | 2024-10-04 11:53 | 32K | |
| Pleasantville Guidan..> | 2024-10-04 11:53 | 29K | |
| Plymouth Man Arreste..> | 2024-10-04 11:53 | 134K | |
| Plymouth Man Pleads ..> | 2024-10-04 11:53 | 104K | |
| Plymouth Man Sentenc..> | 2024-10-04 11:53 | 493K | |
| Podiatrist_Patient_R..> | 2024-10-04 11:53 | 129K | |
| Political Consultant..> | 2024-10-04 11:53 | 228K | |
| Political Organizer ..> | 2024-10-04 11:53 | 137K | |
| Ponte Vedra Man Indi..> | 2024-10-04 11:53 | 17K | |
| Port St. Lucie Resid..> | 2024-10-04 11:53 | 41K | |
| Portsmouth_Woman_Ple..> | 2024-10-04 11:53 | 107K | |
| Postal Union Steward..> | 2024-10-04 11:53 | 21K | |
| Postal_Service_Mail_..> | 2024-10-04 11:53 | 296K | |
| Pound Va. Man Convic..> | 2024-10-04 11:53 | 86K | |
| Preliminary Injuncti..> | 2024-10-04 11:53 | 164K | |
| President Of Labor U..> | 2024-10-04 11:53 | 111K | |
| President Of Queens-..> | 2024-10-04 11:53 | 148K | |
| President Of Queens-..> | 2024-10-04 11:53 | 581K | |
| President and Vice P..> | 2024-10-04 11:53 | 88K | |
| President and Vice P..> | 2024-10-04 11:53 | 109K | |
| Press Release - VonF..> | 2024-10-04 11:53 | 152K | |
| Press Release Indict..> | 2024-10-04 11:53 | 58K | |
| Previously Deported ..> | 2024-10-04 11:53 | 163K | |
| Prince George’s Co..> | 2024-10-04 11:53 | 110K | |
| Prince Georges Count..> | 2024-10-04 11:53 | 302K | |
| Property company own..> | 2024-10-04 11:53 | 159K | |
| Providence Man Sente..> | 2024-10-04 11:53 | 89K | |
| Providence Man Sente..> | 2024-10-04 11:53 | 268K | |
| Providence Man on Ad..> | 2024-10-04 11:53 | 89K | |
| Providence_Man_Admit..> | 2024-10-04 11:53 | 88K | |
| Providence_Man_Await..> | 2024-10-04 11:53 | 269K | |
| Providence_Man_Detai..> | 2024-10-04 11:53 | 107K | |
| QUEENS MAN SENTENCED..> | 2024-10-04 11:53 | 134K | |
| Queens Couple Pleads..> | 2024-10-04 11:53 | 118K | |
| Queens Couple Senten..> | 2024-10-04 11:53 | 70K | |
| Queens Man Charged w..> | 2024-10-04 11:53 | 489K | |
| Queens_Man_Pleads_Gu..> | 2024-10-04 11:53 | 107K | |
| Queens_Man_Sentenced..> | 2024-10-04 11:53 | 60K | |
| Queens_Postal_Worker..> | 2024-10-04 11:53 | 278K | |
| Queens_Woman_Charged..> | 2024-10-04 11:53 | 121K | |
| READING_MAN_PLEADS_G..> | 2024-10-04 11:53 | 266K | |
| RI_Man_Pleads_Guilty..> | 2024-10-04 11:53 | 164K | |
| Rancho_CD_CA_Release..> | 2024-10-04 11:53 | 116K | |
| Randa Allison Senten..> | 2024-10-04 11:53 | 108K | |
| Rapper_Who_Boasted_i..> | 2024-10-04 11:53 | 122K | |
| Rapper_who_Bragged_A..> | 2024-10-04 11:53 | 119K | |
| Reading_Man_Sentence..> | 2024-10-04 11:53 | 168K | |
| Reference_Lab_Pain_C..> | 2024-10-04 11:53 | 296K | |
| Rensselaer Man Sente..> | 2024-10-04 11:53 | 138K | |
| Rensselaer_County_Ma..> | 2024-10-04 11:53 | 89K | |
| Rensselaer_Man_Plead..> | 2024-10-04 11:53 | 87K | |
| Rensselear_Man_Sente..> | 2024-10-04 11:53 | 83K | |
| Repeat Fraudster Sen..> | 2024-10-04 11:53 | 80K | |
| Resident of Nashua S..> | 2024-10-04 11:53 | 47K | |
| Restaurateur and Squ..> | 2024-10-04 11:53 | 77K | |
| Rhode Island Man Sen..> | 2024-10-04 11:53 | 163K | |
| Rhode_Island_Man_Adm..> | 2024-10-04 11:53 | 269K | |
| Rhode_Island_Man_Arr..> | 2024-10-04 11:53 | 89K | |
| Richland Man Indicte..> | 2024-10-04 11:53 | 87K | |
| Richmond Man Sentenc..> | 2024-10-04 11:53 | 313K | |
| Rio Arriba County Ma..> | 2024-10-04 11:53 | 185K | |
| Rochester Couple Cha..> | 2024-10-04 11:53 | 18K | |
| Rochester Man Pleads..> | 2024-10-04 11:53 | 130K | |
| Rochester Man Pleads..> | 2024-10-04 11:53 | 39K | |
| Rochester_Man_Second..> | 2024-10-04 11:53 | 110K | |
| Rochester_Man_Senten..> | 2024-10-04 11:53 | 262K | |
| Rochester_Man_Who_Bi..> | 2024-10-04 11:53 | 92K | |
| Rochester woman plea..> | 2024-10-04 11:53 | 489K | |
| Rocky River business..> | 2024-10-04 11:53 | 108K | |
| Rocky River executiv..> | 2024-10-04 11:53 | 24K | |
| Rodriguez_Rafael_SA_..> | 2024-10-04 11:53 | 113K | |
| Romance Scammer Conv..> | 2024-10-04 11:53 | 495K | |
| Romance Scammer Sent..> | 2024-10-04 11:53 | 487K | |
| Romance Scammer Sent..> | 2024-10-04 11:53 | 84K | |
| Romanian Citizens Ar..> | 2024-10-04 11:53 | 181K | |
| Romanian_Citizen_Arr..> | 2024-10-04 11:53 | 195K | |
| Roofing Company Owne..> | 2024-10-04 11:53 | 48K | |
| Roofing Company Owne..> | 2024-10-04 11:53 | 80K | |
| Roofing Company Prin..> | 2024-10-04 11:53 | 136K | |
| Roofing Company Prin..> | 2024-10-04 11:53 | 119K | |
| Roofing_Company_Prin..> | 2024-10-04 11:53 | 197K | |
| Roshell Beaty Senten..> | 2024-10-04 11:53 | 330K | |
| Rush City Woman Sent..> | 2024-10-04 11:53 | 488K | |
| Rush_City_Woman_Plea..> | 2024-10-04 11:53 | 159K | |
| Rusk County Man Sent..> | 2024-10-04 11:53 | 110K | |
| Rusk_County_Man_Plea..> | 2024-10-04 11:53 | 107K | |
| Russell_County_Woman..> | 2024-10-04 11:53 | 83K | |
| SD-MS Release.pdf | 2024-10-04 11:53 | 122K | |
| SDNY_Connecticut_Ins..> | 2024-10-04 11:53 | 116K | |
| SDNY_Teamsters_Sente..> | 2024-10-04 11:53 | 106K | |
| SDNY_UI_Release.pdf | 2024-10-04 11:53 | 106K | |
| SD_CA_EDD.pdf | 2024-10-04 11:53 | 119K | |
| SD_MS_Release.pdf | 2024-10-04 11:53 | 98K | |
| SUTTER COUNTY MAN SE..> | 2024-10-04 11:53 | 80K | |
| SUTTER COUNTY WOMEN ..> | 2024-10-04 11:53 | 95K | |
| SW_VA_Man_Sentenced_..> | 2024-10-04 11:53 | 106K | |
| SW_VA_Man_Sentenced_..> | 2024-10-04 11:53 | 105K | |
| SW_VA_Man_Sentenced_..> | 2024-10-04 11:53 | 81K | |
| Sacramento Dentist P..> | 2024-10-04 11:53 | 250K | |
| Sacramento Dentist S..> | 2024-10-04 11:53 | 86K | |
| Sacramento Jury Conv..> | 2024-10-04 11:53 | 85K | |
| Sacramento Woman Sen..> | 2024-10-04 11:53 | 22K | |
| Salem Man Pleads Gui..> | 2024-10-04 11:53 | 261K | |
| Salvatore Armao Plea..> | 2024-10-04 11:53 | 43K | |
| San Fernando Valley ..> | 2024-10-04 11:53 | 87K | |
| San Francisco Acupun..> | 2024-10-04 11:53 | 102K | |
| San Francisco Acupun..> | 2024-10-04 11:53 | 100K | |
| San_Francisco_Man_Pl..> | 2024-10-04 11:53 | 89K | |
| SandersCoryIndictPR.pdf | 2024-10-04 11:53 | 36K | |
| Sandown_Man_Pleads_G..> | 2024-10-04 11:53 | 109K | |
| Santa Ana Man Charge..> | 2024-10-04 11:53 | 160K | |
| Santillo GP.pdf | 2024-10-04 11:53 | 39K | |
| Sarasota_Man_Sentenc..> | 2024-10-04 11:53 | 102K | |
| Saratoga County Man ..> | 2024-10-04 11:53 | 509K | |
| Saratoga County Man ..> | 2024-10-04 11:53 | 89K | |
| Saratoga Man Sentenc..> | 2024-10-04 11:53 | 136K | |
| Saratoga_Springs_Man..> | 2024-10-04 11:53 | 260K | |
| Saratoga_Springs_Man..> | 2024-10-04 11:53 | 100K | |
| Savani_Group_Owners_..> | 2024-10-04 11:53 | 198K | |
| Scam Alert - Law Enf..> | 2024-10-04 11:53 | 517K | |
| Schaller_Man_Sentenc..> | 2024-10-04 11:53 | 88K | |
| Scranton Business Ow..> | 2024-10-04 11:53 | 20K | |
| Scranton_Doctor_Sent..> | 2024-10-04 11:53 | 266K | |
| Seattle man who defr..> | 2024-10-04 11:53 | 166K | |
| Second Canadian resi..> | 2024-10-04 11:53 | 102K | |
| Second City Official..> | 2024-10-04 11:53 | 85K | |
| Second Wayne County ..> | 2024-10-04 11:53 | 102K | |
| Selection of Phase I..> | 2024-10-04 11:53 | 61K | |
| Senator Abel Nazario..> | 2024-10-04 11:53 | 50K | |
| Sentenced for Role i..> | 2024-10-04 11:53 | 486K | |
| Serial Fraudster Sen..> | 2024-10-04 11:53 | 498K | |
| Serial Fraudster Sen..> | 2024-10-04 11:53 | 109K | |
| Serial_Fraudster_Sen..> | 2024-10-04 11:53 | 109K | |
| Servider Sentencing ..> | 2024-10-04 11:53 | 56K | |
| Seven Maryland Resid..> | 2024-10-04 11:53 | 100K | |
| Seven People Charged..> | 2024-10-04 11:53 | 183K | |
| Seven Sentenced to F..> | 2024-10-04 11:53 | 174K | |
| Seven_Guilty_Forest_..> | 2024-10-04 11:53 | 267K | |
| Seven_Individuals_In..> | 2024-10-04 11:53 | 132K | |
| Seven_People_Indcite..> | 2024-10-04 11:53 | 112K | |
| Seven_charged_for_ro..> | 2024-10-04 11:53 | 96K | |
| Sherman_Oaks_Woman_P..> | 2024-10-04 11:53 | 292K | |
| Sherwin-Williams_to_..> | 2024-10-04 11:53 | 164K | |
| Siblings Convicted, ..> | 2024-10-04 11:53 | 160K | |
| Simsbury Man Sentenc..> | 2024-10-04 11:53 | 106K | |
| Sinking Spring_PA Ma..> | 2024-10-04 11:53 | 35K | |
| Sioux_City_Woman_Ple..> | 2024-10-04 11:53 | 107K | |
| Sioux_City_Woman_Sen..> | 2024-10-04 11:53 | 105K | |
| Six Additional India..> | 2024-10-04 11:53 | 23K | |
| Six Defendants Arres..> | 2024-10-04 11:53 | 108K | |
| Six Defendants Charg..> | 2024-10-04 11:53 | 41K | |
| Six Defendants Indic..> | 2024-10-04 11:53 | 46K | |
| Six Defendants Plead..> | 2024-10-04 11:53 | 76K | |
| Six Individuals, Inc..> | 2024-10-04 11:53 | 127K | |
| Six Philadelphia-Are..> | 2024-10-04 11:53 | 94K | |
| Six Plead Guilty to ..> | 2024-10-04 11:53 | 85K | |
| Six_Defendants_Arres..> | 2024-10-04 11:53 | 105K | |
| Six_Defendants_Charg..> | 2024-10-04 11:53 | 95K | |
| Six_Individuals_Iden..> | 2024-10-04 11:53 | 266K | |
| Six_People_Indicted_..> | 2024-10-04 11:53 | 85K | |
| Six_People_Indicted_..> | 2024-10-04 11:53 | 117K | |
| Smyrna_resident_sent..> | 2024-10-04 11:53 | 165K | |
| Social Media Influen..> | 2024-10-04 11:53 | 169K | |
| Social_Security_Empl..> | 2024-10-04 11:53 | 90K | |
| South Bay Resident C..> | 2024-10-04 11:53 | 112K | |
| South Florida Constr..> | 2024-10-04 11:53 | 132K | |
| South Florida US Att..> | 2024-10-04 11:53 | 190K | |
| South Jersey Woman A..> | 2024-10-04 11:53 | 107K | |
| South Los Angeles Wo..> | 2024-10-04 11:53 | 193K | |
| South_Florida_Man_In..> | 2024-10-04 11:53 | 81K | |
| South_Florida_U.S._A..> | 2024-10-04 11:53 | 383K | |
| South_Jersey_Dr.D_NJ..> | 2024-10-04 11:53 | 103K | |
| Southern District of..> | 2024-10-04 11:53 | 106K | |
| Southern District pr..> | 2024-10-04 11:53 | 188K | |
| Southern_District_Fl..> | 2024-10-04 11:53 | 326K | |
| Southfield Man First..> | 2024-10-04 11:53 | 492K | |
| Southfield Woman Ple..> | 2024-10-04 11:53 | 492K | |
| Southfield_Man_Sente..> | 2024-10-04 11:53 | 263K | |
| Southfield_Resident_..> | 2024-10-04 11:53 | 113K | |
| Southfield_Woman_Cha..> | 2024-10-04 11:53 | 81K | |
| Southwest_Man_Senten..> | 2024-10-04 11:53 | 104K | |
| Southwest_Virginia_M..> | 2024-10-04 11:53 | 145K | |
| Spokane Resident Ple..> | 2024-10-04 11:53 | 169K | |
| Springfield Man Sent..> | 2024-10-04 11:53 | 491K | |
| Springfield_Company_..> | 2024-10-04 11:53 | 93K | |
| Springfield_Health_C..> | 2024-10-04 11:53 | 137K | |
| Springfield_Woman_In..> | 2024-10-04 11:53 | 92K | |
| Springfield_Woman_Se..> | 2024-10-04 11:53 | 267K | |
| St. Joseph Woman Sen..> | 2024-10-04 11:53 | 123K | |
| St_Joseph_Woman_Plea..> | 2024-10-04 11:53 | 160K | |
| St_Paul_Virginia_Wom..> | 2024-10-04 11:53 | 261K | |
| St_Paul_Woman_Senten..> | 2024-10-04 11:53 | 265K | |
| State Contractor Cha..> | 2024-10-04 11:53 | 76K | |
| State Labor Commissi..> | 2024-10-04 11:53 | 31K | |
| State_Contractor_Ple..> | 2024-10-04 11:53 | 213K | |
| State and Federal Of..> | 2024-10-04 11:53 | 127K | |
| State_Contractor_Sen..> | 2024-10-04 11:53 | 108K | |
| State_Employee_Charg..> | 2024-10-04 11:53 | 261K | |
| State_Prison_Inmates..> | 2024-10-04 11:53 | 87K | |
| State_Prisoners_Sent..> | 2024-10-04 11:53 | 268K | |
| Stockton Man Arreste..> | 2024-10-04 11:53 | 127K | |
| Stockton Man Sentenc..> | 2024-10-04 11:53 | 147K | |
| Stockton Man Sentenc..> | 2024-10-04 11:53 | 47K | |
| Stockton Woman Charg..> | 2024-10-04 11:53 | 60K | |
| Stockton Woman Plead..> | 2024-10-04 11:53 | 78K | |
| Stockton Woman Sente..> | 2024-10-04 11:53 | 136K | |
| Stoneham_Man_Indicte..> | 2024-10-04 11:53 | 87K | |
| Stoneham_Man_Pleads_..> | 2024-10-04 11:53 | 87K | |
| Stoneham_Woman_Plead..> | 2024-10-04 11:53 | 106K | |
| Stoneham_Woman_Sente..> | 2024-10-04 11:53 | 267K | |
| Strauss_sentenced.pdf | 2024-10-04 11:53 | 106K | |
| Subcontractor_Agrees..> | 2024-10-04 11:53 | 294K | |
| Suburban Chicago Chi..> | 2024-10-04 11:53 | 160K | |
| Suburban Chicago Doc..> | 2024-10-04 11:53 | 160K | |
| Suburban Chicago Phy..> | 2024-10-04 11:53 | 139K | |
| Suburban Physician I..> | 2024-10-04 11:53 | 20K | |
| Suburban_CHI_Couple_..> | 2024-10-04 11:53 | 165K | |
| Suburban_Chicago_Dr_..> | 2024-10-04 11:53 | 159K | |
| Suburban_Chicago_Man..> | 2024-10-04 11:53 | 92K | |
| Suburban_Doctor_Char..> | 2024-10-04 11:53 | 81K | |
| Sumerour Trial NDTX ..> | 2024-10-04 11:53 | 109K | |
| Sunderlage bankruptc..> | 2024-10-04 11:53 | 58K | |
| Sunnyvale_Man_Senten..> | 2024-10-04 11:53 | 89K | |
| Superseding_Indictme..> | 2024-10-04 11:53 | 258K | |
| Supersiding_Indictme..> | 2024-10-04 11:53 | 167K | |
| Sutter County Women ..> | 2024-10-04 11:53 | 25K | |
| TENNESSEE COUPLE SEN..> | 2024-10-04 11:53 | 35K | |
| TEXAS MAN SENTENCED ..> | 2024-10-04 11:53 | 63K | |
| TX_Woman_Sentenced_U..> | 2024-10-04 11:53 | 106K | |
| Tampa_FL_Man_Facing_..> | 2024-10-04 11:53 | 115K | |
| Tampa_Man_Sentenced_..> | 2024-10-04 11:53 | 107K | |
| Tampa_Men_Sentenced_..> | 2024-10-04 11:53 | 104K | |
| Tampa_Woman_Charged_..> | 2024-10-04 11:53 | 105K | |
| Tampa_Woman_Sentence..> | 2024-10-04 11:53 | 84K | |
| Taunton_Man_Charged_..> | 2024-10-04 11:53 | 192K | |
| Teamsters Indicated ..> | 2024-10-04 11:53 | 48K | |
| Tedesco Matthew and ..> | 2024-10-04 11:53 | 41K | |
| Ten Individuals Conv..> | 2024-10-04 11:53 | 47K | |
| Ten Members and Asso..> | 2024-10-04 11:53 | 515K | |
| Tewksbury Woman Plea..> | 2024-10-04 11:53 | 141K | |
| Tewksbury Woman Sent..> | 2024-10-04 11:53 | 111K | |
| Texan_Sentenced_CARE..> | 2024-10-04 11:53 | 98K | |
| Texas Man Arraigned ..> | 2024-10-04 11:53 | 484K | |
| Texas Man Indicted f..> | 2024-10-04 11:53 | 107K | |
| Texas Man Sentenced ..> | 2024-10-04 11:53 | 118K | |
| Texas Man Sentenced ..> | 2024-10-04 11:53 | 275K | |
| Texas_Defraud_NDCA.pdf | 2024-10-04 11:53 | 106K | |
| Texas_Man_Pleads_Gui..> | 2024-10-04 11:53 | 104K | |
| Texas_Man_Pleads_Gui..> | 2024-10-04 11:53 | 112K | |
| Texas_Man_Pleads_Gui..> | 2024-10-04 11:53 | 86K | |
| Texas_Man_Sentenced_..> | 2024-10-04 11:53 | 109K | |
| Texas_Woman_Pleads_G..> | 2024-10-04 11:53 | 88K | |
| Thirteen_Defendants_..> | 2024-10-04 11:53 | 120K | |
| Thirty Individuals A..> | 2024-10-04 11:53 | 190K | |
| Thomas Sudhan and Ap..> | 2024-10-04 11:53 | 42K | |
| Three Albuquerque Re..> | 2024-10-04 11:53 | 169K | |
| Three Family Members..> | 2024-10-04 11:53 | 40K | |
| Three Former Employe..> | 2024-10-04 11:53 | 62K | |
| Three Former Local 9..> | 2024-10-04 11:53 | 109K | |
| Three Indicted Arrai..> | 2024-10-04 11:53 | 81K | |
| Three Indicted in Im..> | 2024-10-04 11:53 | 30K | |
| Three Individuals In..> | 2024-10-04 11:53 | 498K | |
| Three Individuals Se..> | 2024-10-04 11:53 | 91K | |
| Three Labor Union.pdf | 2024-10-04 11:53 | 156K | |
| Three Sutter County ..> | 2024-10-04 11:53 | 105K | |
| Three_California_Res..> | 2024-10-04 11:53 | 90K | |
| Three_Charged_Steali..> | 2024-10-04 11:53 | 104K | |
| Three_Charged_in_All..> | 2024-10-04 11:53 | 280K | |
| Three_Defendants_Cha..> | 2024-10-04 11:53 | 278K | |
| Three_Defendants_Cha..> | 2024-10-04 11:53 | 262K | |
| Three_Defendants_Sen..> | 2024-10-04 11:53 | 115K | |
| Three_Former_Executi..> | 2024-10-04 11:53 | 230K | |
| Three_Indicted_Force..> | 2024-10-04 11:53 | 127K | |
| Three_Men_Arrested_i..> | 2024-10-04 11:53 | 266K | |
| Three_Men_Indicted_i..> | 2024-10-04 11:53 | 265K | |
| Three_Men_Sentenced_..> | 2024-10-04 11:53 | 101K | |
| Three_Plead_Guilty_H..> | 2024-10-04 11:53 | 163K | |
| Three_men_sentenced_..> | 2024-10-04 11:53 | 128K | |
| Timeshare Consulting..> | 2024-10-04 11:53 | 41K | |
| Tishman DPA Press Re..> | 2024-10-04 11:53 | 61K | |
| Tracy Woman Pleads G..> | 2024-10-04 11:53 | 493K | |
| Tracy Woman Sentence..> | 2024-10-04 11:53 | 76K | |
| Tracy_Woman_Indicted..> | 2024-10-04 11:53 | 106K | |
| Transit_Union_Plea.pdf | 2024-10-04 11:53 | 96K | |
| Traveling carnival b..> | 2024-10-04 11:53 | 527K | |
| Troy Man Arraigned o..> | 2024-10-04 11:53 | 72K | |
| Troy Man Indicted fo..> | 2024-10-04 11:53 | 491K | |
| Troy Man Pleads Guil..> | 2024-10-04 11:53 | 54K | |
| Troy Man Pleads Guil..> | 2024-10-04 11:53 | 103K | |
| Troy Man Pleads Guil..> | 2024-10-04 11:53 | 493K | |
| Troy_Man_Sentenced_f..> | 2024-10-04 11:53 | 141K | |
| TuckerJoanneSentence..> | 2024-10-04 11:53 | 81K | |
| TuckerShaunSentenceP..> | 2024-10-04 11:53 | 84K | |
| Tulsa_OK_Man Sentenc..> | 2024-10-04 11:53 | 496K | |
| Turner Woman Sentenc..> | 2024-10-04 11:53 | 70K | |
| Twenty Seven Indiana..> | 2024-10-04 11:53 | 101K | |
| Twenty White County ..> | 2024-10-04 11:53 | 48K | |
| Twenty_Arrested_Char..> | 2024-10-04 11:53 | 110K | |
| Twin_Brothers_Facing..> | 2024-10-04 11:53 | 296K | |
| Two Boston City Hall..> | 2024-10-04 11:53 | 106K | |
| Two Boston City Hall..> | 2024-10-04 11:53 | 106K | |
| Two Capital Region M..> | 2024-10-04 11:53 | 143K | |
| Two Charged With 12M..> | 2024-10-04 11:53 | 486K | |
| Two Chicago Women He..> | 2024-10-04 11:53 | 131K | |
| Two Convicted of Rom..> | 2024-10-04 11:53 | 139K | |
| Two Dallas Area Clin..> | 2024-10-04 11:53 | 123K | |
| Two Dallas Area Clin..> | 2024-10-04 11:53 | 230K | |
| Two Defendants Charg..> | 2024-10-04 11:53 | 160K | |
| Two Defendants Plead..> | 2024-10-04 11:53 | 96K | |
| Two Defendants Plead..> | 2024-10-04 11:53 | 59K | |
| Two Delano Residents..> | 2024-10-04 11:53 | 41K | |
| Two Former Fiat Chry..> | 2024-10-04 11:53 | 116K | |
| Two Former Missouri ..> | 2024-10-04 11:53 | 523K | |
| Two Georgians indict..> | 2024-10-04 11:53 | 165K | |
| Two Houston Resident..> | 2024-10-04 11:53 | 99K | |
| Two Jacksonville Com..> | 2024-10-04 11:53 | 130K | |
| Two Labor Union Offi..> | 2024-10-04 11:53 | 51K | |
| Two Men Convicted of..> | 2024-10-04 11:53 | 79K | |
| Two Men Plead Guilty..> | 2024-10-04 11:53 | 111K | |
| Two Men Sentenced fo..> | 2024-10-04 11:53 | 101K | |
| Two Men Sentenced fo..> | 2024-10-04 11:53 | 319K | |
| Two More Sentenced F..> | 2024-10-04 11:53 | 41K | |
| Two Nigerian Nationa..> | 2024-10-04 11:53 | 392K | |
| Two Nigerian citizen..> | 2024-10-04 11:53 | 150K | |
| Two Pharmaceutical E..> | 2024-10-04 11:53 | 26K | |
| Two Stockton Men Cha..> | 2024-10-04 11:53 | 25K | |
| Two Suburban Chicago..> | 2024-10-04 11:53 | 490K | |
| Two Texas Men Senten..> | 2024-10-04 11:53 | 42K | |
| Two Union Officials ..> | 2024-10-04 11:53 | 23K | |
| Two former labor uni..> | 2024-10-04 11:53 | 29K | |
| TwoContractorsAndOne..> | 2024-10-04 11:53 | 57K | |
| Two_Allentown_Reside..> | 2024-10-04 11:53 | 161K | |
| Two_Burlington_Count..> | 2024-10-04 11:53 | 266K | |
| Two_Camden_County_Re..> | 2024-10-04 11:53 | 89K | |
| Two supervisors at a..> | 2024-10-04 11:53 | 117K | |
| Two_Charged_Particip..> | 2024-10-04 11:53 | 105K | |
| Two_Charged_Submitti..> | 2024-10-04 11:53 | 107K | |
| Two_Chicago_Physicia..> | 2024-10-04 11:53 | 102K | |
| Two_Defendants_Charg..> | 2024-10-04 11:53 | 107K | |
| Two_Defendants_Sente..> | 2024-10-04 11:53 | 259K | |
| Two_Felons_Admit_Gui..> | 2024-10-04 11:53 | 265K | |
| Two_Firefighters_Sen..> | 2024-10-04 11:53 | 160K | |
| Two_Former_Directors..> | 2024-10-04 11:53 | 169K | |
| Two_Hondurans_Senten..> | 2024-10-04 11:53 | 262K | |
| Two_Individuals_Conv..> | 2024-10-04 11:53 | 133K | |
| Two_Marketers_Senten..> | 2024-10-04 11:53 | 99K | |
| Two_Men_Charged_With..> | 2024-10-04 11:53 | 85K | |
| Two_NJ_Men_Admit_Hea..> | 2024-10-04 11:53 | 105K | |
| Two_New_Jersey_Men_A..> | 2024-10-04 11:53 | 322K | |
| Two_Niagara_County_M..> | 2024-10-04 11:53 | 108K | |
| Two_Niagara_County_M..> | 2024-10-04 11:53 | 108K | |
| Two_Postal_Employees..> | 2024-10-04 11:53 | 103K | |
| Two_Postal_Employees..> | 2024-10-04 11:53 | 157K | |
| Two_Postal_Service_E..> | 2024-10-04 11:53 | 114K | |
| Two_SCI_Inmates_Two_..> | 2024-10-04 11:53 | 97K | |
| Two_Sentenced_Conspi..> | 2024-10-04 11:53 | 106K | |
| Two_Stoneham_Residen..> | 2024-10-04 11:53 | 84K | |
| Two_Tampa_Men_Plead_..> | 2024-10-04 11:53 | 85K | |
| Two_VA_Inmates_Plead..> | 2024-10-04 11:53 | 82K | |
| Two_Women_Charged_Wi..> | 2024-10-04 11:53 | 93K | |
| Two_arraigned_in_3_m..> | 2024-10-04 11:53 | 269K | |
| Two_felons_sentenced..> | 2024-10-04 11:53 | 93K | |
| U.S. Attorney Announ..> | 2024-10-04 11:53 | 201K | |
| U.S. Attorney's Offi..> | 2024-10-04 11:53 | 81K | |
| U.S. Attorney Announ..> | 2024-10-04 11:53 | 188K | |
| U.S. Attorney Wagner..> | 2024-10-04 11:53 | 281K | |
| U.S. Attorney Wifred..> | 2024-10-04 11:53 | 37K | |
| U.S. Postal Service ..> | 2024-10-04 11:53 | 147K | |
| U.S._Attorney_Announ..> | 2024-10-04 11:53 | 296K | |
| UAW_Kickbacks_Senten..> | 2024-10-04 11:53 | 268K | |
| UI Program Letter 50..> | 2024-10-04 11:53 | 1.0M | |
| USAO EDLA Press Rele..> | 2024-10-04 11:53 | 702K | |
| US Army Veteran And ..> | 2024-10-04 11:53 | 80K | |
| US Attorney Federal ..> | 2024-10-04 11:53 | 121K | |
| US Attorneys Office ..> | 2024-10-04 11:53 | 138K | |
| USAO_D-PR_Release.pdf | 2024-10-04 11:53 | 109K | |
| USAO_D_MA_Malden_Man..> | 2024-10-04 11:53 | 83K | |
| USAO_D_NJ_Morris_Cou..> | 2024-10-04 11:53 | 121K | |
| USAO_ED_ CA_Rosevill..> | 2024-10-04 11:53 | 83K | |
| USAO_ED_MI_Former_In..> | 2024-10-04 11:53 | 98K | |
| USAO_Georgia_Man_Ind..> | 2024-10-04 11:53 | 172K | |
| USAO_OWCP_Release.pdf | 2024-10-04 11:53 | 114K | |
| USAO_SD_FL_South_Flo..> | 2024-10-04 11:53 | 162K | |
| USPS Employee Senten..> | 2024-10-04 11:53 | 503K | |
| USPS_Employee_Indict..> | 2024-10-04 11:53 | 78K | |
| US_Attorney_Announce..> | 2024-10-04 11:53 | 449K | |
| US_Atty_Presents_Law..> | 2024-10-04 11:53 | 152K | |
| US_Law_Enforcement_D..> | 2024-10-04 11:53 | 185K | |
| US_Law_Enforcement_T..> | 2024-10-04 11:53 | 207K | |
| US_Reaches_Settlemen..> | 2024-10-04 11:53 | 272K | |
| US_Secret_Service_He..> | 2024-10-04 11:53 | 178K | |
| UTC_settlement_civil..> | 2024-10-04 11:53 | 116K | |
| Undocumented_Individ..> | 2024-10-04 11:53 | 265K | |
| Union Bookkeeper Who..> | 2024-10-04 11:53 | 20K | |
| Union Employee Sente..> | 2024-10-04 11:53 | 39K | |
| Union Officer Pleads..> | 2024-10-04 11:53 | 21K | |
| Union Officer to Ple..> | 2024-10-04 11:53 | 20K | |
| Union Official Plead..> | 2024-10-04 11:53 | 20K | |
| Union Officials Plea..> | 2024-10-04 11:53 | 98K | |
| Union Treasurer Sent..> | 2024-10-04 11:53 | 17K | |
| Union_Members_Plead_..> | 2024-10-04 11:53 | 103K | |
| United States Attorn..> | 2024-10-04 11:53 | 159K | |
| United States Attorn..> | 2024-10-04 11:53 | 261K | |
| United States Attorn..> | 2024-10-04 11:53 | 130K | |
| United States Postal..> | 2024-10-04 11:53 | 19K | |
| United States Resolv..> | 2024-10-04 11:53 | 122K | |
| United_States_Files_..> | 2024-10-04 11:53 | 267K | |
| University_City_Man_..> | 2024-10-04 11:53 | 158K | |
| Urbanski Steven Hodn..> | 2024-10-04 11:53 | 38K | |
| Utah County Business..> | 2024-10-04 11:53 | 508K | |
| Utah Restaurant Owne..> | 2024-10-04 11:53 | 110K | |
| VA_Beach_Woman_Sente..> | 2024-10-04 11:53 | 107K | |
| VA_Inmate_Sentenced_..> | 2024-10-04 11:53 | 84K | |
| VILLANUEVA Guilty Pl..> | 2024-10-04 11:53 | 53K | |
| Valenti Michael Plea..> | 2024-10-04 11:53 | 42K | |
| Vertuccio Guilty Ple..> | 2024-10-04 11:53 | 55K | |
| Vertuccio Takedown P..> | 2024-10-04 11:53 | 243K | |
| Vice President of Lo..> | 2024-10-04 11:53 | 68K | |
| Vice President of Lo..> | 2024-10-04 11:53 | 35K | |
| Victorville Woman Ar..> | 2024-10-04 11:53 | 164K | |
| Victorville_Woman_Se..> | 2024-10-04 11:53 | 166K | |
| Violent Detroit Stre..> | 2024-10-04 11:53 | 182K | |
| Virginia Beach Woman..> | 2024-10-04 11:53 | 166K | |
| Virginia Immigration..> | 2024-10-04 11:53 | 24K | |
| Virginia Man Admits ..> | 2024-10-04 11:53 | 20K | |
| Virginia_Company_Pay..> | 2024-10-04 11:53 | 106K | |
| Virginia_Inmate_Plea..> | 2024-10-04 11:53 | 88K | |
| Virginia_Man_Sentenc..> | 2024-10-04 11:53 | 85K | |
| Virginia_Woman_Plead..> | 2024-10-04 11:53 | 89K | |
| Vista_Man_Pleads_Gui..> | 2024-10-04 11:53 | 113K | |
| WHD_Plea_CDCA.pdf | 2024-10-04 11:53 | 88K | |
| WTC USAO EDVA Press ..> | 2024-10-04 11:53 | 110K | |
| WV_Woman_Admits_Fili..> | 2024-10-04 11:53 | 256K | |
| Washington Business ..> | 2024-10-04 11:53 | 26K | |
| Washington County Bu..> | 2024-10-04 11:53 | 60K | |
| Washington man who s..> | 2024-10-04 11:53 | 85K | |
| Washington_County_Bu..> | 2024-10-04 11:53 | 258K | |
| Waterbury Man Admits..> | 2024-10-04 11:53 | 160K | |
| Waterbury Man Senten..> | 2024-10-04 11:53 | 123K | |
| Waterbury_Man_Charge..> | 2024-10-04 11:53 | 100K | |
| Watervliet Woman Cha..> | 2024-10-04 11:53 | 159K | |
| Wayne County Man Cha..> | 2024-10-04 11:53 | 161K | |
| Wayne County Man Sen..> | 2024-10-04 11:53 | 109K | |
| Wellington.pdf | 2024-10-04 11:53 | 13K | |
| West Boylston Man Pl..> | 2024-10-04 11:53 | 159K | |
| West NY Financial Ad..> | 2024-10-04 11:53 | 572K | |
| West Palm Beach Man ..> | 2024-10-04 11:53 | 54K | |
| West Palm Beach Man ..> | 2024-10-04 11:53 | 20K | |
| West Roxbury Man Ple..> | 2024-10-04 11:53 | 497K | |
| West Suburban Dermat..> | 2024-10-04 11:53 | 108K | |
| West_Warwick_Man_Ind..> | 2024-10-04 11:53 | 108K | |
| West_Warwick_Man_Sen..> | 2024-10-04 11:53 | 109K | |
| Westmoreland_County_..> | 2024-10-04 11:53 | 255K | |
| Westwego Woman Indic..> | 2024-10-04 11:53 | 89K | |
| Wife of Former UAW V..> | 2024-10-04 11:53 | 49K | |
| Wife of Former UAW V..> | 2024-10-04 11:53 | 53K | |
| Williamsburg_Busines..> | 2024-10-04 11:53 | 108K | |
| Winter Garden Man Se..> | 2024-10-04 11:53 | 487K | |
| Wise_County_Man_Plea..> | 2024-10-04 11:53 | 260K | |
| Wise_County_Man_Sent..> | 2024-10-04 11:53 | 86K | |
| Wiseman Garrett Sent..> | 2024-10-04 11:53 | 35K | |
| Woburn Restaurant Ow..> | 2024-10-04 11:53 | 87K | |
| Woman Admits Multimi..> | 2024-10-04 11:53 | 93K | |
| Woman Sentenced for ..> | 2024-10-04 11:53 | 44K | |
| Woman_Pleads_Guilty_..> | 2024-10-04 11:53 | 285K | |
| Woman_Pleads_Guilty_..> | 2024-10-04 11:53 | 262K | |
| Woman admits to subm..> | 2024-10-04 11:53 | 79K | |
| Woman and Her Two Da..> | 2024-10-04 11:53 | 495K | |
| Woman and Her Two Da..> | 2024-10-04 11:53 | 124K | |
| Woman_Previously_Cha..> | 2024-10-04 11:53 | 109K | |
| Woman_Serving_Life_P..> | 2024-10-04 11:53 | 146K | |
| Woodbridge Man Plead..> | 2024-10-04 11:53 | 85K | |
| Woodbridge man plead..> | 2024-10-04 11:53 | 103K | |
| Woodbury Woman Plead..> | 2024-10-04 11:53 | 28K | |
| Woodbury Woman Sente..> | 2024-10-04 11:53 | 57K | |
| Woonsocket_Businessm..> | 2024-10-04 11:53 | 265K | |
| Woonsocket_Businessm..> | 2024-10-04 11:53 | 85K | |
| Worcester Man Senten..> | 2024-10-04 11:53 | 492K | |
| Wright State Univers..> | 2024-10-04 11:53 | 231K | |
| Yonkers Man Pleads G..> | 2024-10-04 11:53 | 160K | |
| Yonkers Man Sentence..> | 2024-10-04 11:53 | 496K | |
| carrasco perjury GP_..> | 2024-10-04 11:53 | 35K | |
| carrasco sent_7_26_1..> | 2024-10-04 11:53 | 33K | |
| dayton-couple-charge..> | 2024-10-04 11:53 | 115K | |
| former.pdf | 2024-10-04 11:53 | 181K | |
| huniskcer joel sent_..> | 2024-10-04 11:53 | 32K | |
| lutz roofing 11.03.1..> | 2024-10-04 11:53 | 256K | |
| moving-company-owner..> | 2024-10-04 11:53 | 110K | |
| roofing.pdf | 2024-10-04 11:53 | 17K | |
| york john sen.pdf | 2024-10-04 11:53 | 96K | |
| Leader Of Yoga To Th..> | 2024-10-07 09:01 | 141K | |
| Maryland Man Facing ..> | 2024-10-07 09:01 | 126K | |
| Mexican National Ple..> | 2024-10-07 17:52 | 83K | |
| York County Judge In..> | 2024-10-08 15:23 | 223K | |
| Leader of an Interna..> | 2024-10-09 10:18 | 87K | |
| Annual Awards Ceremo..> | 2024-10-11 13:51 | 90K | |
| Iowa Farmer Sentence..> | 2024-10-15 09:18 | 102K | |
| Ex-Husband of RHNJ S..> | 2024-10-16 08:26 | 98K | |
| Former NYCHA Superin..> | 2024-10-21 08:40 | 122K | |
| Portland Man Sentenc..> | 2024-10-21 09:23 | 102K | |
| Bank Manager Sentenc..> | 2024-10-21 15:51 | 86K | |
| Three Indicted for U..> | 2024-10-22 16:45 | 79K | |
| New York Doctor Char..> | 2024-10-23 13:16 | 81K | |
| Mexican National Adm..> | 2024-10-25 08:13 | 81K | |
| Georgia Woman Senten..> | 2024-10-25 14:30 | 94K | |
| Owner of Boston Pizz..> | 2024-10-28 10:42 | 101K | |
| Atlantic County Doct..> | 2024-10-30 14:32 | 83K | |
| New Jersey Man Convi..> | 2024-10-30 15:51 | 84K | |
| Former Officer Plead..> | 2024-10-31 08:20 | 87K | |
| Mexican National Ple..> | 2024-11-04 18:06 | 74K | |
| Rocky Hill Pharmacy ..> | 2024-11-05 07:31 | 82K | |
| San Bernardino Count..> | 2024-11-06 08:26 | 94K | |
| Executive of Louisia..> | 2024-11-14 08:43 | 108K | |
| Florida Woman Pleads..> | 2024-11-14 08:43 | 127K | |
| Trio sentenced to pr..> | 2024-11-14 16:17 | 87K | |
| Woburn Men Plead Gui..> | 2024-11-15 08:42 | 82K | |
| Las Vegas Woman Plea..> | 2024-11-15 08:43 | 85K | |
| Vietnamese National ..> | 2024-11-19 08:40 | 105K | |
| Boston Man Sentenced..> | 2024-11-19 08:42 | 88K | |
| West New York Financ..> | 2024-11-19 13:32 | 100K | |
| Mexican National Adm..> | 2024-11-25 08:14 | 106K | |
| Second Former NYCHA ..> | 2024-11-25 08:15 | 131K | |
| CEO of Non-Profit th..> | 2024-11-26 08:55 | 109K | |
| Podiatrist and Patie..> | 2024-12-04 16:57 | 83K | |
| Bank contractor indi..> | 2024-12-05 08:05 | 86K | |
| Postal Employee Plea..> | 2024-12-06 08:01 | 95K | |
| Previously Convicted..> | 2024-12-09 17:45 | 109K | |
| Owner of Medford Con..> | 2024-12-11 08:03 | 81K | |
| Suffolk County Corre..> | 2024-12-13 11:53 | 101K | |
| Third Former NYCHA S..> | 2024-12-16 08:27 | 120K | |
| Nationwide Lawsuit F..> | 2024-12-18 16:00 | 96K | |
| Clinton Man Sentence..> | 2024-12-18 17:21 | 79K | |
| Troy Man Charged Wit..> | 2024-12-20 08:48 | 98K | |
| Boston Man Sentenced..> | 2024-12-20 08:48 | 100K | |
| Chicago Attorney Ind..> | 2024-12-20 08:48 | 97K | |
| Two Maryland Men Ind..> | 2024-12-20 14:47 | 92K | |
| First of Multiple In..> | 2024-12-27 08:45 | 78K | |
| Drug Wholesaler Agre..> | 2024-12-31 08:26 | 87K | |
| Georgia Man Sentence..> | 2025-01-06 19:18 | 89K | |
| DOL-OIG_Press_Releas..> | 2025-01-08 09:06 | 202K | |
| DOL-OIG_Press_Releas..> | 2025-01-08 09:06 | 202K | |
| Former State Governm..> | 2025-01-10 07:47 | 88K | |
| Edinburg doctor and ..> | 2025-01-14 08:59 | 67K | |
| Pharmacist guilty in..> | 2025-01-21 08:29 | 75K | |
| Justice Department F..> | 2025-01-21 08:30 | 125K | |
| Houston Woman Senten..> | 2025-01-22 17:11 | 71K | |
| Pain-Management Doct..> | 2025-01-23 08:40 | 97K | |
| Kapolei Woman Indict..> | 2025-01-27 09:19 | 82K | |
| Boston Gang Member P..> | 2025-01-28 12:36 | 77K | |
| Nigerian who defraud..> | 2025-01-29 08:43 | 95K | |
| One Defendant Pleads..> | 2025-01-29 16:09 | 89K | |
| General President of..> | 2025-01-29 17:15 | 80K | |
| Schenectady Man Char..> | 2025-01-30 14:59 | 90K | |
| Two Men Indicted for..> | 2025-01-31 09:25 | 87K | |
| Former NYCHA Superin..> | 2025-02-03 08:16 | 102K | |
| Serial Fraudster Sen..> | 2025-02-03 13:18 | 97K | |
| Convicted of a Drive..> | 2025-02-03 14:41 | 115K | |
| Malden Woman Sentenc..> | 2025-02-04 13:21 | 83K | |
| Siblings Plead Guilt..> | 2025-02-05 13:05 | 80K | |
| Former Massachusetts..> | 2025-02-10 09:14 | 103K | |
| Two Arizona DES Empl..> | 2025-02-11 15:50 | 92K | |
| Boston Man Pleads Gu..> | 2025-02-12 15:19 | 88K | |
| Albany Woman Pleads ..> | 2025-02-13 13:41 | 77K | |
| Political Organizer ..> | 2025-02-14 08:58 | 103K | |
| Boston Woman Sentenc..> | 2025-02-14 08:58 | 84K | |
| Haverhill Man Pleads..> | 2025-02-14 08:58 | 78K | |
| Sacramento Woman Ple..> | 2025-02-14 08:59 | 81K | |
| Convicted Felon Admi..> | 2025-02-14 14:58 | 88K | |
| Daytona Beach Man Se..> | 2025-02-19 08:21 | 74K | |
| Detroit Man Sentence..> | 2025-02-19 15:35 | 82K | |
| Florida Businessman ..> | 2025-02-21 07:50 | 101K | |
| NW Arkansas Man Sent..> | 2025-02-24 16:08 | 82K | |
| Hartford Man Admits ..> | 2025-02-25 08:09 | 78K | |
| Owner of Boston Area..> | 2025-02-26 08:24 | 85K | |
| Longtime Gang Member..> | 2025-02-26 08:26 | 85K | |
| Former NYCHA Superin..> | 2025-02-26 17:05 | 98K | |
| Citrus Heights Woman..> | 2025-02-27 15:29 | 79K | |
| Man Sentenced to Thr..> | 2025-03-03 11:04 | 83K | |
| Nigerian Man Charged..> | 2025-03-04 07:52 | 82K | |
| Scranton Man Sentenc..> | 2025-03-04 07:53 | 72K | |
| Shelton Man Admits F..> | 2025-03-04 07:53 | 87K | |
| 5 Charged in Alleged..> | 2025-03-07 08:36 | 133K | |
| Immigration-Related ..> | 2025-03-07 08:39 | 127K | |
| New Jersey Man Sente..> | 2025-03-10 08:32 | 86K | |
| VA Firefighter Admit..> | 2025-03-10 08:32 | 79K | |
| Mexican National Inv..> | 2025-03-10 08:32 | 75K | |
| Texas Pharmacist Sen..> | 2025-03-11 08:08 | 95K | |
| Hampton man sentence..> | 2025-03-13 07:51 | 85K | |
| Chester Woman Charge..> | 2025-03-13 08:53 | 248K | |
| Ringleader of 6.2M U..> | 2025-03-13 16:01 | 80K | |
| Two Executives Of Lo..> | 2025-03-17 08:33 | 85K | |
| Las Vegas Man Indict..> | 2025-03-17 08:40 | 84K | |
| Hot Springs Man Sent..> | 2025-03-17 13:14 | 75K | |
| Baltimore Man Senten..> | 2025-03-18 08:50 | 96K | |
| Pawtucket Man Pleads..> | 2025-03-19 08:43 | 83K | |
| Brazilian National A..> | 2025-03-19 08:43 | 78K | |
| Two Consulting Compa..> | 2025-03-21 08:46 | 103K | |
| Four Individuals Sen..> | 2025-03-21 08:46 | 139K | |
| Nigerian National Ch..> | 2025-03-24 15:17 | 74K | |
| Albany Man Pleads Gu..> | 2025-03-25 07:31 | 79K | |
| Fraud Conspiracy Lea..> | 2025-03-25 15:12 | 82K | |
| Defendant Who Failed..> | 2025-03-26 08:15 | 76K | |
| Florida Man Pleads G..> | 2025-03-27 08:01 | 118K | |
| 15 charged in scheme..> | 2025-03-27 13:43 | 90K | |
| Florida Man Who Boug..> | 2025-03-28 08:02 | 121K | |
| Leader Of $23 Millio..> | 2025-03-28 08:38 | 100K | |
| Former EDD Employee ..> | 2025-03-28 14:37 | 100K | |
| Las Vegas Man Senten..> | 2025-03-31 09:12 | 83K | |
| Woburn Men Sentenced..> | 2025-03-31 10:03 | 79K | |
| Oakland Woman Who Ma..> | 2025-04-01 08:15 | 82K | |
| Florida couple plead..> | 2025-04-02 15:53 | 82K | |
| Maryland Man Pleads ..> | 2025-04-02 15:54 | 95K | |
| Owner of Boston Area..> | 2025-04-03 08:33 | 77K | |
| New Britain Woman Ad..> | 2025-04-04 08:05 | 102K | |
| New York Man Sentenc..> | 2025-04-04 08:07 | 103K | |
| Former Bureau of Lab..> | 2025-04-04 08:08 | 100K | |
| MD Man Sentenced to ..> | 2025-04-07 09:09 | 95K | |
| Brooklyn-Based Nined..> | 2025-04-09 18:25 | 90K | |
| Ten People Charged w..> | 2025-04-10 08:44 | 154K | |
| Previously Convicted..> | 2025-04-10 09:45 | 111K | |
| H Block Gang Member ..> | 2025-04-11 07:46 | 100K | |
| Mexican National Sen..> | 2025-04-14 08:56 | 81K | |
| Delaware Woman Admit..> | 2025-04-17 08:16 | 84K | |
| Norfolk man sentence..> | 2025-04-17 11:14 | 82K | |
| H Block Gang Member ..> | 2025-04-21 09:14 | 86K | |
| Walgreens Agrees to ..> | 2025-04-21 14:26 | 125K | |
| Pontiac Man Pleads G..> | 2025-04-24 08:25 | 83K | |
| Nigerian Man Pleads ..> | 2025-04-24 08:27 | 86K | |
| Citrus Heights Man P..> | 2025-04-25 08:42 | 91K | |
| 4 Southern Californi..> | 2025-04-25 08:50 | 115K | |
| Ex-Congressman Georg..> | 2025-04-28 08:03 | 112K | |
| Rhode Island Man Adm..> | 2025-04-28 08:05 | 81K | |
| Florida Woman Senten..> | 2025-04-28 16:33 | 98K | |
| False disaster relie..> | 2025-05-02 11:00 | 75K | |
| Ringleader of PPP Fr..> | 2025-05-05 09:28 | 89K | |
| Former NYCHA Superin..> | 2025-05-07 07:47 | 97K | |
| Hancock County Man S..> | 2025-05-08 08:38 | 74K | |
| Four Sentenced in 11..> | 2025-05-09 08:05 | 103K | |
| Self-Described Pasto..> | 2025-05-12 09:15 | 107K | |
| Three Baton Rouge In..> | 2025-05-12 09:15 | 85K | |
| Former State Governm..> | 2025-05-12 09:15 | 90K | |
| Former State Employe..> | 2025-05-13 08:15 | 89K | |
| Brazilian National P..> | 2025-05-14 08:45 | 81K | |
| East Point, Georgia ..> | 2025-05-14 14:01 | 82K | |
| Baltimore Man Pleads..> | 2025-05-15 09:43 | 97K | |
| Honduran Man Pleads ..> | 2025-05-15 17:20 | 76K | |
| Manchester Man Sente..> | 2025-05-16 08:13 | 136K | |
| Westwego Woman Guilt..> | 2025-05-20 07:52 | 90K | |
| Mexican National Sen..> | 2025-05-20 07:52 | 85K | |
| Brooklyn Man Sentenc..> | 2025-05-21 15:20 | 90K | |
| California Man Sente..> | 2025-05-22 07:28 | 86K | |
| Final Defendant Plea..> | 2025-05-22 18:13 | 88K | |
| Three Sentenced for ..> | 2025-05-27 08:29 | 90K | |
| Jury Convicts Canadi..> | 2025-05-27 08:30 | 80K | |
| Las Vegas Man Pleads..> | 2025-05-27 08:32 | 78K | |
| Four Individuals Cha..> | 2025-05-27 08:32 | 84K | |
| Two Texas Residents ..> | 2025-05-27 08:33 | 85K | |
| Construction Manager..> | 2025-05-29 08:07 | 105K | |
| Former NYCHA Superin..> | 2025-05-29 08:09 | 96K | |
| Five Charged with Fa..> | 2025-05-30 07:56 | 345K | |
| Bergen County Man Se..> | 2025-06-02 09:00 | 83K | |
| Second Defendant Ple..> | 2025-06-03 07:52 | 84K | |
| California Man Sente..> | 2025-06-03 09:09 | 85K | |
| Colorado Man Pleads ..> | 2025-06-06 09:48 | 81K | |
| Lexington Man Pleads..> | 2025-06-09 08:56 | 88K | |
| Three Sentenced for ..> | 2025-06-09 08:56 | 80K | |
| Ohio Company Sentenc..> | 2025-06-09 14:59 | 80K | |
| Passaic County Lawye..> | 2025-06-10 08:46 | 83K | |
| Husband and wife ple..> | 2025-06-16 16:39 | 77K | |
| Conspirators sentenc..> | 2025-06-16 16:53 | 87K | |
| Eight Members and As..> | 2025-06-16 16:53 | 118K | |
| Former State Employe..> | 2025-06-17 07:29 | 81K | |
| Forrest County Sibli..> | 2025-06-17 07:54 | 85K | |
| Leessa Augustine, Fo..> | 2025-06-17 17:38 | 85K | |
| Former SBA Employee ..> | 2025-06-18 08:12 | 91K | |
| Riverside County Wom..> | 2025-06-20 07:53 | 91K | |
| Wesley Chapel Woman ..> | 2025-06-23 08:04 | 76K | |
| Miami Man Sentenced ..> | 2025-06-25 07:48 | 96K | |
| Middlesex County Wom..> | 2025-06-26 10:32 | 83K | |
| Former Employee of t..> | 2025-06-26 10:32 | 76K | |
| Members of Violent â..> | 2025-06-27 08:10 | 105K | |
| Boston Gang Member S..> | 2025-06-27 08:12 | 101K | |
| Brazilian National S..> | 2025-06-30 07:59 | 78K | |
| Leader of Yoga to th..> | 2025-06-30 15:18 | 95K | |
| National Health Care..> | 2025-07-01 08:06 | 114K | |
| Three West Tennessee..> | 2025-07-01 08:07 | 103K | |
| AG Nessel Announces ..> | 2025-07-02 08:03 | 143K | |
| Tolland Man Charged ..> | 2025-07-03 08:26 | 96K | |
| Social Security Admi..> | 2025-07-03 08:27 | 97K | |
| Virginia Man Sentenc..> | 2025-07-03 08:27 | 116K | |
| Inglewood Woman Arre..> | 2025-07-08 13:45 | 94K | |
| Live Entertainment C..> | 2025-07-10 09:00 | 90K | |
| H Block Gang Member ..> | 2025-07-11 08:15 | 85K | |
| Weymouth Man Pleads ..> | 2025-07-16 08:02 | 101K | |
| Former Longshoreman ..> | 2025-07-16 14:29 | 87K | |
| Owners of Northern A..> | 2025-07-17 14:38 | 98K | |
| Former Amtrak Employ..> | 2025-07-18 09:38 | 93K | |
| Former veteran’s s..> | 2025-07-21 07:54 | 114K | |
| Bank contractor sent..> | 2025-07-23 08:42 | 94K | |
| Prince George’s Ma..> | 2025-07-24 08:03 | 107K | |
| Political Organizer ..> | 2025-07-24 09:20 | 115K | |
| Former LWC Subcontra..> | 2025-07-25 07:59 | 101K | |
| Longtime Gang Member..> | 2025-07-29 09:04 | 99K | |
| Five People Indicted..> | 2025-07-29 09:04 | 97K | |
| Honduran National Pl..> | 2025-07-31 08:14 | 94K | |
| Federal Grand Jury i..> | 2025-08-01 08:00 | 98K | |
| CEO and Medical Dire..> | 2025-08-01 08:15 | 97K | |
| H-Block Gang Member ..> | 2025-08-01 08:17 | 98K | |
| Nanticoke Man Charge..> | 2025-08-01 10:18 | 95K | |
|
|---|